mirror of
https://github.com/gnh1201/welsonjs.git
synced 2024-11-26 15:31:42 +00:00
fix many things
This commit is contained in:
parent
839bdcc69d
commit
e44554f981
|
|
@ -65,11 +65,6 @@ C:\Users\John\Documents\GitHub\welsonjs> cscript app.js sayhello
|
|||
hello
|
||||
```
|
||||
|
||||
## Showcases
|
||||
|
||||
|
||||
|
||||
|
||||
## Related projects
|
||||
- [gnh1201/wsh-js-gtk](https://catswords.re.kr/go/wshjsgtk) - GTK GUI ported to Windows Scripting Host - Javascript (Microsoft JScript) (wsh-js)
|
||||
- [gnh1201/wsh-json](https://catswords.re.kr/go//wshjson) - JSON stringify/parse (encode/decode) for Windows Scripting Host
|
||||
|
|
|
|||
|
|
@ -1,75 +0,0 @@
|
|||
# welsonjs
|
||||
WelsonJS - Build a Windows desktop apps with JavaScript, HTML, and CSS based on WSH/HTA
|
||||
|
||||
## Structure
|
||||
|
||||
|
||||
## Specifications
|
||||
- ES5(ECMAScript 5), ES6(ECMAScript 6) compatibility with [es5-shim](https://catswords.re.kr/go/es5shim), [es6-shim](https://catswords.re.kr/go/es6shim), and [json3](https://catswords.re.kr/go/json3)
|
||||
- HTML5/CSS3 compatibility with [html5shiv](https://catswords.re.kr/go/html5shiv), [jquery-html5-placeholder-shim](https://catswords.re.kr/go/placeholdershim), [respond](https://catswords.re.kr/go/respondjs), [selectivizr](https://catswords.re.kr/go/selectivizrjs), [excanvas](https://catswords.re.kr/go/excanvasjs), [html5media](https://catswords.re.kr/go/html5media), and [modernizr](https://catswords.re.kr/go/modernizrjs)
|
||||
- [module.exports](https://catswords.re.kr/go/whatisrequire)(Node) styled module implementation, and managing packages with [NPM(Node Package Manager)](https://catswords.re.kr/go/npmjs)
|
||||
- Ready to use on Windows machine immediately. No require additional softwares installation.
|
||||
|
||||
## Included libraries
|
||||
- lib/std (Standard library)
|
||||
- lib/system (System library)
|
||||
- lib/base64 (BASE64 Encode and Decode)
|
||||
- lib/db (Database interface)
|
||||
- lib/file (File I/O interface)
|
||||
- lib/http (HTTP interface)
|
||||
- lib/json (JSON Encode and Decode)
|
||||
- lib/registry (Windows Registry interface)
|
||||
- lib/security (Security Policy interface)
|
||||
- lib/sendmail (Sendmail interface with 3rdparty)
|
||||
- lib/shell (Command Prompt interface)
|
||||
- lib/timer (`setTimeout` implementation for not supported environment)
|
||||
- lib/powershell (Windows Powershell interface)
|
||||
- lib/service (Windows Service interface)
|
||||
- lib/oldbrowser (HTML/JS/CSS interface)
|
||||
- lib/uri (URI scheme interface)
|
||||
- lib/winlibs (Windows DLL(Dynamic-link library) interface)
|
||||
- lib/autohotkey ([AutoHotKey](https://catswords.re.kr/go/autohotkey) interface)
|
||||
- lib/autoit3 ([AutoIt3](https://catswords.re.kr/go/autoit3) interface)
|
||||
- lib/cloudflare ([Cloudflare Argo Tunnel](https://catswords.re.kr/go/argotunnel) interface)
|
||||
- lib/shadowsocks ([Shadowsocks](https://catswords.re.kr/go/shadowsocks) interface)
|
||||
- lib/excel (Microsoft Excel interface)
|
||||
|
||||
## Make your own `sayhello` example
|
||||
|
||||
### 1. Write a file `lib/sayhello-lib.js`
|
||||
```
|
||||
exports.VERSIONINFO = "sayhello library (sayhello-lib.js) version 0.1
|
||||
exports.global = global;
|
||||
exports.require = global.require;
|
||||
|
||||
exports.say = function() {
|
||||
console.log("hello");
|
||||
}
|
||||
```
|
||||
|
||||
### 2. Write a file `sayhello.js`
|
||||
```
|
||||
var sayhello = require("lib/sayhello-lib");
|
||||
exports.main = function() {
|
||||
sayhello.say();
|
||||
};
|
||||
```
|
||||
|
||||
### 3. Execute file on the command prompt
|
||||
```
|
||||
C:\Users\John\Documents\GitHub\welsonjs> cscript app.js sayhello
|
||||
hello
|
||||
```
|
||||
|
||||
## Related projects
|
||||
- [gnh1201/wsh-js-gtk](https://catswords.re.kr/go/wshjsgtk) - GTK GUI ported to Windows Scripting Host - Javascript (Microsoft JScript) (wsh-js)
|
||||
- [gnh1201/wsh-json](https://catswords.re.kr/go/wshjson) - JSON stringify/parse (encode/decode) for Windows Scripting Host
|
||||
- [redskyit/wsh-appjs](https://catswords.re.kr/go/wshappjs) - require-js and app framework for Windows Scripting Host JavaScript
|
||||
- [JohnLaTwC's gist](https://catswords.re.kr/go/johnlatwcgist) - JavaScript RAT
|
||||
- [JSMan-/JS-Framework](https://catswords.re.kr/go/jsmanfw) - No description
|
||||
- [iconjack/setTimeout-for-windows-script-host](https://catswords.re.kr/go/wshtimer) - Replacement for the missing setTimeout and clearTimeout function in Windows Script Host
|
||||
- [johnjohnsp1/RegistrationFreeCOM](https://catswords.re.kr/go/actctx) - Inject DLL Prototype using Microsoft.Windows.ACTCTX COM Object
|
||||
- [kuntashov/jsunit](https://catswords.re.kr/go/wshjsunit) - JSUnit port for Windows Scripting Host
|
||||
|
||||
## Contact me
|
||||
- gnh1201@gmail.com
|
||||
2
app.hta
2
app.hta
|
|
@ -59,7 +59,7 @@
|
|||
<link type="text/css" rel="stylesheet" href="app/style.css" />
|
||||
</head>
|
||||
<body>
|
||||
<div id="app"></div>
|
||||
<div id="app">#app</div>
|
||||
<script src="app.js" type="text/javascript" charset="utf-8"></script>
|
||||
<script type="text/javascript">//<!--<![CDATA[
|
||||
init_window("webloader", [WELSONJS_WINDOW.commandLine], 800, 600);
|
||||
|
|
|
|||
19
app.js
19
app.js
|
|
@ -44,7 +44,10 @@ var console = {
|
|||
__echo: function(msg) {
|
||||
if (typeof(WScript) !== "undefined") {
|
||||
WScript.echo(msg);
|
||||
} else if (typeof(window) !== "undefined") {
|
||||
window.alert(msg);
|
||||
}
|
||||
|
||||
this.__messages.push(msg);
|
||||
},
|
||||
log: function(msg) {
|
||||
|
|
@ -75,7 +78,7 @@ if (typeof(CreateObject) !== "function") {
|
|||
if (typeof(WScript) !== "undefined") {
|
||||
return WScript.CreateObject(p, s);
|
||||
} else {
|
||||
return new ActiveXObject(p, s);
|
||||
return new ActiveXObject(p);
|
||||
}
|
||||
};
|
||||
|
||||
|
|
@ -88,7 +91,9 @@ if (typeof(CreateObject) !== "function") {
|
|||
for (var i = 0; i < progIds.length; i++) {
|
||||
try {
|
||||
return _CreateObject(progIds[i], serverName);
|
||||
} catch (e) {};
|
||||
} catch (e) {
|
||||
console.error(e.message);
|
||||
};
|
||||
}
|
||||
};
|
||||
}
|
||||
|
|
@ -102,7 +107,7 @@ if (typeof(GetObject) !== "function") {
|
|||
var strNamespace = paths.slice(3).join("\\");
|
||||
return objLocator.ConnectServer(strComputer, strNamespace);
|
||||
} else {
|
||||
console.log("Not supported: " + pathName);
|
||||
console.log("Not supported " + pathName);
|
||||
}
|
||||
};
|
||||
}
|
||||
|
|
@ -166,13 +171,6 @@ function require(FN) {
|
|||
return cache[FN];
|
||||
}
|
||||
|
||||
/////////////////////////////////////////////////////////////////////////////////
|
||||
// get global variables
|
||||
/////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
var __global = {};
|
||||
var __config = require("config").config;
|
||||
|
||||
/////////////////////////////////////////////////////////////////////////////////
|
||||
// Load script, and call app.main()
|
||||
/////////////////////////////////////////////////////////////////////////////////
|
||||
|
|
@ -211,7 +209,6 @@ function init_window(name, args, w, h) {
|
|||
console.error("Error, window is not defined");
|
||||
exit(1);
|
||||
}
|
||||
|
||||
var app = require(name);
|
||||
|
||||
// "set default size of window";
|
||||
|
|
|
|||
|
|
@ -1,68 +0,0 @@
|
|||
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN"
|
||||
"http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
|
||||
<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ko" lang="ko">
|
||||
<head>
|
||||
<!--
|
||||
@tag hta:application
|
||||
|
||||
@attribute ApplicationName Sets the name of the HTA.
|
||||
|
||||
@attribute Border [Thick]|Thin|None
|
||||
@attribute BorderStyle [Normal]|Raised|Sunken|Complex|Static
|
||||
@attribute InnerBorder [Yes]|No
|
||||
@attribute Caption [Yes]|No
|
||||
@attribute ContextMenu [Yes]|No
|
||||
@attribute Icon Path/To/Icon.ico
|
||||
@attribute MaximizeButton [Yes]|No
|
||||
@attribute MinimizeButton [Yes]|No
|
||||
@attribute Navigable [Yes]|No
|
||||
@attribute Scroll [Auto]|Yes|No
|
||||
@attribute ScrollFlat [Auto]|Yes|No
|
||||
@attribute Selection [Yes]|No
|
||||
@attribute ShowInTaskbar [Yes]|No
|
||||
@attribute SingleInstance [Yes]|No
|
||||
@attribute SysMenu [Yes]|No (Setting to No will remove close button)
|
||||
@attribute WindowsState [Normal]|Minimize|Maximize
|
||||
-->
|
||||
<hta:application
|
||||
ID="WELSONJS_WINDOW"
|
||||
Version="0.1.2"
|
||||
ApplicationName="WelsonJS"
|
||||
Border="None"
|
||||
BorderStyle="Static"
|
||||
InnerBorder="No"
|
||||
Caption="No"
|
||||
Icon="app/favicon.ico"
|
||||
ContextMenu="No"
|
||||
MaximizeButton="No"
|
||||
MinimizeButton="No"
|
||||
Navigable="No"
|
||||
Scroll="No"
|
||||
ScrollFlat="Yes"
|
||||
Selection="No"
|
||||
ShowInTaskbar="Yes"
|
||||
SingleInstance="Yes"
|
||||
SysMenu="Yes"
|
||||
WindowState="Normal"
|
||||
Selection="No"
|
||||
/>
|
||||
<title>Welcome to WelsonJS application</title>
|
||||
<!--<meta http-equiv="X-UA-Compatible" content="IE=9" />-->
|
||||
<meta http-equiv="Content-Type" content="application/xhtml+xml; charset=utf-8" />
|
||||
<meta name="description" content="Welsonjs - Build a Windows desktop apps with JavaScript, HTML, and CSS based on WSH/HTA" />
|
||||
<meta name="keywords" content="webapp" />
|
||||
<meta name="author" content="gnh1201" />
|
||||
<meta name="generator" content="welsonjs" />
|
||||
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
|
||||
<link type="image/x-icon" rel="icon" href="app/favicon.ico" />
|
||||
<link type="image/png" rel="shortcut icon" href="app/assets/img/paper-plane-icon.png" />
|
||||
<link type="text/css" rel="stylesheet" href="app/style.css" />
|
||||
</head>
|
||||
<body>
|
||||
<div id="app"></div>
|
||||
<script src="app.js" type="text/javascript" charset="utf-8"></script>
|
||||
<script type="text/javascript">//<!--<![CDATA[
|
||||
init_window("webloader", [WELSONJS_WINDOW.commandLine], 800, 600);
|
||||
//]]>--></script>
|
||||
</body>
|
||||
</html>
|
||||
File diff suppressed because it is too large
Load Diff
1032
app/assets/css/cascade/development/build-core+typography.css
Normal file
1032
app/assets/css/cascade/development/build-core+typography.css
Normal file
File diff suppressed because it is too large
Load Diff
2036
app/assets/css/cascade/development/build-full-no-icons.css
Normal file
2036
app/assets/css/cascade/development/build-full-no-icons.css
Normal file
File diff suppressed because it is too large
Load Diff
3138
app/assets/css/cascade/development/build-full.css
Normal file
3138
app/assets/css/cascade/development/build-full.css
Normal file
File diff suppressed because it is too large
Load Diff
408
app/assets/css/cascade/development/colors.css
Normal file
408
app/assets/css/cascade/development/colors.css
Normal file
|
|
@ -0,0 +1,408 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
table.box-header th {
|
||||
background-color:#4F82B4;
|
||||
color:#fff;
|
||||
}
|
||||
|
||||
code,.files .tree a:hover {
|
||||
border-color:#e1e1e8;
|
||||
}
|
||||
|
||||
.pipes li,.outline,.outline-header th,.icon-border {
|
||||
border-color:#333;
|
||||
}
|
||||
|
||||
.datasheet th,.files .tree a {
|
||||
border-color:#fff;
|
||||
}
|
||||
|
||||
fieldset {
|
||||
border-color:#c0c0c0;
|
||||
}
|
||||
|
||||
hr {
|
||||
border-bottom-color:#fff;
|
||||
}
|
||||
|
||||
.datasheet th {
|
||||
border-right-color:#ccc;
|
||||
border-bottom-color:#ccc;
|
||||
}
|
||||
|
||||
.site-header,.site-header-fixture {
|
||||
background:#2d3538;
|
||||
}
|
||||
|
||||
.tags .blocks li.disabled,.tags .blocks a {
|
||||
background:#e5e5e0;
|
||||
}
|
||||
|
||||
.tags .blocks a:hover{
|
||||
background:#dcdcd5;
|
||||
}
|
||||
|
||||
input:invalid,textarea:invalid {
|
||||
background:#f0dddd;
|
||||
}
|
||||
|
||||
pre code {
|
||||
background:none;
|
||||
}
|
||||
|
||||
ins {
|
||||
background:#ff9;
|
||||
}
|
||||
|
||||
mark {
|
||||
background:#ff0;
|
||||
}
|
||||
|
||||
body,.site-footer,.site-footer-fixture,pre,button,.panel .footer,.button,.menu .stat a:hover,.files .tree a:hover,.panel .header,.datasheet th,code,.menu .active a,.tab-block .body, .tab-block .body .tabs .nav a,.menu .active a:hover,.menu .links .active a:hover {
|
||||
background-color:#f7f7f9;
|
||||
}
|
||||
|
||||
input,textarea,select,table,.site-body,.panel,.menu .links a:hover,.tabs .nav a,.tab-block .tabs .nav .active a,.tab-content,.tab-block .panel .body,.tabs .nav .active a:hover {
|
||||
background-color:#fff;
|
||||
}
|
||||
|
||||
.menu-tabs .menu a:hover {
|
||||
background:#15628e;
|
||||
}
|
||||
|
||||
.label {
|
||||
background:#999;
|
||||
}
|
||||
|
||||
.masthead,.menu a:hover,.menu-tabs .menu .nav,.menu-tabs .active a,.menu-tabs .tabs .nav .active a,.menu-tabs .active a:hover,.menu-tabs .tabs .active a:hover {
|
||||
background:#4F82B4;
|
||||
}
|
||||
|
||||
.pagination a {
|
||||
background:url('../../../img/alpha-w-60.png');
|
||||
_background:none;
|
||||
}
|
||||
|
||||
.pagination a:hover,.pagination a:focus,.hovered-button,.button:hover {
|
||||
background-image:url('../../../img/alpha-10.png');
|
||||
_background:#eee;
|
||||
}
|
||||
|
||||
.files .tree a {
|
||||
background:url("../../../img/icon-file.gif") 5px 50% no-repeat;
|
||||
}
|
||||
|
||||
.files .tree .collapse-trigger {
|
||||
background:url("../../../img/icon-folder-open.gif") 5px 50% no-repeat;
|
||||
}
|
||||
|
||||
.files .tree .collapsed .collapse-trigger {
|
||||
background:url("../../../img/icon-folder.gif") 5px 50% no-repeat;
|
||||
}
|
||||
|
||||
.site-header .nav a:hover {
|
||||
color:#ccc;
|
||||
}
|
||||
|
||||
.site-header .nav a {
|
||||
color:#999;
|
||||
}
|
||||
|
||||
.tiny {
|
||||
color:#ccc;
|
||||
}
|
||||
|
||||
h6,small,.label,.menu .text {
|
||||
color:#999;
|
||||
}
|
||||
|
||||
input,textarea,.typ,.atn,.dec,.var {
|
||||
color:#808080;
|
||||
}
|
||||
|
||||
code {
|
||||
color:#d14;
|
||||
}
|
||||
|
||||
.parsley-error-list li {
|
||||
color:#9d261d;
|
||||
}
|
||||
|
||||
pre code {
|
||||
color:inherit;
|
||||
}
|
||||
|
||||
body,select,input,textarea,.nav a,.nav a:hover,button,.button,.button:hover,.menu .active a,.menu .active a:hover,.tabs .active a,.tabs .active a:hover {
|
||||
color:#333;
|
||||
}
|
||||
|
||||
.menu .links a,a,.pipes a,.menu .stat a {
|
||||
color:#4F82B4;
|
||||
}
|
||||
|
||||
a:hover,.menu .links a:hover,.pipes a:hover,.menu .stat a:hover,.tags .cloud a:hover {
|
||||
color:#2F69A2;
|
||||
}
|
||||
|
||||
.tags .disabled,.tabs a, .tags a,.tags a:hover {
|
||||
color:#686867;
|
||||
}
|
||||
|
||||
.masthead,table.box-header th,.label,.menu a:hover,.site-header,.site-header .nav .active a,.site-header .nav .active a:hover,.menu-tabs .menu a, .menu-tabs .active a, .menu-tabs .active a:hover {
|
||||
color:#fff;
|
||||
}
|
||||
|
||||
.lit {
|
||||
color:#195f91;
|
||||
}
|
||||
|
||||
.com,.pun,.opn,.clo {
|
||||
color:#93a1a1;
|
||||
}
|
||||
|
||||
.fun {
|
||||
color:#dc322f;
|
||||
}
|
||||
|
||||
.str, .atv {
|
||||
color:#D14;
|
||||
}
|
||||
|
||||
.kwd, .prettyprint .tag {
|
||||
color:#1e347b;
|
||||
}
|
||||
|
||||
.pln {
|
||||
color:#48484c;
|
||||
}
|
||||
|
||||
:-moz-placeholder {
|
||||
color:#999;
|
||||
}
|
||||
|
||||
::-webkit-input-placeholder {
|
||||
color:#999;
|
||||
}
|
||||
|
||||
::-moz-selection {
|
||||
background:#0050A3; color:#fff; text-shadow:none;
|
||||
}
|
||||
|
||||
::selection {
|
||||
background:#0050A3; color:#fff; text-shadow:none;
|
||||
}
|
||||
|
||||
select:focus, input:focus,textarea:focus {
|
||||
border-color:#115698;
|
||||
}
|
||||
|
||||
[disabled],[readonly] {
|
||||
cursor:not-allowed;
|
||||
background-color:#eeeeee;
|
||||
}
|
||||
|
||||
.background-blue {
|
||||
background:#15628e !important;
|
||||
}
|
||||
|
||||
.background-green {
|
||||
background:#46a546 !important;
|
||||
}
|
||||
|
||||
.background-red {
|
||||
background:#9d261d !important;
|
||||
}
|
||||
|
||||
.background-yellow {
|
||||
background:#ffc40d !important;
|
||||
}
|
||||
|
||||
.background-orange {
|
||||
background:#f89406 !important;
|
||||
}
|
||||
|
||||
.background-pink {
|
||||
background:#f49ac1 !important;
|
||||
}
|
||||
|
||||
.background-purple {
|
||||
background:#7a43b6 !important;
|
||||
}
|
||||
|
||||
.background-grey {
|
||||
background:#999 !important;
|
||||
}
|
||||
|
||||
.background-black {
|
||||
background:#333 !important;
|
||||
}
|
||||
|
||||
.background-white {
|
||||
background:#fff !important;
|
||||
}
|
||||
|
||||
.background-blue,.background-green,.background-red,.background-yellow,.background-orange,.background-pink,.background-purple,.background-grey,.background-black {
|
||||
color:#fff !important;
|
||||
}
|
||||
|
||||
.color-blue {
|
||||
color:#15628e !important;
|
||||
}
|
||||
|
||||
.color-green {
|
||||
color:#46a546 !important;
|
||||
}
|
||||
|
||||
.color-red {
|
||||
color:#9d261d !important;
|
||||
}
|
||||
|
||||
.color-yellow {
|
||||
color:#ffc40d !important;
|
||||
}
|
||||
|
||||
.color-orange {
|
||||
color:#f89406 !important;
|
||||
}
|
||||
|
||||
.color-pink {
|
||||
color:#c3325f !important;
|
||||
}
|
||||
|
||||
.color-purple {
|
||||
color:#7a43b6 !important;
|
||||
}
|
||||
|
||||
.color-grey {
|
||||
color:#999 !important;
|
||||
}
|
||||
|
||||
.color-black {
|
||||
color:#333 !important;
|
||||
}
|
||||
|
||||
.color-white {
|
||||
color:#fff !important;
|
||||
}
|
||||
|
||||
::selection {
|
||||
background:#15628e;
|
||||
}
|
||||
|
||||
::-moz-selection {
|
||||
background:#15628e;
|
||||
}
|
||||
|
||||
html {
|
||||
-webkit-tap-highlight-color:rgba(255,255,255,0);
|
||||
}
|
||||
|
||||
a {
|
||||
-webkit-tap-highlight-color:#15628e;
|
||||
}
|
||||
|
||||
.gradient {
|
||||
background-image:url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiA/Pgo8c3ZnIHhtbG5zPSJod…EiIGhlaWdodD0iMSIgZmlsbD0idXJsKCNncmFkLXVjZ2ctZ2VuZXJhdGVkKSIgLz4KPC9zdmc+);
|
||||
background-image:-moz-linear-gradient(top, rgba(234,234,234,0) 0%, rgba(0,0,0,0.15) 100%);
|
||||
background-image:-webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(234,234,234,0)), color-stop(100%,rgba(0,0,0,0.15)));
|
||||
background-image:-webkit-linear-gradient(top, rgba(234,234,234,0) 0%,rgba(0,0,0,0.15) 100%);
|
||||
background-image:-o-linear-gradient(top, rgba(234,234,234,0) 0%,rgba(0,0,0,0.15) 100%);
|
||||
background-image:-ms-linear-gradient(top, rgba(234,234,234,0) 0%,rgba(0,0,0,0.15) 100%);
|
||||
background-image:linear-gradient(top, rgba(234,234,234,0) 0%,rgba(0,0,0,0.15) 100%);
|
||||
filter:progid:DXImageTransform.Microsoft.gradient( startColorstr='#00eaeaea', endColorstr='#26000000',GradientType=0 );
|
||||
}
|
||||
694
app/assets/css/cascade/development/core.css
Normal file
694
app/assets/css/cascade/development/core.css
Normal file
|
|
@ -0,0 +1,694 @@
|
|||
div,main,article,aside,details,figcaption,figure,footer,header,hgroup,nav,section,pre,.nav,.nav a,.width-fill,.width-fit img,blockquote small,address,button,.button,.nav ul,.nav li,.logo,.col,.cell {
|
||||
display:block;*zoom:1;
|
||||
}
|
||||
|
||||
.pipes .stat span,.menu .tiny {
|
||||
display:block;
|
||||
}
|
||||
|
||||
.center {
|
||||
display:block !important;
|
||||
}
|
||||
|
||||
audio,canvas,video,img,input,label,textarea,.menu .stat span,.icon,.label,.pipes a,.files .tree a {
|
||||
display:inline-block;*display:inline;*zoom:1;
|
||||
}
|
||||
|
||||
figcaption,div:after,main:after,article:after,aside:after,details:after,figcaption:after,figure:after,footer:after,header:after,
|
||||
hgroup:after,nav:after,section:after,pre:after,.nav:after,.nav a:after,.width-fill:after,.width-fit img:after,
|
||||
blockquote small:after,address:after,.nav ul:after,.nav li:after {
|
||||
clear:both;
|
||||
}
|
||||
|
||||
|
||||
div:before,div:after,main:before,main:after,article:before,article:after,aside:before,aside:after,details:before,details:after,
|
||||
figcaption:before,figcaption:after,figure:before,figure:after,footer:before,footer:after,
|
||||
header:before,header:after,hgroup:before,hgroup:after,nav:before,nav:after,section:before,section:after,
|
||||
pre:before,pre:after,.nav:before,.nav:after,.nav a:before,.nav a:after,.width-fill:before,.width-fill:after,
|
||||
.width-fit img:before,.width-fit img:after,blockquote small:before,blockquote small:after,address:before,address:after,
|
||||
.nav ul:before,.nav ul:after,.nav li:before,.nav li:after {
|
||||
content:""; display:table;
|
||||
}
|
||||
|
||||
li {
|
||||
display:list-item;
|
||||
}
|
||||
|
||||
[hidden] {
|
||||
display:none;
|
||||
}
|
||||
|
||||
audio:not([controls]) {
|
||||
display:none;
|
||||
}
|
||||
|
||||
.parsley-error-list,.parsley-error-list li {
|
||||
display: inline !important;
|
||||
}
|
||||
|
||||
.tabs .nav {
|
||||
float:none;
|
||||
}
|
||||
|
||||
section,article,header,footer,aside,nav,img,.nav,.col,.tabs,.tab-content,.width-fit,.nav li,button,.button,.button-group,.nav a,.left li li,.tabs .left,.right li li {
|
||||
float:left;
|
||||
}
|
||||
|
||||
.width-fill {
|
||||
display:table-cell;
|
||||
float:none;
|
||||
_float:left;
|
||||
}
|
||||
|
||||
.tabs .right {
|
||||
float:right;
|
||||
}
|
||||
|
||||
.gallery img,.left li,.right li,.left a,.right a,.tree,.tree li,.menu .nav,.pipes a,.tree a {
|
||||
float:none;
|
||||
}
|
||||
|
||||
.site-center,.center {
|
||||
float:none !important;
|
||||
}
|
||||
|
||||
sub,sup,body,fieldset,legend,.cell,.center,.site-center,.nav li,.nav a,.site-header,.site-header-ghost,.site-footer {
|
||||
position:relative;
|
||||
}
|
||||
|
||||
td,th {
|
||||
*position:relative;
|
||||
}
|
||||
|
||||
.nav {
|
||||
_position:relative;
|
||||
}
|
||||
|
||||
.pipes li{
|
||||
position:static;
|
||||
}
|
||||
|
||||
.parsley-error-list {
|
||||
right: 0;
|
||||
}
|
||||
|
||||
.site-header-fixture .site-header,.menu .data {
|
||||
top:0;
|
||||
right:0;
|
||||
}
|
||||
|
||||
.site-footer-fixture .site-footer {
|
||||
bottom:0;
|
||||
}
|
||||
|
||||
.site-header-ghost {
|
||||
_position:absolute;
|
||||
}
|
||||
|
||||
.parsley-error-list,.site-footer-fixture,.menu .data {
|
||||
position:absolute;
|
||||
}
|
||||
|
||||
.site-footer-fixture .site-footer,.site-header-fixture .site-header {
|
||||
position:fixed;
|
||||
z-index:9900;
|
||||
}
|
||||
|
||||
.site-header-fixture .site-header *,.site-footer-fixture .site-footer * {
|
||||
z-index:9999;
|
||||
}
|
||||
|
||||
.radio,.checkbox {
|
||||
position:relative;
|
||||
*top:-5px;
|
||||
}
|
||||
|
||||
sup {
|
||||
top:-0.5em;
|
||||
}
|
||||
|
||||
sub {
|
||||
bottom:-0.25em;
|
||||
}
|
||||
|
||||
fieldset {
|
||||
margin:0 2px;
|
||||
padding:0.35em 0.625em 0.75em;
|
||||
}
|
||||
|
||||
ol.linenums {
|
||||
margin:0 0 0 33px;
|
||||
}
|
||||
|
||||
.tree ul {
|
||||
margin-left:15px;
|
||||
}
|
||||
|
||||
body,blockquote,blockquote p,dl,table,address,pre,p,dd,figure,legend,
|
||||
form,button,input,select,textarea,h1,h2,h3,h4,h5,h6,ul p, ol p, figure img,.nav,.panel .body,.menu .tree ul,.button-group .button {
|
||||
margin:0;
|
||||
}
|
||||
|
||||
.tags .nav li {
|
||||
margin:2px;
|
||||
}
|
||||
|
||||
.cell {
|
||||
margin:10px;
|
||||
}
|
||||
|
||||
form .cell,.mediaobject .cell {
|
||||
margin:4px;
|
||||
}
|
||||
|
||||
ul,ol {
|
||||
margin:0 0 9px 25px;
|
||||
}
|
||||
|
||||
.pipes li{
|
||||
margin:0 6px 0 -6px;
|
||||
}
|
||||
|
||||
hr,.page-header {
|
||||
margin:18px 0;
|
||||
}
|
||||
|
||||
.site-center .site-body {
|
||||
margin-top:20px;
|
||||
}
|
||||
|
||||
ul ul,ul ol,ol ol,ol ul,.gallery img {
|
||||
margin-bottom:0;
|
||||
}
|
||||
|
||||
.pipes .stat span {
|
||||
margin-top:2px;
|
||||
}
|
||||
|
||||
blockquote,dl,table,address {
|
||||
margin-bottom:18px;
|
||||
}
|
||||
|
||||
pre,p {
|
||||
margin-bottom:9px;
|
||||
}
|
||||
|
||||
img {
|
||||
margin-bottom:4px;
|
||||
}
|
||||
|
||||
input[type=radio],input[type=checkbox] {
|
||||
margin-bottom:4px;
|
||||
*margin:0;
|
||||
}
|
||||
|
||||
dd {
|
||||
margin-left:9px;
|
||||
}
|
||||
|
||||
img,.icon {
|
||||
margin-right:4px;
|
||||
}
|
||||
|
||||
.icon {
|
||||
margin-left:4px;
|
||||
}
|
||||
|
||||
button,.button,.label,.button-group {
|
||||
margin-right:5px;
|
||||
}
|
||||
|
||||
.top-nav .tab-content {
|
||||
margin-top:-1px;
|
||||
}
|
||||
|
||||
.bottom-nav .tab-content {
|
||||
margin-bottom:-1px;
|
||||
}
|
||||
|
||||
.left-nav .tab-content {
|
||||
_margin-left:-1px;
|
||||
}
|
||||
|
||||
.right-nav .tab-content {
|
||||
*margin-right:-1px;
|
||||
}
|
||||
|
||||
.tab-block-2d.right-nav .tab-content {
|
||||
margin-top:0;
|
||||
}
|
||||
|
||||
legend {
|
||||
*margin-left:-7px;
|
||||
}
|
||||
|
||||
.icon-collapse {
|
||||
margin-right:11px;
|
||||
}
|
||||
|
||||
.tabs a {
|
||||
margin:1px 2px -1px 0;
|
||||
}
|
||||
|
||||
.tabs .bottom a {
|
||||
margin:-1px 2px 1px 0;
|
||||
}
|
||||
|
||||
.tabs .left a {
|
||||
margin:0 -1px 2px 1px;
|
||||
}
|
||||
|
||||
.tabs .right a {
|
||||
margin:0 1px 2px -1px;
|
||||
}
|
||||
|
||||
.pagination li {
|
||||
margin:0 4px 0 0;
|
||||
}
|
||||
|
||||
.button .icon {
|
||||
margin:0 0 0 1px;
|
||||
*margin:2px 1px 0 3px;
|
||||
}
|
||||
|
||||
.center,.site-center {
|
||||
margin-left:auto !important;
|
||||
margin-right:auto !important;
|
||||
}
|
||||
|
||||
code {
|
||||
padding:3px 4px;
|
||||
}
|
||||
|
||||
pre {
|
||||
padding:0 3px 2px;
|
||||
}
|
||||
|
||||
th,td,.nav .disabled,.nav a,.menu .data,.prettyprint {
|
||||
padding:8px;
|
||||
}
|
||||
|
||||
.menu-tabs .menu .nav {
|
||||
padding:6px;
|
||||
}
|
||||
|
||||
ol.linenums li {
|
||||
padding-left:12px;
|
||||
}
|
||||
|
||||
.panel .header,.panel .footer {
|
||||
padding:5px 10px;
|
||||
}
|
||||
|
||||
.pipes li,.pipes .disabled {
|
||||
padding:0 6px;
|
||||
}
|
||||
|
||||
label {
|
||||
padding:5px;
|
||||
}
|
||||
|
||||
.button {
|
||||
padding:4px 10px;
|
||||
}
|
||||
|
||||
input.button,button,button.button {
|
||||
*padding:3px 9px 1px;
|
||||
}
|
||||
|
||||
|
||||
input,textarea,.parsley-error-list,.tags .nav li.disabled,select,.tags .nav a,.icon-button {
|
||||
padding:4px;
|
||||
}
|
||||
|
||||
button.icon-button {
|
||||
*padding:3px 3px 1px;
|
||||
}
|
||||
|
||||
select {
|
||||
padding-left:0;
|
||||
}
|
||||
|
||||
.pagination a,.tags .blocks li.disabled,.tags .blocks a {
|
||||
padding:4px 8px;
|
||||
}
|
||||
|
||||
.site-header .nav a,.site-header-ghost .nav a {
|
||||
padding:8px 16px;
|
||||
}
|
||||
|
||||
ul,ol,legend,blockquote,td input,pre code,.menu .header,.pipes a,.gallery a {
|
||||
padding:0;
|
||||
}
|
||||
|
||||
blockquote {
|
||||
padding-left:15px;
|
||||
}
|
||||
|
||||
.page-header {
|
||||
padding-bottom:17px;
|
||||
}
|
||||
|
||||
.tree a {
|
||||
padding:0 7px 0 27px;
|
||||
}
|
||||
|
||||
.menu .tree a {
|
||||
padding:4px 7px 4px 34px;
|
||||
*padding:4px 7px 4px 35px;
|
||||
_padding:4px 7px 4px 38px;
|
||||
}
|
||||
|
||||
.menu .tree .collapse-trigger {
|
||||
padding:4px 7px;
|
||||
}
|
||||
|
||||
.label {
|
||||
padding:2px 4px;
|
||||
}
|
||||
|
||||
.links .menu a {
|
||||
padding:7px 0;
|
||||
}
|
||||
|
||||
.menu .tiny {
|
||||
padding:6px 8px;
|
||||
}
|
||||
|
||||
.tabs a {
|
||||
padding:0 15px;
|
||||
}
|
||||
|
||||
.tabs .active a {
|
||||
padding:0 14px;
|
||||
}
|
||||
|
||||
.tab-block .body .tabs .nav {
|
||||
padding-left:9px;
|
||||
}
|
||||
|
||||
.icon-16 {
|
||||
width:16px;
|
||||
}
|
||||
|
||||
.icon-32 {
|
||||
width:32px;
|
||||
}
|
||||
|
||||
.icon-64 {
|
||||
width:64px;
|
||||
}
|
||||
|
||||
.icon-128 {
|
||||
width:128px;
|
||||
}
|
||||
|
||||
.button .icon {
|
||||
height:18px;
|
||||
width:18px;
|
||||
}
|
||||
|
||||
section,article,header,footer,aside,nav,.col,.tabs {
|
||||
min-height:1px;
|
||||
}
|
||||
|
||||
.fluid {
|
||||
min-width:200px !important;
|
||||
width:80% !important;
|
||||
}
|
||||
|
||||
.width-fill {
|
||||
min-width:50px;
|
||||
}
|
||||
|
||||
main,section,article,header,footer,aside,nav,.site-footer,.site-header,table,.col,.tabs,.tab-content,.tabs .nav,figure img,.tree li {
|
||||
width:100%;
|
||||
}
|
||||
|
||||
.tabs .nav,.tab-content {
|
||||
_width:auto;
|
||||
}
|
||||
|
||||
.width-fit {
|
||||
width:auto;
|
||||
_width:1px;
|
||||
}
|
||||
|
||||
.site-center {
|
||||
width:920px;
|
||||
min-width:200px;
|
||||
}
|
||||
|
||||
.width-fill {
|
||||
width:10000px;*width:auto;
|
||||
}
|
||||
|
||||
select {
|
||||
width:220px;
|
||||
}
|
||||
|
||||
table input {
|
||||
width:100%;
|
||||
height:18px;
|
||||
}
|
||||
|
||||
html,body {
|
||||
height:100%;
|
||||
}
|
||||
|
||||
img {
|
||||
height:auto;
|
||||
}
|
||||
|
||||
.logo {
|
||||
width:32px;
|
||||
height:32px;
|
||||
}
|
||||
|
||||
select {
|
||||
height:28px;
|
||||
}
|
||||
|
||||
table {
|
||||
border-collapse:separate; border-spacing:0; *border-collapse:collapse; empty-cells:show;
|
||||
}
|
||||
|
||||
.icon {
|
||||
border-style:none;
|
||||
}
|
||||
|
||||
form,main,section,article,header,footer,aside,nav,div,table,col,th,td,img,figure,fieldset,pre,code,abbr,span,ol,ul,li,a,button,input,hr,select,textarea,blockquote,td input,.icon-border,.checkbox,.radio,.datasheet table.body {
|
||||
border:0 solid #ccc;
|
||||
}
|
||||
|
||||
blockquote {
|
||||
border-left-width:5px;
|
||||
}
|
||||
|
||||
hr {
|
||||
border-top-width:1px;
|
||||
}
|
||||
|
||||
pre,textarea,code,input,button,select,.button,.pagination a,.tab-content,.icon-border,.files .tree a {
|
||||
border-width:1px;
|
||||
}
|
||||
|
||||
hr,abbr,.tabs .nav,.page-header {
|
||||
border-bottom-width:1px;
|
||||
}
|
||||
|
||||
.tab-block-2d .tab-content,.menu-tabs .tab-content {
|
||||
border-top-width:0;
|
||||
}
|
||||
|
||||
html>body .tab-block-2d .tab-content {
|
||||
*border-top-width:1px;
|
||||
}
|
||||
|
||||
html>body .tab-block-2d.right-nav .tab-content {
|
||||
border-top-width:0;
|
||||
}
|
||||
|
||||
.tabs .nav a {
|
||||
border-width:0 0 1px 0;
|
||||
}
|
||||
|
||||
.panel .header,.panel .body,.panel .footer {
|
||||
border-width:0 1px 1px 0;
|
||||
}
|
||||
|
||||
.tab-block .header,.tabs .left,.tabs .left a {
|
||||
border-width :0 1px 0 0;
|
||||
}
|
||||
|
||||
.collapsed .header {
|
||||
border-width:0 1px 1px 0;
|
||||
}
|
||||
|
||||
.panel {
|
||||
border-width:1px 0 0 1px;
|
||||
}
|
||||
|
||||
.tabs .bottom,.tabs .bottom a,.tab-block .body .tab-content {
|
||||
border-width:1px 0 0 0;
|
||||
}
|
||||
|
||||
.pipes li,.tabs .right,.tabs .right a {
|
||||
border-width:0 0 0 1px;
|
||||
}
|
||||
|
||||
.tabs .nav .active a {
|
||||
border-width:1px 1px 0 1px;
|
||||
}
|
||||
|
||||
.tabs .bottom .active a {
|
||||
border-width:0 1px 1px 1px;
|
||||
}
|
||||
|
||||
.tabs .left .active a {
|
||||
border-width:1px 0 1px 1px;
|
||||
}
|
||||
|
||||
.tabs .right .active a {
|
||||
border-width:1px 1px 1px 0;
|
||||
}
|
||||
|
||||
.button-group {
|
||||
border-width:0 0 1px 1px;
|
||||
}
|
||||
|
||||
.button-group .button {
|
||||
border-width:1px 1px 0 0;
|
||||
}
|
||||
|
||||
.icon-32 {
|
||||
border-width:2px;
|
||||
}
|
||||
|
||||
.icon-64 {
|
||||
border-width:3px;
|
||||
}
|
||||
|
||||
.icon-128 {
|
||||
border-width:4px;
|
||||
}
|
||||
|
||||
abbr {
|
||||
border-style:dotted;
|
||||
}
|
||||
|
||||
body,.nav li,ul,ol {
|
||||
overflow:visible;
|
||||
}
|
||||
|
||||
button,input {
|
||||
*overflow:visible;
|
||||
}
|
||||
|
||||
textarea {
|
||||
overflow:auto; resize:none;
|
||||
}
|
||||
|
||||
.pipes,table input {
|
||||
overflow:hidden;
|
||||
}
|
||||
|
||||
svg:not(:root) {
|
||||
overflow:hidden;
|
||||
}
|
||||
|
||||
html {
|
||||
overflow-y:scroll; -webkit-overflow-scrolling:touch;
|
||||
}
|
||||
|
||||
.site-header-ghost {
|
||||
visibility:hidden;
|
||||
}
|
||||
|
||||
.icon {
|
||||
text-align:center;
|
||||
}
|
||||
|
||||
.tabs .left {
|
||||
text-align:right;
|
||||
}
|
||||
|
||||
th {
|
||||
text-align:left;
|
||||
}
|
||||
|
||||
p {
|
||||
text-align:justify;
|
||||
}
|
||||
|
||||
ul {
|
||||
list-style:disc;
|
||||
}
|
||||
|
||||
ol {
|
||||
list-style:decimal;
|
||||
}
|
||||
|
||||
.nav {
|
||||
list-style-type:none;
|
||||
}
|
||||
|
||||
abbr {
|
||||
cursor:help;
|
||||
}
|
||||
|
||||
label,button,.button,a,.nav .disabled,.collapse-trigger {
|
||||
cursor:pointer;
|
||||
}
|
||||
|
||||
input[type=button],input[type=submit] {
|
||||
cursor:pointer;
|
||||
}
|
||||
|
||||
*:hover,*:active,*:focus {
|
||||
outline:none;
|
||||
}
|
||||
|
||||
blockquote,q {
|
||||
quotes:none;
|
||||
}
|
||||
|
||||
.icon:before {
|
||||
speak:none;
|
||||
}
|
||||
|
||||
q:before,q:after,
|
||||
blockquote:before,blockquote:after {
|
||||
content:""; content:none;
|
||||
}
|
||||
|
||||
img {
|
||||
-ms-interpolation-mode:bicubic;
|
||||
}
|
||||
|
||||
* html {
|
||||
filter:expression(document.execCommand("BackgroundImageCache",false,true));
|
||||
}
|
||||
|
||||
input, button, textarea {
|
||||
-webkit-appearance: none;
|
||||
-moz-appearance: none;
|
||||
}
|
||||
|
||||
input[type=checkbox] {
|
||||
-webkit-appearance: checkbox;
|
||||
-moz-appearance: checkbox;
|
||||
}
|
||||
|
||||
input[type=radio] {
|
||||
-webkit-appearance: radio;
|
||||
-moz-appearance: radio;
|
||||
}
|
||||
|
||||
button::-moz-focus-inner {
|
||||
border:0; padding:0;
|
||||
}
|
||||
|
||||
input::-moz-focus-inner {
|
||||
border:0; padding:2px;
|
||||
}
|
||||
151
app/assets/css/cascade/development/grids.css
Normal file
151
app/assets/css/cascade/development/grids.css
Normal file
|
|
@ -0,0 +1,151 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
|
||||
|
||||
.width-1of24{width:4.1666666%;}
|
||||
.width-1of16{width:6.25%;}
|
||||
.width-1of12,.width-2of24{width:8.3333333%;}
|
||||
.width-1of10{width:10%;}
|
||||
.width-1of9{width:11.1111111%;}
|
||||
.width-1of8,.width-2of16,.width-3of24{width:12.5%;}
|
||||
.width-1of7{width:14.2857143%;}
|
||||
.width-1of6,.width-2of12,.width-4of24{width:16.6666666%;}
|
||||
.width-3of16{width:18.75%;}
|
||||
.width-1of5,.width-2of10{width:20%;}
|
||||
.width-5of24{width:20.8333333%;}
|
||||
.width-2of9{width:22.2222222%;}
|
||||
.width-1of4,.width-2of8,.width-3of12,.width-4of16,.width-6of24{width:25%;}
|
||||
.width-2of7{width:28.5714286%;}
|
||||
.width-7of24{width:29.1666666%;}
|
||||
.width-3of10{width:30%;}
|
||||
.width-5of16{width:31.25%;}
|
||||
.width-1of3,.width-2of6,.width-3of9,.width-4of12,.width-8of24{width:33.3333333%;}
|
||||
.width-3of8,.width-6of16,.width-9of24{width:37.5%;}
|
||||
.width-2of5,.width-4of10{width:40%;}
|
||||
.width-5of12,.width-10of24{width:41.6666666%;}
|
||||
.width-3of7{width:42.8571429%;}
|
||||
.width-7of16{width:43.75%;}
|
||||
.width-4of9{width:44.4444444%;}
|
||||
.width-11of24{width:45.8333333%;}
|
||||
.width-1of2,.width-2of4,.width-3of6,.width-4of8,.width-5of10,.width-6of12,.width-8of16,.width-12of24{width:50%;}
|
||||
.width-13of24{width:54.1666666%;}
|
||||
.width-5of9{width:55.5555555%;}
|
||||
.width-9of16{width:56.25%;}
|
||||
.width-4of7{width:57.1428572%;}
|
||||
.width-7of12,.width-14of24{width:58.3333333%;}
|
||||
.width-3of5,.width-6of10{width:60%;}
|
||||
.width-5of8,.width-10of16,.width-15of24{width:62.5%;}
|
||||
.width-2of3,.width-4of6,.width-6of9,.width-8of12,.width-16of24{width:66.6666666%;}
|
||||
.width-11of16{width:68.75%;}
|
||||
.width-7of10{width:70%;}
|
||||
.width-17of24{width:70.8333333%;}
|
||||
.width-5of7{width:71.4285715%;}
|
||||
.width-3of4,.width-6of8,.width-9of12,.width-12of16,.width-18of24{width:75%;}
|
||||
.width-7of9{width:77.7777777%;}
|
||||
.width-19of24{width:79.1666666%;}
|
||||
.width-4of5,.width-8of10{width:80%;}
|
||||
.width-13of16{width:81.25%;}
|
||||
.width-5of6,.width-10of12,.width-20of24{width:83.3333333%;}
|
||||
.width-6of7{width:85.7142858%;}
|
||||
.width-7of8,.width-14of16,.width-21of24{width:87.5%;}
|
||||
.width-8of9{width:88.8888888%;}
|
||||
.width-9of10{width:90%;}
|
||||
.width-11of12,.width-22of24{width:91.6666666%;}
|
||||
.width-15of16{width:93.75%;}
|
||||
.width-23of24{width:95.8333333%;}
|
||||
|
||||
204
app/assets/css/cascade/development/helpers.css
Normal file
204
app/assets/css/cascade/development/helpers.css
Normal file
|
|
@ -0,0 +1,204 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
.no-margin {
|
||||
margin : 0 !important;
|
||||
}
|
||||
|
||||
.no-padding {
|
||||
padding : 0 !important;
|
||||
}
|
||||
|
||||
.float-left {
|
||||
float: left !important;
|
||||
}
|
||||
|
||||
.float-right {
|
||||
float: right !important;
|
||||
}
|
||||
|
||||
.float-right .text, .float-left .text {
|
||||
float: left;
|
||||
}
|
||||
|
||||
.border-bottom {
|
||||
border-bottom-width: 1px !important;
|
||||
}
|
||||
|
||||
.border-left {
|
||||
border-left-width: 1px !important;
|
||||
}
|
||||
|
||||
.border-right {
|
||||
border-right-width: 1px !important;
|
||||
}
|
||||
|
||||
.border-top {
|
||||
border-top-width: 1px !important;
|
||||
}
|
||||
|
||||
.no-border {
|
||||
border-width: 0 !important;
|
||||
}
|
||||
|
||||
.width-full {
|
||||
width:100% !important;
|
||||
}
|
||||
|
||||
.invisible {
|
||||
visibility: hidden !important;
|
||||
border: none !important;
|
||||
}
|
||||
|
||||
.collapsed .collapse-section {
|
||||
position: absolute !important;
|
||||
top: -999999em !important;
|
||||
left: auto !important;
|
||||
width: 1px !important;
|
||||
height: 1px !important;
|
||||
overflow:hidden !important;
|
||||
}
|
||||
|
||||
.collapse-section {
|
||||
overflow:hidden;
|
||||
}
|
||||
|
||||
.hidden-tab,.collapsible .collapsed-only {
|
||||
display:none !important;
|
||||
}
|
||||
|
||||
.collapsed .collapsed-only, .collapsible .uncollapsed-only {
|
||||
display:inline !important;
|
||||
}
|
||||
|
||||
.collapsed .uncollapsed-only {
|
||||
display:none !important;
|
||||
}
|
||||
|
||||
.desktop-hidden {
|
||||
*display:none !important;
|
||||
}
|
||||
|
||||
@media \0 screen {
|
||||
.desktop-hidden {
|
||||
display:none !important;
|
||||
}
|
||||
}
|
||||
|
||||
@media (min-width: 768px) {
|
||||
.desktop-hidden,.col.desktop-hidden {
|
||||
display:none !important;
|
||||
}
|
||||
}
|
||||
|
||||
@media (max-width:767px) {
|
||||
.mobile-hidden,.col.mobile-hidden {
|
||||
display:none !important;
|
||||
}
|
||||
}
|
||||
|
||||
@media (min-width: 481px) and (max-width: 767px) {
|
||||
.tablet-hidden,.col.tablet-hidden {
|
||||
display:none !important;
|
||||
}
|
||||
}
|
||||
|
||||
@media (max-width: 480px) {
|
||||
.phone-hidden,.col.phone-hidden {
|
||||
display:none !important;
|
||||
}
|
||||
}
|
||||
1265
app/assets/css/cascade/development/icons-ie7.css
Normal file
1265
app/assets/css/cascade/development/icons-ie7.css
Normal file
File diff suppressed because it is too large
Load Diff
1204
app/assets/css/cascade/development/icons.css
Normal file
1204
app/assets/css/cascade/development/icons.css
Normal file
File diff suppressed because it is too large
Load Diff
152
app/assets/css/cascade/development/mobile-grids.css
Normal file
152
app/assets/css/cascade/development/mobile-grids.css
Normal file
|
|
@ -0,0 +1,152 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
|
||||
|
||||
@media (max-width: 767px) {
|
||||
.mobile-width-1of24{width:4.1666666% !important;}
|
||||
.mobile-width-1of16{width:6.25% !important;}
|
||||
.mobile-width-1of12,.mobile-width-2of24{width:8.3333333% !important;}
|
||||
.mobile-width-1of10{width:10% !important;}
|
||||
.mobile-width-1of9{width:11.1111111% !important;}
|
||||
.mobile-width-1of8,.mobile-width-2of16,.mobile-width-3of24{width:12.5% !important;}
|
||||
.mobile-width-1of7{width:14.2857143% !important;}
|
||||
.mobile-width-1of6,.mobile-width-2of12,.mobile-width-4of24{width:16.6666666% !important;}
|
||||
.mobile-width-3of16{width:18.75% !important;}
|
||||
.mobile-width-1of5,.mobile-width-2of10{width:20% !important;}
|
||||
.mobile-width-5of24{width:20.8333333% !important;}
|
||||
.mobile-width-2of9{width:22.2222222% !important;}
|
||||
.mobile-width-1of4,.mobile-width-2of8,.mobile-width-3of12,.mobile-width-4of16,.mobile-width-6of24{width:25% !important;}
|
||||
.width-2of7{width:28.5714286% !important;}
|
||||
.mobile-width-7of24{width:29.1666666% !important;}
|
||||
.mobile-width-3of10{width:30% !important;}
|
||||
.mobile-width-5of16{width:31.25% !important;}
|
||||
.mobile-width-1of3,.mobile-width-2of6,.mobile-width-3of9,.mobile-width-4of12,.mobile-width-8of24{width:33.3333333% !important;}
|
||||
.mobile-width-3of8,.mobile-width-6of16,.mobile-width-9of24{width:37.5% !important;}
|
||||
.mobile-width-2of5,.mobile-width-4of10{width:40% !important;}
|
||||
.mobile-width-5of12,.mobile-width-10of24{width:41.6666666% !important;}
|
||||
.mobile-width-3of7{width:42.8571429% !important;}
|
||||
.mobile-width-7of16{width:43.75% !important;}
|
||||
.mobile-width-4of9{width:44.4444444% !important;}
|
||||
.mobile-width-11of24{width:45.8333333% !important;}
|
||||
.mobile-width-1of2,.mobile-width-2of4,.mobile-width-3of6,.mobile-width-4of8,.mobile-width-5of10,.mobile-width-6of12,.mobile-width-8of16,.mobile-width-12of24{width:50% !important;}
|
||||
.mobile-width-13of24{width:54.1666666% !important;}
|
||||
.mobile-width-5of9{width:55.5555555% !important;}
|
||||
.mobile-width-9of16{width:56.25% !important;}
|
||||
.mobile-width-4of7{width:57.1428572% !important;}
|
||||
.mobile-width-7of12,.mobile-width-14of24{width:58.3333333% !important;}
|
||||
.mobile-width-3of5,.mobile-width-6of10{width:60% !important;}
|
||||
.mobile-width-5of8,.mobile-width-10of16,.mobile-width-15of24{width:62.5% !important;}
|
||||
.mobile-width-2of3,.mobile-width-4of6,.mobile-width-6of9,.mobile-width-8of12,.mobile-width-16of24{width:66.6666666% !important;}
|
||||
.mobile-width-11of16{width:68.75% !important;}
|
||||
.mobile-width-7of10{width:70% !important;}
|
||||
.mobile-width-17of24{width:70.8333333% !important;}
|
||||
.mobile-width-5of7{width:71.4285715% !important;}
|
||||
.mobile-width-3of4,.mobile-width-6of8,.mobile-width-9of12,.mobile-width-12of16,.mobile-width-18of24{width:75% !important;}
|
||||
.mobile-width-7of9{width:77.7777777% !important;}
|
||||
.mobile-width-19of24{width:79.1666666% !important;}
|
||||
.mobile-width-4of5,.mobile-width-8of10{width:80% !important;}
|
||||
.mobile-width-13of16{width:81.25% !important;}
|
||||
.mobile-width-5of6,.mobile-width-10of12,.mobile-width-20of24{width:83.3333333% !important;}
|
||||
.mobile-width-6of7{width:85.7142858% !important;}
|
||||
.mobile-width-7of8,.mobile-width-14of16,.mobile-width-21of24{width:87.5% !important;}
|
||||
.mobile-width-8of9{width:88.8888888% !important;}
|
||||
.mobile-width-9of10{width:90% !important;}
|
||||
.mobile-width-11of12,.mobile-width-22of24{width:91.6666666% !important;}
|
||||
.mobile-width-15of16{width:93.75% !important;}
|
||||
.mobile-width-23of24{width:95.8333333% !important;}
|
||||
}
|
||||
237
app/assets/css/cascade/development/modern.css
Normal file
237
app/assets/css/cascade/development/modern.css
Normal file
|
|
@ -0,0 +1,237 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
input,textarea,select,code,.label,.icon {
|
||||
-webkit-border-radius:3px;
|
||||
-moz-border-radius:3px;
|
||||
border-radius:3px;
|
||||
}
|
||||
|
||||
.menu-tabs .menu a,.icon-64 {
|
||||
-webkit-border-radius:4px;
|
||||
-moz-radius:4px;
|
||||
border-radius:4px;
|
||||
}
|
||||
|
||||
button,.button,.button-group,.tags .blocks a,.pagination a,.tags .blocks li.disabled,.icon-128,.files .tree a:hover {
|
||||
-moz-border-radius:5px;
|
||||
-webkit-border-radius:5px;
|
||||
border-radius:5px;
|
||||
}
|
||||
|
||||
|
||||
pre {
|
||||
-webkit-border-radius:8px;
|
||||
-moz-border-radius:8px;
|
||||
border-radius:8px;
|
||||
}
|
||||
.button-group .button {
|
||||
-webkit-border-radius:0;
|
||||
-moz-radius:0;
|
||||
border-radius:0;
|
||||
}
|
||||
|
||||
|
||||
.button-group .button:first-child {
|
||||
-webkit-border-radius:5px 0 0 5px;
|
||||
-moz-border-radius:5px 0 0 5px;
|
||||
border-radius:5px 0 0 5px;
|
||||
}
|
||||
|
||||
.button-group .button:last-child {
|
||||
-webkit-border-radius:0 5px 5px 0;
|
||||
-moz-border-radius:0 5px 5px 0;
|
||||
border-radius:0 5px 5px 0;
|
||||
}
|
||||
|
||||
.menu .collapse-trigger {
|
||||
-moz-border-radius:0 !important;
|
||||
-webkit-border-radius:0 !important;
|
||||
border-radius:0 !important;
|
||||
}
|
||||
|
||||
.tabs a {
|
||||
-webkit-border-radius:4px 4px 0 0;
|
||||
-moz-radius:4px 4px 0 0;
|
||||
border-radius:4px 4px 0 0;
|
||||
}
|
||||
|
||||
.tabs .bottom a {
|
||||
-webkit-border-radius:0 0 4px 4px;
|
||||
-moz-radius:0 0 4px 4px;
|
||||
border-radius:0 0 4px 4px;
|
||||
}
|
||||
|
||||
.tabs .left a {
|
||||
-webkit-border-radius:4px 0 0 4px;
|
||||
-moz-radius:4px 0 0 4px;
|
||||
border-radius:4px 0 0 4px;
|
||||
}
|
||||
|
||||
.tabs .right a {
|
||||
-webkit-border-radius:0 4px 4px 0;
|
||||
-moz-radius:0 4px 4px 0;
|
||||
border-radius:0 4px 4px 0;
|
||||
}
|
||||
|
||||
.panel, .panel > :first-child, .panel > :first-child > :first-child {
|
||||
-webkit-border-top-left-radius:8px;
|
||||
-moz-border-radius-topleft:8px;
|
||||
border-top-left-radius:8px;
|
||||
-webkit-border-top-right-radius:8px;
|
||||
-moz-border-radius-topright:8px;
|
||||
border-top-right-radius:8px;
|
||||
}
|
||||
|
||||
.panel, .panel > :last-child, .panel > :last-child > :last-child, .collapsed:last-child > .collapse-trigger {
|
||||
-webkit-border-bottom-left-radius:8px;
|
||||
-moz-border-radius-bottomleft:8px;
|
||||
border-bottom-left-radius:8px;
|
||||
-webkit-border-bottom-right-radius:8px;
|
||||
-moz-border-radius-bottomright:8px;
|
||||
border-bottom-right-radius:8px;
|
||||
}
|
||||
|
||||
.panel, pre {
|
||||
-moz-box-shadow:0 0 3px rgba(0,0,0,.1);
|
||||
-webkit-box-shadow:0 0 3px rgba(0,0,0,.1);
|
||||
box-shadow:1px 2px 3px rgba(0,0,0,.05);
|
||||
}
|
||||
|
||||
.site-header {
|
||||
-webkit-box-shadow:0 1px 2px rgba(0,0,0,0.2);
|
||||
-moz-box-shadow:0 1px 2px rgba(0,0,0,0.2);
|
||||
box-shadow:0 1px 2px rgba(0,0,0,0.2);
|
||||
}
|
||||
|
||||
:not(.menu) > .nav a, .button, button, select, input, textarea {
|
||||
-webkit-box-shadow:none !important;
|
||||
-moz-box-shadow:none !important;
|
||||
box-shadow:none !important;
|
||||
-webkit-transition: 0.2s ease;
|
||||
-moz-transition: 0.2s ease;
|
||||
-ms-transition: 0.2s ease;
|
||||
-o-transition: 0.2s ease;
|
||||
transition: 0.2s ease;
|
||||
}
|
||||
|
||||
.spin {
|
||||
-moz-animation:spin 2s infinite linear;
|
||||
-o-animation:spin 2s infinite linear;
|
||||
-webkit-animation:spin 2s infinite linear;
|
||||
animation:spin 2s infinite linear;
|
||||
}
|
||||
@-moz-keyframes spin {
|
||||
0% { -moz-transform:rotate(0deg); }
|
||||
100% { -moz-transform:rotate(359deg); }
|
||||
}
|
||||
@-webkit-keyframes spin {
|
||||
0% { -webkit-transform:rotate(0deg); }
|
||||
100% { -webkit-transform:rotate(359deg); }
|
||||
}
|
||||
@-o-keyframes spin {
|
||||
0% { -o-transform:rotate(0deg); }
|
||||
100% { -o-transform:rotate(359deg); }
|
||||
}
|
||||
@-ms-keyframes spin {
|
||||
0% { -ms-transform:rotate(0deg); }
|
||||
100% { -ms-transform:rotate(359deg); }
|
||||
}
|
||||
@keyframes spin {
|
||||
0% { transform:rotate(0deg); }
|
||||
100% { transform:rotate(359deg); }
|
||||
}
|
||||
152
app/assets/css/cascade/development/phone-grids.css
Normal file
152
app/assets/css/cascade/development/phone-grids.css
Normal file
|
|
@ -0,0 +1,152 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
|
||||
|
||||
@media (max-width: 480px) {
|
||||
.phone-width-1of24{width:4.1666666% !important;}
|
||||
.phone-width-1of16{width:6.25% !important;}
|
||||
.phone-width-1of12,.phone-width-2of24{width:8.3333333% !important;}
|
||||
.phone-width-1of10{width:10% !important;}
|
||||
.phone-width-1of9{width:11.1111111% !important;}
|
||||
.phone-width-1of8,.phone-width-2of16,.phone-width-3of24{width:12.5% !important;}
|
||||
.phone-width-1of7{width:14.2857143% !important;}
|
||||
.phone-width-1of6,.phone-width-2of12,.phone-width-4of24{width:16.6666666% !important;}
|
||||
.phone-width-3of16{width:18.75% !important;}
|
||||
.phone-width-1of5,.phone-width-2of10{width:20% !important;}
|
||||
.phone-width-5of24{width:20.8333333% !important;}
|
||||
.phone-width-2of9{width:22.2222222% !important;}
|
||||
.phone-width-1of4,.phone-width-2of8,.phone-width-3of12,.phone-width-4of16,.phone-width-6of24{width:25% !important;}
|
||||
.size2of7{width:28.5714286% !important;}
|
||||
.phone-width-7of24{width:29.1666666% !important;}
|
||||
.phone-width-3of10{width:30% !important;}
|
||||
.phone-width-5of16{width:31.25% !important;}
|
||||
.phone-width-1of3,.phone-width-2of6,.phone-width-3of9,.phone-width-4of12,.phone-width-8of24{width:33.3333333% !important;}
|
||||
.phone-width-3of8,.phone-width-6of16,.phone-width-9of24{width:37.5% !important;}
|
||||
.phone-width-2of5,.phone-width-4of10{width:40% !important;}
|
||||
.phone-width-5of12,.phone-width-10of24{width:41.6666666% !important;}
|
||||
.phone-width-3of7{width:42.8571429% !important;}
|
||||
.phone-width-7of16{width:43.75% !important;}
|
||||
.phone-width-4of9{width:44.4444444% !important;}
|
||||
.phone-width-11of24{width:45.8333333% !important;}
|
||||
.phone-width-1of2,.phone-width-2of4,.phone-width-3of6,.phone-width-4of8,.phone-width-5of10,.phone-width-6of12,.phone-width-8of16,.phone-width-12of24{width:50% !important;}
|
||||
.phone-width-13of24{width:54.1666666% !important;}
|
||||
.phone-width-5of9{width:55.5555555% !important;}
|
||||
.phone-width-9of16{width:56.25% !important;}
|
||||
.phone-width-4of7{width:57.1428572% !important;}
|
||||
.phone-width-7of12,.phone-width-14of24{width:58.3333333% !important;}
|
||||
.phone-width-3of5,.phone-width-6of10{width:60% !important;}
|
||||
.phone-width-5of8,.phone-width-10of16,.phone-width-15of24{width:62.5% !important;}
|
||||
.phone-width-2of3,.phone-width-4of6,.phone-width-6of9,.phone-width-8of12,.phone-width-16of24{width:66.6666666% !important;}
|
||||
.phone-width-11of16{width:68.75% !important;}
|
||||
.phone-width-7of10{width:70% !important;}
|
||||
.phone-width-17of24{width:70.8333333% !important;}
|
||||
.phone-width-5of7{width:71.4285715% !important;}
|
||||
.phone-width-3of4,.phone-width-6of8,.phone-width-9of12,.phone-width-12of16,.phone-width-18of24{width:75% !important;}
|
||||
.phone-width-7of9{width:77.7777777% !important;}
|
||||
.phone-width-19of24{width:79.1666666% !important;}
|
||||
.phone-width-4of5,.phone-width-8of10{width:80% !important;}
|
||||
.phone-width-13of16{width:81.25% !important;}
|
||||
.phone-width-5of6,.phone-width-10of12,.phone-width-20of24{width:83.3333333% !important;}
|
||||
.phone-width-6of7{width:85.7142858% !important;}
|
||||
.phone-width-7of8,.phone-width-14of16,.phone-width-21of24{width:87.5% !important;}
|
||||
.phone-width-8of9{width:88.8888888% !important;}
|
||||
.phone-width-9of10{width:90% !important;}
|
||||
.phone-width-11of12,.phone-width-22of24{width:91.6666666% !important;}
|
||||
.phone-width-15of16{width:93.75% !important;}
|
||||
.phone-width-23of24{width:95.8333333% !important;}
|
||||
}
|
||||
113
app/assets/css/cascade/development/print.css
Normal file
113
app/assets/css/cascade/development/print.css
Normal file
|
|
@ -0,0 +1,113 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
|
||||
|
||||
@media print {
|
||||
* { background: transparent !important; color: black !important; text-shadow: none !important; filter:none !important; -ms-filter: none !important; }
|
||||
a, a:visited { text-decoration: underline; }
|
||||
a[href]:after { content: " (" attr(href) ")"; }
|
||||
abbr[title]:after { content: " (" attr(title) ")"; }
|
||||
.ir a:after, a[href^="javascript:"]:after, a[href^="#"]:after { content: ""; }
|
||||
pre, blockquote { border: 1px solid #999; page-break-inside: avoid; }
|
||||
thead { display: table-header-group; }
|
||||
tr, img { page-break-inside: avoid; }
|
||||
img { max-width: 100% !important; }
|
||||
@page { margin: 0.5cm; }
|
||||
p, h2, h3 { orphans: 3; widows: 3; }
|
||||
h2, h3 { page-break-after: avoid; }
|
||||
}
|
||||
230
app/assets/css/cascade/development/responsive.css
Normal file
230
app/assets/css/cascade/development/responsive.css
Normal file
|
|
@ -0,0 +1,230 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
@media (min-width:1200px) {
|
||||
.site-center {
|
||||
width:1160px;
|
||||
}
|
||||
.cell{
|
||||
margin:15px;
|
||||
}
|
||||
}
|
||||
|
||||
@media (min-width:768px) and (max-width:979px) {
|
||||
.site-center {
|
||||
width:704px;
|
||||
}
|
||||
}
|
||||
|
||||
@media (max-width:767px) {
|
||||
.parsley-error-list {
|
||||
position: static;
|
||||
display: block !important;
|
||||
margin-left:3px;
|
||||
}
|
||||
|
||||
main,section,article,header,footer,aside,nav,.col,
|
||||
main.width-fit,main.width-fill,
|
||||
section.width-fit,section.width-fill,
|
||||
article.width-fit,article.width-fill,
|
||||
header.width-fit,header.width-fill,
|
||||
footer.width-fit,footer.width-fill,
|
||||
aside.width-fit,aside.width-fill,
|
||||
nav.width-fit,nav.width-fill,
|
||||
.col.width-fit,.col.width-fill {
|
||||
padding:0 !important;
|
||||
display:block !important;
|
||||
float:left !important;
|
||||
width:100% !important;
|
||||
}
|
||||
|
||||
.site-center,.site-body,.site-header,.site-footer,.site-center > .body {
|
||||
margin:0 !important;
|
||||
width:100% !important;
|
||||
border:none !important;
|
||||
-webkit-box-shadow:none !important;
|
||||
-moz-box-shadow:none !important;
|
||||
box-shadow:none !important;
|
||||
-webkit-border-radius: 0 !important;
|
||||
-moz-border-radius: 0 !important;
|
||||
border-radius: 0 !important;
|
||||
}
|
||||
|
||||
.center {
|
||||
float:none !important;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/* =============================================================================
|
||||
width-fit and width-fill support for mobile
|
||||
========================================================================== */
|
||||
|
||||
@media (max-width: 767px) {
|
||||
main.mobile-width-fill,
|
||||
section.mobile-width-fill,
|
||||
article.mobile-width-fill,
|
||||
header.mobile-width-fill,
|
||||
footer.mobile-width-fill,
|
||||
aside.mobile-width-fill,
|
||||
nav.mobile-width-fill,
|
||||
.col.mobile-width-fill {display:table-cell !important;float:none!important;min-width:50px!important;width:10000px!important;}
|
||||
main.mobile-width-fit,
|
||||
section.mobile-width-fit,
|
||||
article.mobile-width-fit,
|
||||
header.mobile-width-fit,
|
||||
footer.mobile-width-fit,
|
||||
aside.mobile-width-fit,
|
||||
nav.mobile-width-fit,
|
||||
.col.mobile-width-fit {width:auto!important;}
|
||||
|
||||
.mobile-center {
|
||||
float:none !important;
|
||||
margin-left:auto !important;
|
||||
margin-right:auto !important;
|
||||
}
|
||||
}
|
||||
|
||||
@media (min-width: 481px) and (max-width: 767px) {
|
||||
main.mobile-width-fill,
|
||||
section.tablet-width-fill,
|
||||
article.tablet-width-fill,
|
||||
header.tablet-width-fill,
|
||||
footer.tablet-width-fill,
|
||||
aside.tablet-width-fill,
|
||||
nav.tablet-width-fill,
|
||||
.col.tablet-width-fill {display:table-cell !important;float:none!important;min-width:50px!important;width:10000px!important;}
|
||||
main.mobile-width-fill,
|
||||
section.tablet-width-fit,
|
||||
article.tablet-width-fit,
|
||||
header.tablet-width-fit,
|
||||
footer.tablet-width-fit,
|
||||
aside.tablet-width-fit,
|
||||
nav.tablet-width-fit,
|
||||
.col.tablet-width-fit {width:auto!important;}
|
||||
|
||||
.tablet-center {
|
||||
float:none !important;
|
||||
margin-left:auto !important;
|
||||
margin-right:auto !important;
|
||||
}
|
||||
}
|
||||
|
||||
@media (max-width: 480px) {
|
||||
main.phone-width-fill,
|
||||
section.phone-width-fill,
|
||||
article.phone-width-fill,
|
||||
header.phone-width-fill,
|
||||
footer.phone-width-fill,
|
||||
aside.phone-width-fill,
|
||||
nav.phone-width-fill,
|
||||
.col.phone-width-fill {display:table-cell !important;float:none!important;min-width:50px!important;width:10000px!important;}
|
||||
main.phone-width-fit,
|
||||
section.phone-width-fit,
|
||||
article.phone-width-fit,
|
||||
header.phone-width-fit,
|
||||
footer.phone-width-fit,
|
||||
aside.phone-width-fit,
|
||||
nav.phone-width-fit,
|
||||
.col.phone-width-fit {width:auto!important;}
|
||||
|
||||
.phone-center {
|
||||
float:none !important;
|
||||
margin-left:auto !important;
|
||||
margin-right:auto !important;
|
||||
}
|
||||
}
|
||||
191
app/assets/css/cascade/development/tables.css
Normal file
191
app/assets/css/cascade/development/tables.css
Normal file
|
|
@ -0,0 +1,191 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
.block th, .block td {
|
||||
padding:10px 20px;
|
||||
}
|
||||
|
||||
.condensed th, .condensed td {
|
||||
padding:4px 5px;
|
||||
}
|
||||
|
||||
.datasheet td,.datasheet th {
|
||||
padding:2px 4px;
|
||||
}
|
||||
|
||||
.outline-header th {
|
||||
font-size:14px;
|
||||
line-height:14px;
|
||||
}
|
||||
|
||||
.datasheet th {
|
||||
line-height:16px;
|
||||
height:18px;
|
||||
}
|
||||
|
||||
.datasheet tbody th {
|
||||
text-align:right;
|
||||
}
|
||||
|
||||
.uppercase-header th {
|
||||
text-transform:uppercase;
|
||||
}
|
||||
|
||||
.box-header th {
|
||||
border-left-width:0;
|
||||
border-right-width:0;
|
||||
}
|
||||
|
||||
.box-header th,.outline td,.outline th {
|
||||
border-bottom-width:0;
|
||||
}
|
||||
|
||||
.outline tr :last-child {
|
||||
border-right-width:0;
|
||||
}
|
||||
|
||||
.block th, .block td {
|
||||
border-width:0 1px 0 0;
|
||||
}
|
||||
|
||||
table.box {
|
||||
border-width:1px;
|
||||
}
|
||||
|
||||
.header-border thead td,.header-border thead th {
|
||||
border-bottom-width:1px;
|
||||
}
|
||||
|
||||
table.block {
|
||||
border-width:1px 0 1px 1px;
|
||||
}
|
||||
|
||||
.datasheet td,.datasheet th {
|
||||
border-width:1px;
|
||||
}
|
||||
|
||||
table.border,table.datasheet {
|
||||
border-width:1px 0 0 1px;
|
||||
}
|
||||
|
||||
.datasheet td,.border th,.border td {
|
||||
border-width:0 1px 1px 0;
|
||||
}
|
||||
|
||||
.box-header thead tr {
|
||||
border-width:0 0 1px 0;
|
||||
}
|
||||
|
||||
table.outline {
|
||||
border-width:2px;
|
||||
}
|
||||
|
||||
.horizontal-border th, .horizontal-border td {
|
||||
border-bottom-width:1px;
|
||||
}
|
||||
|
||||
.outline-header thead td,.outline-header thead th {
|
||||
border-bottom-width:2px;
|
||||
}
|
||||
|
||||
.border .body {
|
||||
border-bottom-width:0;
|
||||
}
|
||||
|
||||
.border .body,.block .body {
|
||||
border-right-width:0;
|
||||
}
|
||||
152
app/assets/css/cascade/development/tablet-grids.css
Normal file
152
app/assets/css/cascade/development/tablet-grids.css
Normal file
|
|
@ -0,0 +1,152 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
|
||||
|
||||
@media (min-width: 481px) and (max-width: 767px) {
|
||||
.tablet-width-1of24{width:4.1666666% !important;}
|
||||
.tablet-width-1of16{width:6.25% !important;}
|
||||
.tablet-width-1of12,.tablet-width-2of24{width:8.3333333% !important;}
|
||||
.tablet-width-1of10{width:10% !important;}
|
||||
.tablet-width-1of9{width:11.1111111% !important;}
|
||||
.tablet-width-1of8,.tablet-width-2of16,.tablet-width-3of24{width:12.5% !important;}
|
||||
.tablet-width-1of7{width:14.2857143% !important;}
|
||||
.tablet-width-1of6,.tablet-width-2of12,.tablet-width-4of24{width:16.6666666% !important;}
|
||||
.tablet-width-3of16{width:18.75% !important;}
|
||||
.tablet-width-1of5,.tablet-width-2of10{width:20% !important;}
|
||||
.tablet-width-5of24{width:20.8333333% !important;}
|
||||
.tablet-width-2of9{width:22.2222222% !important;}
|
||||
.tablet-width-1of4,.tablet-width-2of8,.tablet-width-3of12,.tablet-width-4of16,.tablet-width-6of24{width:25% !important;}
|
||||
.size2of7{width:28.5714286% !important;}
|
||||
.tablet-width-7of24{width:29.1666666% !important;}
|
||||
.tablet-width-3of10{width:30% !important;}
|
||||
.tablet-width-5of16{width:31.25% !important;}
|
||||
.tablet-width-1of3,.tablet-width-2of6,.tablet-width-3of9,.tablet-width-4of12,.tablet-width-8of24{width:33.3333333% !important;}
|
||||
.tablet-width-3of8,.tablet-width-6of16,.tablet-width-9of24{width:37.5% !important;}
|
||||
.tablet-width-2of5,.tablet-width-4of10{width:40% !important;}
|
||||
.tablet-width-5of12,.tablet-width-10of24{width:41.6666666% !important;}
|
||||
.tablet-width-3of7{width:42.8571429% !important;}
|
||||
.tablet-width-7of16{width:43.75% !important;}
|
||||
.tablet-width-4of9{width:44.4444444% !important;}
|
||||
.tablet-width-11of24{width:45.8333333% !important;}
|
||||
.tablet-width-1of2,.tablet-width-2of4,.tablet-width-3of6,.tablet-width-4of8,.tablet-width-5of10,.tablet-width-6of12,.tablet-width-8of16,.tablet-width-12of24{width:50% !important;}
|
||||
.tablet-width-13of24{width:54.1666666% !important;}
|
||||
.tablet-width-5of9{width:55.5555555% !important;}
|
||||
.tablet-width-9of16{width:56.25% !important;}
|
||||
.tablet-width-4of7{width:57.1428572% !important;}
|
||||
.tablet-width-7of12,.tablet-width-14of24{width:58.3333333% !important;}
|
||||
.tablet-width-3of5,.tablet-width-6of10{width:60% !important;}
|
||||
.tablet-width-5of8,.tablet-width-10of16,.tablet-width-15of24{width:62.5% !important;}
|
||||
.tablet-width-2of3,.tablet-width-4of6,.tablet-width-6of9,.tablet-width-8of12,.tablet-width-16of24{width:66.6666666% !important;}
|
||||
.tablet-width-11of16{width:68.75% !important;}
|
||||
.tablet-width-7of10{width:70% !important;}
|
||||
.tablet-width-17of24{width:70.8333333% !important;}
|
||||
.tablet-width-5of7{width:71.4285715% !important;}
|
||||
.tablet-width-3of4,.tablet-width-6of8,.tablet-width-9of12,.tablet-width-12of16,.tablet-width-18of24{width:75% !important;}
|
||||
.tablet-width-7of9{width:77.7777777% !important;}
|
||||
.tablet-width-19of24{width:79.1666666% !important;}
|
||||
.tablet-width-4of5,.tablet-width-8of10{width:80% !important;}
|
||||
.tablet-width-13of16{width:81.25% !important;}
|
||||
.tablet-width-5of6,.tablet-width-10of12,.tablet-width-20of24{width:83.3333333% !important;}
|
||||
.tablet-width-6of7{width:85.7142858% !important;}
|
||||
.tablet-width-7of8,.tablet-width-14of16,.tablet-width-21of24{width:87.5% !important;}
|
||||
.tablet-width-8of9{width:88.8888888% !important;}
|
||||
.tablet-width-9of10{width:90% !important;}
|
||||
.tablet-width-11of12,.tablet-width-22of24{width:91.6666666% !important;}
|
||||
.tablet-width-15of16{width:93.75% !important;}
|
||||
.tablet-width-23of24{width:95.8333333% !important;}
|
||||
}
|
||||
335
app/assets/css/cascade/development/typography.css
Normal file
335
app/assets/css/cascade/development/typography.css
Normal file
|
|
@ -0,0 +1,335 @@
|
|||
/*!
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* CASCADE FRAMEWORK 1.0
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Copyright 2013, John Slegers
|
||||
* Released under the MIT license
|
||||
* http://jslegers.github.com/cascadeframework/license.html
|
||||
*
|
||||
*
|
||||
* This means you can use Cascade Framework for any project,
|
||||
* whether commercial or not.
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
*
|
||||
* Cascade Framework also contains the following goodies,
|
||||
* which all have the same or similar 'permissive licenses :
|
||||
*
|
||||
*
|
||||
* Includes polyfills by Joshua Bell
|
||||
* http://www.calormen.com/polyfill/
|
||||
* Released in public domain
|
||||
*
|
||||
*
|
||||
* Includes Google ExplorerCanvas
|
||||
* https://code.google.com/p/explorercanvas/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Google Prettify
|
||||
* https://code.google.com/p/google-code-prettify/
|
||||
* Released under the Apache 2.0 license
|
||||
*
|
||||
*
|
||||
* Includes Yepnope
|
||||
* http://yepnopejs.com/
|
||||
* Released under the WTFPL license
|
||||
*
|
||||
*
|
||||
* Includes Modernizr
|
||||
* http://modernizr.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes lodash
|
||||
* http://lodash.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery
|
||||
* http://jquery.com/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Easing plugin
|
||||
* http://gsgd.co.uk/sandbox/jquery/easing/
|
||||
* Released under the BSD license
|
||||
*
|
||||
*
|
||||
* Includes jQuery Flot plugin
|
||||
* http://www.flotcharts.org/
|
||||
* Released under the MIT license
|
||||
*
|
||||
*
|
||||
* Includes the Font Awesome webfont
|
||||
* http://fortawesome.github.com/Font-Awesome/
|
||||
* Released under the SIL Open Font License
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*
|
||||
* Cascade Framework was inspired by many articles and projects
|
||||
*
|
||||
* Especially these authors are worth mentioning :
|
||||
*
|
||||
* Nicolle Sullivan
|
||||
* Jonathan Snook
|
||||
* Chris Coyier
|
||||
* Eric Meyer
|
||||
* Nicolas Gallagher
|
||||
* Paul Irish
|
||||
* Mark Otto
|
||||
* Jacob Thornton
|
||||
*
|
||||
*
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
* Date: 2013-03-15
|
||||
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||
*/
|
||||
|
||||
@font-face {
|
||||
font-family:'FontAwesome';
|
||||
src: url('../font/fontawesome-webfont.eot?v=3.2.1');
|
||||
src: url('../font/fontawesome-webfont.eot?#iefix&v=3.2.1') format('embedded-opentype'),
|
||||
url('../font/fontawesome-webfont.woff?v=3.2.1') format('woff'),
|
||||
url('../font/fontawesome-webfont.ttf?v=3.2.1') format('truetype'),
|
||||
url('../font/fontawesome-webfont.svg#fontawesomeregular?v=3.2.1') format('svg');
|
||||
}
|
||||
|
||||
body,h1,h2,h3,h4,h5,h6 {
|
||||
text-rendering:optimizeLegibility;
|
||||
}
|
||||
|
||||
body {
|
||||
font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;
|
||||
-webkit-text-size-adjust:100%;
|
||||
-ms-text-size-adjust:100%;
|
||||
}
|
||||
|
||||
p,button,input,select,textarea {
|
||||
font-family: inherit;
|
||||
}
|
||||
|
||||
pre,code,kbd,samp {
|
||||
font-family:Menlo,Monaco,"Courier New",monospace;
|
||||
}
|
||||
|
||||
.icon {
|
||||
font-family:FontAwesome;
|
||||
}
|
||||
|
||||
i,dfn,em,figcaption,cite {
|
||||
font-style:italic;
|
||||
}
|
||||
|
||||
address,cite,legend {
|
||||
font-style:inherit;
|
||||
white-space:inherit;
|
||||
}
|
||||
|
||||
.nav li,.label {
|
||||
white-space:nowrap;
|
||||
}
|
||||
|
||||
pre {
|
||||
white-space:pre;
|
||||
white-space:pre-wrap;
|
||||
}
|
||||
|
||||
.left li,.right li {
|
||||
white-space:normal;
|
||||
}
|
||||
|
||||
pre {
|
||||
word-break:break-all;
|
||||
word-wrap:break-word;
|
||||
}
|
||||
|
||||
b,th,strong,h1,h2,h3,h4,h5,h6,dt,.label,.fatty,.panel .header,.tags .blocks a,.tags .blocks .disabled,.pipes .stat a,.parsley-error-list li,.menu .links li,.site-header-ghost .nav a,.site-header .nav a,.tabs .active a {
|
||||
font-weight:700;
|
||||
}
|
||||
|
||||
blockquote p,.menu .header {
|
||||
font-weight:300;
|
||||
}
|
||||
|
||||
small,.pipes .stat span {
|
||||
font-weight:normal;
|
||||
}
|
||||
|
||||
body {
|
||||
font-size:13px;
|
||||
}
|
||||
|
||||
h1 {
|
||||
font-size:230%;
|
||||
}
|
||||
|
||||
h2 {
|
||||
font-size:185%;
|
||||
}
|
||||
|
||||
.tags .cloud .tag5 {
|
||||
font-size:180%;
|
||||
}
|
||||
|
||||
.tags .cloud .tag4 {
|
||||
font-size:160%;
|
||||
}
|
||||
|
||||
h3,.pipes .stat a,.tags .cloud .tag3 {
|
||||
font-size:140%;
|
||||
}
|
||||
|
||||
.icon-button .icon, .tags .cloud .tag2,blockquote p,.site-header .nav a,.site-header-ghost .nav a {
|
||||
font-size:120%;
|
||||
}
|
||||
|
||||
.panel .header {
|
||||
font-size:113%;
|
||||
}
|
||||
|
||||
.fatty {
|
||||
font-size:110%;
|
||||
}
|
||||
|
||||
h4,.menu .nav a,.menu .nav .disabled {
|
||||
font-size:106%;
|
||||
}
|
||||
|
||||
p,button,.button,input,select,textarea,small,.icon,.tags .cloud .tag1 {
|
||||
font-size:100%;
|
||||
}
|
||||
|
||||
abbr,.label,pre,code,kbd,samp,table,h4 small,h5 {
|
||||
font-size:95%;
|
||||
}
|
||||
|
||||
h6,p small,sub,sup,.menu .header .nav a {
|
||||
font-size:85%;
|
||||
}
|
||||
|
||||
h2 small,h3 small {
|
||||
font-size:75%;
|
||||
}
|
||||
|
||||
.tiny,.pipes .stat span {
|
||||
font-size:70%;
|
||||
}
|
||||
|
||||
h1 small {
|
||||
font-size:60%;
|
||||
}
|
||||
|
||||
.tabs .nav a {
|
||||
line-height:270%;
|
||||
}
|
||||
|
||||
h6 {
|
||||
line-height:170%;
|
||||
}
|
||||
|
||||
body,input,button,.button,select,address,dt,dd,li,p,h2,h3,h5,pre {
|
||||
line-height:150%;
|
||||
}
|
||||
|
||||
table input {
|
||||
line-height:135%;
|
||||
}
|
||||
|
||||
h4,.pipes li,.panel .footer {
|
||||
line-height:130%;
|
||||
}
|
||||
|
||||
.label,h1 {
|
||||
line-height:120%;
|
||||
}
|
||||
|
||||
.menu a,.menu .disabled,.panel .header {
|
||||
line-height:110%;
|
||||
}
|
||||
|
||||
td,th,small,.tiny {
|
||||
line-height:100%;
|
||||
}
|
||||
|
||||
sub,sup {
|
||||
line-height:0;
|
||||
}
|
||||
|
||||
.button .icon {
|
||||
line-height:16px;
|
||||
}
|
||||
|
||||
.tags .nav li {
|
||||
line-height:19px;
|
||||
}
|
||||
|
||||
.tags .nav a {
|
||||
line-height:inherit;
|
||||
}
|
||||
|
||||
.icon-16 {
|
||||
font-size:14px;
|
||||
line-height: 16px;
|
||||
}
|
||||
|
||||
.icon-32 {
|
||||
font-size:28px;
|
||||
line-height:32px;
|
||||
}
|
||||
|
||||
.icon-64 {
|
||||
font-size:56px;
|
||||
line-height:64px;
|
||||
}
|
||||
|
||||
.icon-128 {
|
||||
font-size:112px;
|
||||
line-height:128px;
|
||||
}
|
||||
|
||||
h6,abbr,.tiny {
|
||||
text-transform:uppercase;
|
||||
}
|
||||
|
||||
a:hover {
|
||||
text-decoration:underline;
|
||||
}
|
||||
|
||||
del {
|
||||
text-decoration:line-through;
|
||||
}
|
||||
|
||||
ins,a,.nav a:hover,.button:hover,.collapse-trigger a:hover {
|
||||
text-decoration:none;
|
||||
}
|
||||
|
||||
.tiny {
|
||||
letter-spacing:1px;
|
||||
}
|
||||
|
||||
button,.button,input,select,.radio,.checkbox {
|
||||
vertical-align:bottom;
|
||||
*vertical-align:middle;
|
||||
}
|
||||
|
||||
th,td,.icon,textarea,td img {
|
||||
vertical-align:top;
|
||||
}
|
||||
|
||||
.radio,.checkbox,.icon-16,.icon-32,.icon-64,.icon-128,.button .icon {
|
||||
vertical-align:middle;
|
||||
}
|
||||
|
||||
sub,sup,.label {
|
||||
vertical-align:baseline;
|
||||
}
|
||||
BIN
app/assets/css/cascade/font/FontAwesome.otf
Normal file
BIN
app/assets/css/cascade/font/FontAwesome.otf
Normal file
Binary file not shown.
BIN
app/assets/css/cascade/font/fontawesome-webfont.eot
Normal file
BIN
app/assets/css/cascade/font/fontawesome-webfont.eot
Normal file
Binary file not shown.
399
app/assets/css/cascade/font/fontawesome-webfont.svg
Normal file
399
app/assets/css/cascade/font/fontawesome-webfont.svg
Normal file
|
|
@ -0,0 +1,399 @@
|
|||
<?xml version="1.0" standalone="no"?>
|
||||
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
|
||||
<svg xmlns="http://www.w3.org/2000/svg">
|
||||
<metadata></metadata>
|
||||
<defs>
|
||||
<font id="fontawesomeregular" horiz-adv-x="1536" >
|
||||
<font-face units-per-em="1792" ascent="1536" descent="-256" />
|
||||
<missing-glyph horiz-adv-x="448" />
|
||||
<glyph unicode=" " horiz-adv-x="448" />
|
||||
<glyph unicode="	" horiz-adv-x="448" />
|
||||
<glyph unicode=" " horiz-adv-x="448" />
|
||||
<glyph unicode="¨" horiz-adv-x="1792" />
|
||||
<glyph unicode="©" horiz-adv-x="1792" />
|
||||
<glyph unicode="®" horiz-adv-x="1792" />
|
||||
<glyph unicode="´" horiz-adv-x="1792" />
|
||||
<glyph unicode="Æ" horiz-adv-x="1792" />
|
||||
<glyph unicode=" " horiz-adv-x="768" />
|
||||
<glyph unicode=" " />
|
||||
<glyph unicode=" " horiz-adv-x="768" />
|
||||
<glyph unicode=" " />
|
||||
<glyph unicode=" " horiz-adv-x="512" />
|
||||
<glyph unicode=" " horiz-adv-x="384" />
|
||||
<glyph unicode=" " horiz-adv-x="256" />
|
||||
<glyph unicode=" " horiz-adv-x="256" />
|
||||
<glyph unicode=" " horiz-adv-x="192" />
|
||||
<glyph unicode=" " horiz-adv-x="307" />
|
||||
<glyph unicode=" " horiz-adv-x="85" />
|
||||
<glyph unicode=" " horiz-adv-x="307" />
|
||||
<glyph unicode=" " horiz-adv-x="384" />
|
||||
<glyph unicode="™" horiz-adv-x="1792" />
|
||||
<glyph unicode="∞" horiz-adv-x="1792" />
|
||||
<glyph unicode="≠" horiz-adv-x="1792" />
|
||||
<glyph unicode="" horiz-adv-x="500" d="M0 0z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1699 1350q0 -35 -43 -78l-632 -632v-768h320q26 0 45 -19t19 -45t-19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45t45 19h320v768l-632 632q-43 43 -43 78q0 23 18 36.5t38 17.5t43 4h1408q23 0 43 -4t38 -17.5t18 -36.5z" />
|
||||
<glyph unicode="" d="M1536 1312v-1120q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v537l-768 -237v-709q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89 t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v967q0 31 19 56.5t49 35.5l832 256q12 4 28 4q40 0 68 -28t28 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -52 -38 -90t-90 -38q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5 t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1664 32v768q-32 -36 -69 -66q-268 -206 -426 -338q-51 -43 -83 -67t-86.5 -48.5t-102.5 -24.5h-1h-1q-48 0 -102.5 24.5t-86.5 48.5t-83 67q-158 132 -426 338q-37 30 -69 66v-768q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1664 1083v11v13.5t-0.5 13 t-3 12.5t-5.5 9t-9 7.5t-14 2.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5q0 -168 147 -284q193 -152 401 -317q6 -5 35 -29.5t46 -37.5t44.5 -31.5t50.5 -27.5t43 -9h1h1q20 0 43 9t50.5 27.5t44.5 31.5t46 37.5t35 29.5q208 165 401 317q54 43 100.5 115.5t46.5 131.5z M1792 1120v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M896 -128q-26 0 -44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124t127 -344q0 -221 -229 -450l-623 -600 q-18 -18 -44 -18z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -21 -10.5 -35.5t-30.5 -14.5q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455 l502 -73q56 -9 56 -46z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1137 532l306 297l-422 62l-189 382l-189 -382l-422 -62l306 -297l-73 -421l378 199l377 -199zM1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -50 -41 -50q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500 l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455l502 -73q56 -9 56 -46z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1408 131q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5t43 97.5t62 81t85.5 53.5t111.5 20q9 0 42 -21.5t74.5 -48t108 -48t133.5 -21.5t133.5 21.5t108 48t74.5 48t42 21.5q61 0 111.5 -20t85.5 -53.5t62 -81 t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M384 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 320v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 704v128q0 26 -19 45t-45 19h-128 q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 -64v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM384 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45 t45 -19h128q26 0 45 19t19 45zM1792 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 704v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1792 320v128 q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 704v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19 t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1920 1248v-1344q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1344q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M768 512v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM768 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 512v-384q0 -52 -38 -90t-90 -38 h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 288v-192q0 -40 -28 -68t-68 -28h-320 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192 q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-960 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 h960q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1671 970q0 -40 -28 -68l-724 -724l-136 -136q-28 -28 -68 -28t-68 28l-136 136l-362 362q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -295l656 657q28 28 68 28t68 -28l136 -136q28 -28 28 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1298 214q0 -40 -28 -68l-136 -136q-28 -28 -68 -28t-68 28l-294 294l-294 -294q-28 -28 -68 -28t-68 28l-136 136q-28 28 -28 68t28 68l294 294l-294 294q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -294l294 294q28 28 68 28t68 -28l136 -136q28 -28 28 -68 t-28 -68l-294 -294l294 -294q28 -28 28 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-224q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v224h-224q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h224v224q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5v-224h224 q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5 t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-576q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h576q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5z M1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z " />
|
||||
<glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61t-298 61t-245 164t-164 245t-61 298q0 182 80.5 343t226.5 270q43 32 95.5 25t83.5 -50q32 -42 24.5 -94.5t-49.5 -84.5q-98 -74 -151.5 -181t-53.5 -228q0 -104 40.5 -198.5t109.5 -163.5t163.5 -109.5 t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5q0 121 -53.5 228t-151.5 181q-42 32 -49.5 84.5t24.5 94.5q31 43 84 50t95 -25q146 -109 226.5 -270t80.5 -343zM896 1408v-640q0 -52 -38 -90t-90 -38t-90 38t-38 90v640q0 52 38 90t90 38t90 -38t38 -90z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M256 96v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 224v-320q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 480v-576q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23 v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1408 864v-960q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1376v-1472q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1472q0 14 9 23t23 9h192q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1536 749v-222q0 -12 -8 -23t-20 -13l-185 -28q-19 -54 -39 -91q35 -50 107 -138q10 -12 10 -25t-9 -23q-27 -37 -99 -108t-94 -71q-12 0 -26 9l-138 108q-44 -23 -91 -38 q-16 -136 -29 -186q-7 -28 -36 -28h-222q-14 0 -24.5 8.5t-11.5 21.5l-28 184q-49 16 -90 37l-141 -107q-10 -9 -25 -9q-14 0 -25 11q-126 114 -165 168q-7 10 -7 23q0 12 8 23q15 21 51 66.5t54 70.5q-27 50 -41 99l-183 27q-13 2 -21 12.5t-8 23.5v222q0 12 8 23t19 13 l186 28q14 46 39 92q-40 57 -107 138q-10 12 -10 24q0 10 9 23q26 36 98.5 107.5t94.5 71.5q13 0 26 -10l138 -107q44 23 91 38q16 136 29 186q7 28 36 28h222q14 0 24.5 -8.5t11.5 -21.5l28 -184q49 -16 90 -37l142 107q9 9 24 9q13 0 25 -10q129 -119 165 -170q7 -8 7 -22 q0 -12 -8 -23q-15 -21 -51 -66.5t-54 -70.5q26 -50 41 -98l183 -28q13 -2 21 -12.5t8 -23.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M512 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM768 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1024 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576 q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1152 76v948h-896v-948q0 -22 7 -40.5t14.5 -27t10.5 -8.5h832q3 0 10.5 8.5t14.5 27t7 40.5zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832 q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1408 544v-480q0 -26 -19 -45t-45 -19h-384v384h-256v-384h-384q-26 0 -45 19t-19 45v480q0 1 0.5 3t0.5 3l575 474l575 -474q1 -2 1 -6zM1631 613l-62 -74q-8 -9 -21 -11h-3q-13 0 -21 7l-692 577l-692 -577q-12 -8 -24 -7q-13 2 -21 11l-62 74q-8 10 -7 23.5t11 21.5 l719 599q32 26 76 26t76 -26l244 -204v195q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-408l219 -182q10 -8 11 -21.5t-7 -23.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1280" d="M128 0h1024v768h-416q-40 0 -68 28t-28 68v416h-512v-1280zM768 896h376q-10 29 -22 41l-313 313q-12 12 -41 22v-376zM1280 864v-896q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h640q40 0 88 -20t76 -48l312 -312q28 -28 48 -76t20 -88z " />
|
||||
<glyph unicode="" d="M896 992v-448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1111 540v4l-24 320q-1 13 -11 22.5t-23 9.5h-186q-13 0 -23 -9.5t-11 -22.5l-24 -320v-4q-1 -12 8 -20t21 -8h244q12 0 21 8t8 20zM1870 73q0 -73 -46 -73h-704q13 0 22 9.5t8 22.5l-20 256q-1 13 -11 22.5t-23 9.5h-272q-13 0 -23 -9.5t-11 -22.5l-20 -256 q-1 -13 8 -22.5t22 -9.5h-704q-46 0 -46 73q0 54 26 116l417 1044q8 19 26 33t38 14h339q-13 0 -23 -9.5t-11 -22.5l-15 -192q-1 -14 8 -23t22 -9h166q13 0 22 9t8 23l-15 192q-1 13 -11 22.5t-23 9.5h339q20 0 38 -14t26 -33l417 -1044q26 -62 26 -116z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1280 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 416v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h465l135 -136 q58 -56 136 -56t136 56l136 136h464q40 0 68 -28t28 -68zM1339 985q17 -41 -14 -70l-448 -448q-18 -19 -45 -19t-45 19l-448 448q-31 29 -14 70q17 39 59 39h256v448q0 26 19 45t45 19h256q26 0 45 -19t19 -45v-448h256q42 0 59 -39z" />
|
||||
<glyph unicode="" d="M1120 608q0 -12 -10 -24l-319 -319q-11 -9 -23 -9t-23 9l-320 320q-15 16 -7 35q8 20 30 20h192v352q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-352h192q14 0 23 -9t9 -23zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273 t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1118 660q-8 -20 -30 -20h-192v-352q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v352h-192q-14 0 -23 9t-9 23q0 12 10 24l319 319q11 9 23 9t23 -9l320 -320q15 -16 7 -35zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198 t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1023 576h316q-1 3 -2.5 8t-2.5 8l-212 496h-708l-212 -496q-1 -2 -2.5 -8t-2.5 -8h316l95 -192h320zM1536 546v-482q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v482q0 62 25 123l238 552q10 25 36.5 42t52.5 17h832q26 0 52.5 -17t36.5 -42l238 -552 q25 -61 25 -123z" />
|
||||
<glyph unicode="" d="M1184 640q0 -37 -32 -55l-544 -320q-15 -9 -32 -9q-16 0 -32 8q-32 19 -32 56v640q0 37 32 56q33 18 64 -1l544 -320q32 -18 32 -55zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l138 138q-148 137 -349 137q-104 0 -198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5q119 0 225 52t179 147q7 10 23 12q14 0 25 -9 l137 -138q9 -8 9.5 -20.5t-7.5 -22.5q-109 -132 -264 -204.5t-327 -72.5q-156 0 -298 61t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q147 0 284.5 -55.5t244.5 -156.5l130 129q29 31 70 14q39 -17 39 -59z" />
|
||||
<glyph unicode="" d="M1511 480q0 -5 -1 -7q-64 -268 -268 -434.5t-478 -166.5q-146 0 -282.5 55t-243.5 157l-129 -129q-19 -19 -45 -19t-45 19t-19 45v448q0 26 19 45t45 19h448q26 0 45 -19t19 -45t-19 -45l-137 -137q71 -66 161 -102t187 -36q134 0 250 65t186 179q11 17 53 117 q8 23 30 23h192q13 0 22.5 -9.5t9.5 -22.5zM1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-26 0 -45 19t-19 45t19 45l138 138q-148 137 -349 137q-134 0 -250 -65t-186 -179q-11 -17 -53 -117q-8 -23 -30 -23h-199q-13 0 -22.5 9.5t-9.5 22.5v7q65 268 270 434.5t480 166.5 q146 0 284 -55.5t245 -156.5l130 129q19 19 45 19t45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M384 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M384 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1536 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5z M1536 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5zM1536 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5 t9.5 -22.5zM1664 160v832q0 13 -9.5 22.5t-22.5 9.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 1248v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47 t47 -113z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M320 768h512v192q0 106 -75 181t-181 75t-181 -75t-75 -181v-192zM1152 672v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v192q0 184 132 316t316 132t316 -132t132 -316v-192h32q40 0 68 -28t28 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M320 1280q0 -72 -64 -110v-1266q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v1266q-64 38 -64 110q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -25 -12.5 -38.5t-39.5 -27.5q-215 -116 -369 -116q-61 0 -123.5 22t-108.5 48 t-115.5 48t-142.5 22q-192 0 -464 -146q-17 -9 -33 -9q-26 0 -45 19t-19 45v742q0 32 31 55q21 14 79 43q236 120 421 120q107 0 200 -29t219 -88q38 -19 88 -19q54 0 117.5 21t110 47t88 47t54.5 21q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1664 650q0 -166 -60 -314l-20 -49l-185 -33q-22 -83 -90.5 -136.5t-156.5 -53.5v-32q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-32q71 0 130 -35.5t93 -95.5l68 12q29 95 29 193q0 148 -88 279t-236.5 209t-315.5 78 t-315.5 -78t-236.5 -209t-88 -279q0 -98 29 -193l68 -12q34 60 93 95.5t130 35.5v32q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v32q-88 0 -156.5 53.5t-90.5 136.5l-185 33l-20 49q-60 148 -60 314q0 151 67 291t179 242.5 t266 163.5t320 61t320 -61t266 -163.5t179 -242.5t67 -291z" />
|
||||
<glyph unicode="" horiz-adv-x="768" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 35.5 t12 57t-12 57t-29 35.5t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 35.5 t12 57t-12 57t-29 35.5t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142zM1408 640q0 -153 -85 -282.5t-225 -188.5q-13 -5 -25 -5q-27 0 -46 19t-19 45q0 39 39 59q56 29 76 44q74 54 115.5 135.5t41.5 173.5t-41.5 173.5 t-115.5 135.5q-20 15 -76 44q-39 20 -39 59q0 26 19 45t45 19q13 0 26 -5q140 -59 225 -188.5t85 -282.5zM1664 640q0 -230 -127 -422.5t-338 -283.5q-13 -5 -26 -5q-26 0 -45 19t-19 45q0 36 39 59q7 4 22.5 10.5t22.5 10.5q46 25 82 51q123 91 192 227t69 289t-69 289 t-192 227q-36 26 -82 51q-7 4 -22.5 10.5t-22.5 10.5q-39 23 -39 59q0 26 19 45t45 19q13 0 26 -5q211 -91 338 -283.5t127 -422.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M384 384v-128h-128v128h128zM384 1152v-128h-128v128h128zM1152 1152v-128h-128v128h128zM128 129h384v383h-384v-383zM128 896h384v384h-384v-384zM896 896h384v384h-384v-384zM640 640v-640h-640v640h640zM1152 128v-128h-128v128h128zM1408 128v-128h-128v128h128z M1408 640v-384h-384v128h-128v-384h-128v640h384v-128h128v128h128zM640 1408v-640h-640v640h640zM1408 1408v-640h-640v640h640z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M63 0h-63v1408h63v-1408zM126 1h-32v1407h32v-1407zM220 1h-31v1407h31v-1407zM377 1h-31v1407h31v-1407zM534 1h-62v1407h62v-1407zM660 1h-31v1407h31v-1407zM723 1h-31v1407h31v-1407zM786 1h-31v1407h31v-1407zM943 1h-63v1407h63v-1407zM1100 1h-63v1407h63v-1407z M1226 1h-63v1407h63v-1407zM1352 1h-63v1407h63v-1407zM1446 1h-63v1407h63v-1407zM1635 1h-94v1407h94v-1407zM1698 1h-32v1407h32v-1407zM1792 0h-63v1408h63v-1408z" />
|
||||
<glyph unicode="" d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 l715 -714q37 -39 37 -91z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 l715 -714q37 -39 37 -91zM1899 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-36 0 -59 14t-53 45l470 470q37 37 37 90q0 52 -37 91l-715 714q-38 38 -102 64.5t-117 26.5h224q53 0 117 -26.5t102 -64.5l715 -714q37 -39 37 -91z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1639 1058q40 -57 18 -129l-275 -906q-19 -64 -76.5 -107.5t-122.5 -43.5h-923q-77 0 -148.5 53.5t-99.5 131.5q-24 67 -2 127q0 4 3 27t4 37q1 8 -3 21.5t-3 19.5q2 11 8 21t16.5 23.5t16.5 23.5q23 38 45 91.5t30 91.5q3 10 0.5 30t-0.5 28q3 11 17 28t17 23 q21 36 42 92t25 90q1 9 -2.5 32t0.5 28q4 13 22 30.5t22 22.5q19 26 42.5 84.5t27.5 96.5q1 8 -3 25.5t-2 26.5q2 8 9 18t18 23t17 21q8 12 16.5 30.5t15 35t16 36t19.5 32t26.5 23.5t36 11.5t47.5 -5.5l-1 -3q38 9 51 9h761q74 0 114 -56t18 -130l-274 -906 q-36 -119 -71.5 -153.5t-128.5 -34.5h-869q-27 0 -38 -15q-11 -16 -1 -43q24 -70 144 -70h923q29 0 56 15.5t35 41.5l300 987q7 22 5 57q38 -15 59 -43zM575 1056q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5 t-16.5 -22.5zM492 800q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5t-16.5 -22.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1280" d="M1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M384 0h896v256h-896v-256zM384 640h896v384h-160q-40 0 -68 28t-28 68v160h-640v-640zM1536 576q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 576v-416q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-160q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68 v160h-224q-13 0 -22.5 9.5t-9.5 22.5v416q0 79 56.5 135.5t135.5 56.5h64v544q0 40 28 68t68 28h672q40 0 88 -20t76 -48l152 -152q28 -28 48 -76t20 -88v-256h64q79 0 135.5 -56.5t56.5 -135.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M960 864q119 0 203.5 -84.5t84.5 -203.5t-84.5 -203.5t-203.5 -84.5t-203.5 84.5t-84.5 203.5t84.5 203.5t203.5 84.5zM1664 1280q106 0 181 -75t75 -181v-896q0 -106 -75 -181t-181 -75h-1408q-106 0 -181 75t-75 181v896q0 106 75 181t181 75h224l51 136 q19 49 69.5 84.5t103.5 35.5h512q53 0 103.5 -35.5t69.5 -84.5l51 -136h224zM960 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M725 977l-170 -450q73 -1 153.5 -2t119 -1.5t52.5 -0.5l29 2q-32 95 -92 241q-53 132 -92 211zM21 -128h-21l2 79q22 7 80 18q89 16 110 31q20 16 48 68l237 616l280 724h75h53l11 -21l205 -480q103 -242 124 -297q39 -102 96 -235q26 -58 65 -164q24 -67 65 -149 q22 -49 35 -57q22 -19 69 -23q47 -6 103 -27q6 -39 6 -57q0 -14 -1 -26q-80 0 -192 8q-93 8 -189 8q-79 0 -135 -2l-200 -11l-58 -2q0 45 4 78l131 28q56 13 68 23q12 12 12 27t-6 32l-47 114l-92 228l-450 2q-29 -65 -104 -274q-23 -64 -23 -84q0 -31 17 -43 q26 -21 103 -32q3 0 13.5 -2t30 -5t40.5 -6q1 -28 1 -58q0 -17 -2 -27q-66 0 -349 20l-48 -8q-81 -14 -167 -14z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M555 15q76 -32 140 -32q131 0 216 41t122 113q38 70 38 181q0 114 -41 180q-58 94 -141 126q-80 32 -247 32q-74 0 -101 -10v-144l-1 -173l3 -270q0 -15 12 -44zM541 761q43 -7 109 -7q175 0 264 65t89 224q0 112 -85 187q-84 75 -255 75q-52 0 -130 -13q0 -44 2 -77 q7 -122 6 -279l-1 -98q0 -43 1 -77zM0 -128l2 94q45 9 68 12q77 12 123 31q17 27 21 51q9 66 9 194l-2 497q-5 256 -9 404q-1 87 -11 109q-1 4 -12 12q-18 12 -69 15q-30 2 -114 13l-4 83l260 6l380 13l45 1q5 0 14 0.5t14 0.5q1 0 21.5 -0.5t40.5 -0.5h74q88 0 191 -27 q43 -13 96 -39q57 -29 102 -76q44 -47 65 -104t21 -122q0 -70 -32 -128t-95 -105q-26 -20 -150 -77q177 -41 267 -146q92 -106 92 -236q0 -76 -29 -161q-21 -62 -71 -117q-66 -72 -140 -108q-73 -36 -203 -60q-82 -15 -198 -11l-197 4q-84 2 -298 -11q-33 -3 -272 -11z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M0 -126l17 85q4 1 77 20q76 19 116 39q29 37 41 101l27 139l56 268l12 64q8 44 17 84.5t16 67t12.5 46.5t9 30.5t3.5 11.5l29 157l16 63l22 135l8 50v38q-41 22 -144 28q-28 2 -38 4l19 103l317 -14q39 -2 73 -2q66 0 214 9q33 2 68 4.5t36 2.5q-2 -19 -6 -38 q-7 -29 -13 -51q-55 -19 -109 -31q-64 -16 -101 -31q-12 -31 -24 -88q-9 -44 -13 -82q-44 -199 -66 -306l-61 -311l-38 -158l-43 -235l-12 -45q-2 -7 1 -27q64 -15 119 -21q36 -5 66 -10q-1 -29 -7 -58q-7 -31 -9 -41q-18 0 -23 -1q-24 -2 -42 -2q-9 0 -28 3q-19 4 -145 17 l-198 2q-41 1 -174 -11q-74 -7 -98 -9z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M81 1407l54 -27q20 -5 211 -5h130l19 3l115 1l215 -1h293l34 -2q14 -1 28 7t21 16l7 8l42 1q15 0 28 -1v-104.5t1 -131.5l1 -100l-1 -58q0 -32 -4 -51q-39 -15 -68 -18q-25 43 -54 128q-8 24 -15.5 62.5t-11.5 65.5t-6 29q-13 15 -27 19q-7 2 -42.5 2t-103.5 -1t-111 -1 q-34 0 -67 -5q-10 -97 -8 -136l1 -152v-332l3 -359l-1 -147q-1 -46 11 -85q49 -25 89 -32q2 0 18 -5t44 -13t43 -12q30 -8 50 -18q5 -45 5 -50q0 -10 -3 -29q-14 -1 -34 -1q-110 0 -187 10q-72 8 -238 8q-88 0 -233 -14q-48 -4 -70 -4q-2 22 -2 26l-1 26v9q21 33 79 49 q139 38 159 50q9 21 12 56q8 192 6 433l-5 428q-1 62 -0.5 118.5t0.5 102.5t-2 57t-6 15q-6 5 -14 6q-38 6 -148 6q-43 0 -100 -13.5t-73 -24.5q-13 -9 -22 -33t-22 -75t-24 -84q-6 -19 -19.5 -32t-20.5 -13q-44 27 -56 44v297v86zM1744 128q33 0 42 -18.5t-11 -44.5 l-126 -162q-20 -26 -49 -26t-49 26l-126 162q-20 26 -11 44.5t42 18.5h80v1024h-80q-33 0 -42 18.5t11 44.5l126 162q20 26 49 26t49 -26l126 -162q20 -26 11 -44.5t-42 -18.5h-80v-1024h80z" />
|
||||
<glyph unicode="" d="M81 1407l54 -27q20 -5 211 -5h130l19 3l115 1l446 -1h318l34 -2q14 -1 28 7t21 16l7 8l42 1q15 0 28 -1v-104.5t1 -131.5l1 -100l-1 -58q0 -32 -4 -51q-39 -15 -68 -18q-25 43 -54 128q-8 24 -15.5 62.5t-11.5 65.5t-6 29q-13 15 -27 19q-7 2 -58.5 2t-138.5 -1t-128 -1 q-94 0 -127 -5q-10 -97 -8 -136l1 -152v52l3 -359l-1 -147q-1 -46 11 -85q49 -25 89 -32q2 0 18 -5t44 -13t43 -12q30 -8 50 -18q5 -45 5 -50q0 -10 -3 -29q-14 -1 -34 -1q-110 0 -187 10q-72 8 -238 8q-82 0 -233 -13q-45 -5 -70 -5q-2 22 -2 26l-1 26v9q21 33 79 49 q139 38 159 50q9 21 12 56q6 137 6 433l-5 44q0 265 -2 278q-2 11 -6 15q-6 5 -14 6q-38 6 -148 6q-50 0 -168.5 -14t-132.5 -24q-13 -9 -22 -33t-22 -75t-24 -84q-6 -19 -19.5 -32t-20.5 -13q-44 27 -56 44v297v86zM1505 113q26 -20 26 -49t-26 -49l-162 -126 q-26 -20 -44.5 -11t-18.5 42v80h-1024v-80q0 -33 -18.5 -42t-44.5 11l-162 126q-26 20 -26 49t26 49l162 126q26 20 44.5 11t18.5 -42v-80h1024v80q0 33 18.5 42t44.5 -11z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45 t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h896q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45t-45 -19 h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h640q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M256 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM256 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5 t9.5 -22.5zM256 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344 q13 0 22.5 -9.5t9.5 -22.5zM256 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192 q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M384 992v-576q0 -13 -9.5 -22.5t-22.5 -9.5q-14 0 -23 9l-288 288q-9 9 -9 23t9 23l288 288q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M352 704q0 -14 -9 -23l-288 -288q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v576q0 13 9.5 22.5t22.5 9.5q14 0 23 -9l288 -288q9 -9 9 -23zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 1184v-1088q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-403 403v-166q0 -119 -84.5 -203.5t-203.5 -84.5h-704q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h704q119 0 203.5 -84.5t84.5 -203.5v-165l403 402q18 19 45 19q12 0 25 -5 q39 -17 39 -59z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M640 960q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 576v-448h-1408v192l320 320l160 -160l512 512zM1760 1280h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5v1216 q0 13 -9.5 22.5t-22.5 9.5zM1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
||||
<glyph unicode="" d="M363 0l91 91l-235 235l-91 -91v-107h128v-128h107zM886 928q0 22 -22 22q-10 0 -17 -7l-542 -542q-7 -7 -7 -17q0 -22 22 -22q10 0 17 7l542 542q7 7 7 17zM832 1120l416 -416l-832 -832h-416v416zM1515 1024q0 -53 -37 -90l-166 -166l-416 416l166 165q36 38 90 38 q53 0 91 -38l235 -234q37 -39 37 -91z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M768 896q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1024 896q0 -109 -33 -179l-364 -774q-16 -33 -47.5 -52t-67.5 -19t-67.5 19t-46.5 52l-365 774q-33 70 -33 179q0 212 150 362t362 150t362 -150t150 -362z" />
|
||||
<glyph unicode="" d="M768 96v1088q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M512 384q0 36 -20 69q-1 1 -15.5 22.5t-25.5 38t-25 44t-21 50.5q-4 16 -21 16t-21 -16q-7 -23 -21 -50.5t-25 -44t-25.5 -38t-15.5 -22.5q-20 -33 -20 -69q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 512q0 -212 -150 -362t-362 -150t-362 150t-150 362 q0 145 81 275q6 9 62.5 90.5t101 151t99.5 178t83 201.5q9 30 34 47t51 17t51.5 -17t33.5 -47q28 -93 83 -201.5t99.5 -178t101 -151t62.5 -90.5q81 -127 81 -275z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M888 352l116 116l-152 152l-116 -116v-56h96v-96h56zM1328 1072q-16 16 -33 -1l-350 -350q-17 -17 -1 -33t33 1l350 350q17 17 1 33zM1408 478v-190q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-14 -14 -32 -8q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v126q0 13 9 22l64 64q15 15 35 7t20 -29zM1312 1216l288 -288l-672 -672h-288v288zM1756 1084l-92 -92 l-288 288l92 92q28 28 68 28t68 -28l152 -152q28 -28 28 -68t-28 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1408 547v-259q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h255v0q13 0 22.5 -9.5t9.5 -22.5q0 -27 -26 -32q-77 -26 -133 -60q-10 -4 -16 -4h-112q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832 q66 0 113 47t47 113v214q0 19 18 29q28 13 54 37q16 16 35 8q21 -9 21 -29zM1645 1043l-384 -384q-18 -19 -45 -19q-12 0 -25 5q-39 17 -39 59v192h-160q-323 0 -438 -131q-119 -137 -74 -473q3 -23 -20 -34q-8 -2 -12 -2q-16 0 -26 13q-10 14 -21 31t-39.5 68.5t-49.5 99.5 t-38.5 114t-17.5 122q0 49 3.5 91t14 90t28 88t47 81.5t68.5 74t94.5 61.5t124.5 48.5t159.5 30.5t196.5 11h160v192q0 42 39 59q13 5 25 5q26 0 45 -19l384 -384q19 -19 19 -45t-19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1408 606v-318q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-10 -10 -23 -10q-3 0 -9 2q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832 q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v254q0 13 9 22l64 64q10 10 23 10q6 0 12 -3q20 -8 20 -29zM1639 1095l-814 -814q-24 -24 -57 -24t-57 24l-430 430q-24 24 -24 57t24 57l110 110q24 24 57 24t57 -24l263 -263l647 647q24 24 57 24t57 -24l110 -110 q24 -24 24 -57t-24 -57z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-384v-384h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v384h-384v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45 t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h384v384h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45t-19 -45t-45 -19h-128v-384h384v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M979 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 11 13 19z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1747 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 11 13 19l710 710 q19 19 32 13t13 -32v-710q4 11 13 19z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1619 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-8 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-19 19 -19 45t19 45l710 710q19 19 32 13t13 -32v-710q5 11 13 19z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1384 609l-1328 -738q-23 -13 -39.5 -3t-16.5 36v1472q0 26 16.5 36t39.5 -3l1328 -738q23 -13 23 -31t-23 -31z" />
|
||||
<glyph unicode="" d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45zM640 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v710q0 26 13 32t32 -13l710 -710q19 -19 19 -45t-19 -45l-710 -710q-19 -19 -32 -13t-13 32v710q-5 -10 -13 -19z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v710q0 26 13 32t32 -13l710 -710q8 -8 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-5 -10 -13 -19l-710 -710 q-19 -19 -32 -13t-13 32v710q-5 -10 -13 -19z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-5 -10 -13 -19z" />
|
||||
<glyph unicode="" horiz-adv-x="1538" d="M14 557l710 710q19 19 45 19t45 -19l710 -710q19 -19 13 -32t-32 -13h-1472q-26 0 -32 13t13 32zM1473 0h-1408q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1408q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M742 -37l-652 651q-37 37 -37 90.5t37 90.5l652 651q37 37 90.5 37t90.5 -37l75 -75q37 -37 37 -90.5t-37 -90.5l-486 -486l486 -485q37 -38 37 -91t-37 -90l-75 -75q-37 -37 -90.5 -37t-90.5 37z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M1099 704q0 -52 -37 -91l-652 -651q-37 -37 -90 -37t-90 37l-76 75q-37 39 -37 91q0 53 37 90l486 486l-486 485q-37 39 -37 91q0 53 37 90l76 75q36 38 90 38t90 -38l652 -651q37 -37 37 -90z" />
|
||||
<glyph unicode="" d="M1216 576v128q0 26 -19 45t-45 19h-256v256q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-256h-256q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h256v-256q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v256h256q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5 t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1216 576v128q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5 t103 -385.5z" />
|
||||
<glyph unicode="" d="M1149 414q0 26 -19 45l-181 181l181 181q19 19 19 45q0 27 -19 46l-90 90q-19 19 -46 19q-26 0 -45 -19l-181 -181l-181 181q-19 19 -45 19q-27 0 -46 -19l-90 -90q-19 -19 -19 -46q0 -26 19 -45l181 -181l-181 -181q-19 -19 -19 -45q0 -27 19 -46l90 -90q19 -19 46 -19 q26 0 45 19l181 181l181 -181q19 -19 45 -19q27 0 46 19l90 90q19 19 19 46zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1284 802q0 28 -18 46l-91 90q-19 19 -45 19t-45 -19l-408 -407l-226 226q-19 19 -45 19t-45 -19l-91 -90q-18 -18 -18 -46q0 -27 18 -45l362 -362q19 -19 45 -19q27 0 46 19l543 543q18 18 18 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M896 160v192q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1152 832q0 88 -55.5 163t-138.5 116t-170 41q-243 0 -371 -213q-15 -24 8 -42l132 -100q7 -6 19 -6q16 0 25 12q53 68 86 92q34 24 86 24q48 0 85.5 -26t37.5 -59 q0 -38 -20 -61t-68 -45q-63 -28 -115.5 -86.5t-52.5 -125.5v-36q0 -14 9 -23t23 -9h192q14 0 23 9t9 23q0 19 21.5 49.5t54.5 49.5q32 18 49 28.5t46 35t44.5 48t28 60.5t12.5 81zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1024 160v160q0 14 -9 23t-23 9h-96v512q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h96v-320h-96q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h448q14 0 23 9t9 23zM896 1056v160q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23 t23 -9h192q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1197 512h-109q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h109q-32 108 -112.5 188.5t-188.5 112.5v-109q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v109q-108 -32 -188.5 -112.5t-112.5 -188.5h109q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-109 q32 -108 112.5 -188.5t188.5 -112.5v109q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-109q108 32 188.5 112.5t112.5 188.5zM1536 704v-128q0 -26 -19 -45t-45 -19h-143q-37 -161 -154.5 -278.5t-278.5 -154.5v-143q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v143 q-161 37 -278.5 154.5t-154.5 278.5h-143q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h143q37 161 154.5 278.5t278.5 154.5v143q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-143q161 -37 278.5 -154.5t154.5 -278.5h143q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" d="M1097 457l-146 -146q-10 -10 -23 -10t-23 10l-137 137l-137 -137q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l137 137l-137 137q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l137 -137l137 137q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23 l-137 -137l137 -137q10 -10 10 -23t-10 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5 t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1171 723l-422 -422q-19 -19 -45 -19t-45 19l-294 294q-19 19 -19 45t19 45l102 102q19 19 45 19t45 -19l147 -147l275 275q19 19 45 19t45 -19l102 -102q19 -19 19 -45t-19 -45zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198 t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1312 643q0 161 -87 295l-754 -753q137 -89 297 -89q111 0 211.5 43.5t173.5 116.5t116 174.5t43 212.5zM313 344l755 754q-135 91 -300 91q-148 0 -273 -73t-198 -199t-73 -274q0 -162 89 -299zM1536 643q0 -157 -61 -300t-163.5 -246t-245 -164t-298.5 -61t-298.5 61 t-245 164t-163.5 246t-61 300t61 299.5t163.5 245.5t245 164t298.5 61t298.5 -61t245 -164t163.5 -245.5t61 -299.5z" />
|
||||
<glyph unicode="" d="M1536 640v-128q0 -53 -32.5 -90.5t-84.5 -37.5h-704l293 -294q38 -36 38 -90t-38 -90l-75 -76q-37 -37 -90 -37q-52 0 -91 37l-651 652q-37 37 -37 90q0 52 37 91l651 650q38 38 91 38q52 0 90 -38l75 -74q38 -38 38 -91t-38 -91l-293 -293h704q52 0 84.5 -37.5 t32.5 -90.5z" />
|
||||
<glyph unicode="" d="M1472 576q0 -54 -37 -91l-651 -651q-39 -37 -91 -37q-51 0 -90 37l-75 75q-38 38 -38 91t38 91l293 293h-704q-52 0 -84.5 37.5t-32.5 90.5v128q0 53 32.5 90.5t84.5 37.5h704l-293 294q-38 36 -38 90t38 90l75 75q38 38 90 38q53 0 91 -38l651 -651q37 -35 37 -90z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1611 565q0 -51 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-294 293v-704q0 -52 -37.5 -84.5t-90.5 -32.5h-128q-53 0 -90.5 32.5t-37.5 84.5v704l-294 -293q-36 -38 -90 -38t-90 38l-75 75q-38 38 -38 90q0 53 38 91l651 651q35 37 90 37q54 0 91 -37l651 -651 q37 -39 37 -91z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1611 704q0 -53 -37 -90l-651 -652q-39 -37 -91 -37q-53 0 -90 37l-651 652q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l294 -294v704q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-704l294 294q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 896q0 -26 -19 -45l-512 -512q-19 -19 -45 -19t-45 19t-19 45v256h-224q-98 0 -175.5 -6t-154 -21.5t-133 -42.5t-105.5 -69.5t-80 -101t-48.5 -138.5t-17.5 -181q0 -55 5 -123q0 -6 2.5 -23.5t2.5 -26.5q0 -15 -8.5 -25t-23.5 -10q-16 0 -28 17q-7 9 -13 22 t-13.5 30t-10.5 24q-127 285 -127 451q0 199 53 333q162 403 875 403h224v256q0 26 19 45t45 19t45 -19l512 -512q19 -19 19 -45z" />
|
||||
<glyph unicode="" d="M755 480q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23zM1536 1344v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332 q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" d="M768 576v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45zM1523 1248q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45 t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1408 800v-192q0 -40 -28 -68t-68 -28h-416v-416q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v416h-416q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h416v416q0 40 28 68t68 28h192q40 0 68 -28t28 -68v-416h416q40 0 68 -28t28 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1408 800v-192q0 -40 -28 -68t-68 -28h-1216q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h1216q40 0 68 -28t28 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1482 486q46 -26 59.5 -77.5t-12.5 -97.5l-64 -110q-26 -46 -77.5 -59.5t-97.5 12.5l-266 153v-307q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v307l-266 -153q-46 -26 -97.5 -12.5t-77.5 59.5l-64 110q-26 46 -12.5 97.5t59.5 77.5l266 154l-266 154 q-46 26 -59.5 77.5t12.5 97.5l64 110q26 46 77.5 59.5t97.5 -12.5l266 -153v307q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-307l266 153q46 26 97.5 12.5t77.5 -59.5l64 -110q26 -46 12.5 -97.5t-59.5 -77.5l-266 -154z" />
|
||||
<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM896 161v190q0 14 -9 23.5t-22 9.5h-192q-13 0 -23 -10t-10 -23v-190q0 -13 10 -23t23 -10h192 q13 0 22 9.5t9 23.5zM894 505l18 621q0 12 -10 18q-10 8 -24 8h-220q-14 0 -24 -8q-10 -6 -10 -18l17 -621q0 -10 10 -17.5t24 -7.5h185q14 0 23.5 7.5t10.5 17.5z" />
|
||||
<glyph unicode="" d="M928 180v56v468v192h-320v-192v-468v-56q0 -25 18 -38.5t46 -13.5h192q28 0 46 13.5t18 38.5zM472 1024h195l-126 161q-26 31 -69 31q-40 0 -68 -28t-28 -68t28 -68t68 -28zM1160 1120q0 40 -28 68t-68 28q-43 0 -69 -31l-125 -161h194q40 0 68 28t28 68zM1536 864v-320 q0 -14 -9 -23t-23 -9h-96v-416q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v416h-96q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h440q-93 0 -158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5q107 0 168 -77l128 -165l128 165q61 77 168 77q93 0 158.5 -65.5t65.5 -158.5 t-65.5 -158.5t-158.5 -65.5h440q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1280 832q0 26 -19 45t-45 19q-172 0 -318 -49.5t-259.5 -134t-235.5 -219.5q-19 -21 -19 -45q0 -26 19 -45t45 -19q24 0 45 19q27 24 74 71t67 66q137 124 268.5 176t313.5 52q26 0 45 19t19 45zM1792 1030q0 -95 -20 -193q-46 -224 -184.5 -383t-357.5 -268 q-214 -108 -438 -108q-148 0 -286 47q-15 5 -88 42t-96 37q-16 0 -39.5 -32t-45 -70t-52.5 -70t-60 -32q-30 0 -51 11t-31 24t-27 42q-2 4 -6 11t-5.5 10t-3 9.5t-1.5 13.5q0 35 31 73.5t68 65.5t68 56t31 48q0 4 -14 38t-16 44q-9 51 -9 104q0 115 43.5 220t119 184.5 t170.5 139t204 95.5q55 18 145 25.5t179.5 9t178.5 6t163.5 24t113.5 56.5l29.5 29.5t29.5 28t27 20t36.5 16t43.5 4.5q39 0 70.5 -46t47.5 -112t24 -124t8 -96z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1408 -160v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1152 896q0 -78 -24.5 -144t-64 -112.5t-87.5 -88t-96 -77.5t-87.5 -72t-64 -81.5t-24.5 -96.5q0 -96 67 -224l-4 1l1 -1 q-90 41 -160 83t-138.5 100t-113.5 122.5t-72.5 150.5t-27.5 184q0 78 24.5 144t64 112.5t87.5 88t96 77.5t87.5 72t64 81.5t24.5 96.5q0 94 -66 224l3 -1l-1 1q90 -41 160 -83t138.5 -100t113.5 -122.5t72.5 -150.5t27.5 -184z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1664 576q-152 236 -381 353q61 -104 61 -225q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 121 61 225q-229 -117 -381 -353q133 -205 333.5 -326.5t434.5 -121.5t434.5 121.5t333.5 326.5zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5 t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1792 576q0 -34 -20 -69q-140 -230 -376.5 -368.5t-499.5 -138.5t-499.5 139t-376.5 368q-20 35 -20 69t20 69q140 229 376.5 368t499.5 139t499.5 -139t376.5 -368q20 -35 20 -69z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M555 201l78 141q-87 63 -136 159t-49 203q0 121 61 225q-229 -117 -381 -353q167 -258 427 -375zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1307 1151q0 -7 -1 -9 q-105 -188 -315 -566t-316 -567l-49 -89q-10 -16 -28 -16q-12 0 -134 70q-16 10 -16 28q0 12 44 87q-143 65 -263.5 173t-208.5 245q-20 31 -20 69t20 69q153 235 380 371t496 136q89 0 180 -17l54 97q10 16 28 16q5 0 18 -6t31 -15.5t33 -18.5t31.5 -18.5t19.5 -11.5 q16 -10 16 -27zM1344 704q0 -139 -79 -253.5t-209 -164.5l280 502q8 -45 8 -84zM1792 576q0 -35 -20 -69q-39 -64 -109 -145q-150 -172 -347.5 -267t-419.5 -95l74 132q212 18 392.5 137t301.5 307q-115 179 -282 294l63 112q95 -64 182.5 -153t144.5 -184q20 -34 20 -69z " />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1024 161v190q0 14 -9.5 23.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -23.5v-190q0 -14 9.5 -23.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 23.5zM1022 535l18 459q0 12 -10 19q-13 11 -24 11h-220q-11 0 -24 -11q-10 -7 -10 -21l17 -457q0 -10 10 -16.5t24 -6.5h185 q14 0 23.5 6.5t10.5 16.5zM1008 1469l768 -1408q35 -63 -2 -126q-17 -29 -46.5 -46t-63.5 -17h-1536q-34 0 -63.5 17t-46.5 46q-37 63 -2 126l768 1408q17 31 47 49t65 18t65 -18t47 -49z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1376 1376q44 -52 12 -148t-108 -172l-161 -161l160 -696q5 -19 -12 -33l-128 -96q-7 -6 -19 -6q-4 0 -7 1q-15 3 -21 16l-279 508l-259 -259l53 -194q5 -17 -8 -31l-96 -96q-9 -9 -23 -9h-2q-15 2 -24 13l-189 252l-252 189q-11 7 -13 23q-1 13 9 25l96 97q9 9 23 9 q6 0 8 -1l194 -53l259 259l-508 279q-14 8 -17 24q-2 16 9 27l128 128q14 13 30 8l665 -159l160 160q76 76 172 108t148 -12z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M128 -128h288v288h-288v-288zM480 -128h320v288h-320v-288zM128 224h288v320h-288v-320zM480 224h320v320h-320v-320zM128 608h288v288h-288v-288zM864 -128h320v288h-320v-288zM480 608h320v288h-320v-288zM1248 -128h288v288h-288v-288zM864 224h320v320h-320v-320z M512 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1248 224h288v320h-288v-320zM864 608h320v288h-320v-288zM1248 608h288v288h-288v-288zM1280 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64 q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47 h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M666 1055q-60 -92 -137 -273q-22 45 -37 72.5t-40.5 63.5t-51 56.5t-63 35t-81.5 14.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q250 0 410 -225zM1792 256q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192q-32 0 -85 -0.5t-81 -1t-73 1 t-71 5t-64 10.5t-63 18.5t-58 28.5t-59 40t-55 53.5t-56 69.5q59 93 136 273q22 -45 37 -72.5t40.5 -63.5t51 -56.5t63 -35t81.5 -14.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1792 1152q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5 v192h-256q-48 0 -87 -15t-69 -45t-51 -61.5t-45 -77.5q-32 -62 -78 -171q-29 -66 -49.5 -111t-54 -105t-64 -100t-74 -83t-90 -68.5t-106.5 -42t-128 -16.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q48 0 87 15t69 45t51 61.5t45 77.5q32 62 78 171q29 66 49.5 111 t54 105t64 100t74 83t90 68.5t106.5 42t128 16.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22q-17 -2 -30.5 9t-17.5 29v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281 q0 130 71 248.5t191 204.5t286 136.5t348 50.5q244 0 450 -85.5t326 -233t120 -321.5z" />
|
||||
<glyph unicode="" d="M1536 704v-128q0 -201 -98.5 -362t-274 -251.5t-395.5 -90.5t-395.5 90.5t-274 251.5t-98.5 362v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-128q0 -52 23.5 -90t53.5 -57t71 -30t64 -13t44 -2t44 2t64 13t71 30t53.5 57t23.5 90v128q0 26 19 45t45 19h384 q26 0 45 -19t19 -45zM512 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45zM1536 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1611 320q0 -53 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-486 485l-486 -485q-36 -38 -90 -38t-90 38l-75 75q-38 36 -38 90q0 53 38 91l651 651q37 37 90 37q52 0 91 -37l650 -651q38 -38 38 -91z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1611 832q0 -53 -37 -90l-651 -651q-38 -38 -91 -38q-54 0 -90 38l-651 651q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l486 -486l486 486q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1280 32q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-8 0 -13.5 2t-9 7t-5.5 8t-3 11.5t-1 11.5v13v11v160v416h-192q-26 0 -45 19t-19 45q0 24 15 41l320 384q19 22 49 22t49 -22l320 -384q15 -17 15 -41q0 -26 -19 -45t-45 -19h-192v-384h576q16 0 25 -11l160 -192q7 -11 7 -21 zM1920 448q0 -24 -15 -41l-320 -384q-20 -23 -49 -23t-49 23l-320 384q-15 17 -15 41q0 26 19 45t45 19h192v384h-576q-16 0 -25 12l-160 192q-7 9 -7 20q0 13 9.5 22.5t22.5 9.5h960q8 0 13.5 -2t9 -7t5.5 -8t3 -11.5t1 -11.5v-13v-11v-160v-416h192q26 0 45 -19t19 -45z " />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5 l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5 t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1879 584q0 -31 -31 -66l-336 -396q-43 -51 -120.5 -86.5t-143.5 -35.5h-1088q-34 0 -60.5 13t-26.5 43q0 31 31 66l336 396q43 51 120.5 86.5t143.5 35.5h1088q34 0 60.5 -13t26.5 -43zM1536 928v-160h-832q-94 0 -197 -47.5t-164 -119.5l-337 -396l-5 -6q0 4 -0.5 12.5 t-0.5 12.5v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158z" />
|
||||
<glyph unicode="" horiz-adv-x="768" d="M704 1216q0 -26 -19 -45t-45 -19h-128v-1024h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v1024h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-1024v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h1024v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M512 512v-384h-256v384h256zM896 1024v-896h-256v896h256zM1280 768v-640h-256v640h256zM1664 1152v-1024h-256v1024h256zM1792 32v1216q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5z M1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
||||
<glyph unicode="" d="M1280 926q-56 -25 -121 -34q68 40 93 117q-65 -38 -134 -51q-61 66 -153 66q-87 0 -148.5 -61.5t-61.5 -148.5q0 -29 5 -48q-129 7 -242 65t-192 155q-29 -50 -29 -106q0 -114 91 -175q-47 1 -100 26v-2q0 -75 50 -133.5t123 -72.5q-29 -8 -51 -8q-13 0 -39 4 q21 -63 74.5 -104t121.5 -42q-116 -90 -261 -90q-26 0 -50 3q148 -94 322 -94q112 0 210 35.5t168 95t120.5 137t75 162t24.5 168.5q0 18 -1 27q63 45 105 109zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5 t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M1307 618l23 219h-198v109q0 49 15.5 68.5t71.5 19.5h110v219h-175q-152 0 -218 -72t-66 -213v-131h-131v-219h131v-635h262v635h175zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960 q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M928 704q0 14 -9 23t-23 9q-66 0 -113 -47t-47 -113q0 -14 9 -23t23 -9t23 9t9 23q0 40 28 68t68 28q14 0 23 9t9 23zM1152 574q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM128 0h1536v128h-1536v-128zM1280 574q0 159 -112.5 271.5 t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM256 1216h384v128h-384v-128zM128 1024h1536v118v138h-828l-64 -128h-644v-128zM1792 1280v-1280q0 -53 -37.5 -90.5t-90.5 -37.5h-1536q-53 0 -90.5 37.5t-37.5 90.5v1280 q0 53 37.5 90.5t90.5 37.5h1536q53 0 90.5 -37.5t37.5 -90.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M832 1024q0 80 -56 136t-136 56t-136 -56t-56 -136q0 -42 19 -83q-41 19 -83 19q-80 0 -136 -56t-56 -136t56 -136t136 -56t136 56t56 136q0 42 -19 83q41 -19 83 -19q80 0 136 56t56 136zM1683 320q0 -17 -49 -66t-66 -49q-9 0 -28.5 16t-36.5 33t-38.5 40t-24.5 26 l-96 -96l220 -220q28 -28 28 -68q0 -42 -39 -81t-81 -39q-40 0 -68 28l-671 671q-176 -131 -365 -131q-163 0 -265.5 102.5t-102.5 265.5q0 160 95 313t248 248t313 95q163 0 265.5 -102.5t102.5 -265.5q0 -189 -131 -365l355 -355l96 96q-3 3 -26 24.5t-40 38.5t-33 36.5 t-16 28.5q0 17 49 66t66 49q13 0 23 -10q6 -6 46 -44.5t82 -79.5t86.5 -86t73 -78t28.5 -41z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M896 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1664 128q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1152q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5zM1280 731v-185q0 -10 -7 -19.5t-16 -10.5l-155 -24q-11 -35 -32 -76q34 -48 90 -115q7 -10 7 -20q0 -12 -7 -19q-23 -30 -82.5 -89.5t-78.5 -59.5q-11 0 -21 7l-115 90q-37 -19 -77 -31q-11 -108 -23 -155q-7 -24 -30 -24h-186q-11 0 -20 7.5t-10 17.5 l-23 153q-34 10 -75 31l-118 -89q-7 -7 -20 -7q-11 0 -21 8q-144 133 -144 160q0 9 7 19q10 14 41 53t47 61q-23 44 -35 82l-152 24q-10 1 -17 9.5t-7 19.5v185q0 10 7 19.5t16 10.5l155 24q11 35 32 76q-34 48 -90 115q-7 11 -7 20q0 12 7 20q22 30 82 89t79 59q11 0 21 -7 l115 -90q34 18 77 32q11 108 23 154q7 24 30 24h186q11 0 20 -7.5t10 -17.5l23 -153q34 -10 75 -31l118 89q8 7 20 7q11 0 21 -8q144 -133 144 -160q0 -9 -7 -19q-12 -16 -42 -54t-45 -60q23 -48 34 -82l152 -23q10 -2 17 -10.5t7 -19.5zM1920 198v-140q0 -16 -149 -31 q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20 t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31zM1920 1222v-140q0 -16 -149 -31q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68 q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70 q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1408 768q0 -139 -94 -257t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224 q0 139 94 257t256.5 186.5t353.5 68.5t353.5 -68.5t256.5 -186.5t94 -257zM1792 512q0 -120 -71 -224.5t-195 -176.5q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7 q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230z" />
|
||||
<glyph unicode="" d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 768q0 51 -39 89.5t-89 38.5h-352q0 58 48 159.5t48 160.5q0 98 -32 145t-128 47q-26 -26 -38 -85t-30.5 -125.5t-59.5 -109.5q-22 -23 -77 -91q-4 -5 -23 -30t-31.5 -41t-34.5 -42.5 t-40 -44t-38.5 -35.5t-40 -27t-35.5 -9h-32v-640h32q13 0 31.5 -3t33 -6.5t38 -11t35 -11.5t35.5 -12.5t29 -10.5q211 -73 342 -73h121q192 0 192 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5q32 1 53.5 47t21.5 81zM1536 769 q0 -89 -49 -163q9 -33 9 -69q0 -77 -38 -144q3 -21 3 -43q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5h-36h-93q-96 0 -189.5 22.5t-216.5 65.5q-116 40 -138 40h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h274q36 24 137 155q58 75 107 128 q24 25 35.5 85.5t30.5 126.5t62 108q39 37 90 37q84 0 151 -32.5t102 -101.5t35 -186q0 -93 -48 -192h176q104 0 180 -76t76 -179z" />
|
||||
<glyph unicode="" d="M256 1088q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 512q0 35 -21.5 81t-53.5 47q15 17 25 47.5t10 55.5q0 69 -53 119q18 32 18 69t-17.5 73.5t-47.5 52.5q5 30 5 56q0 85 -49 126t-136 41h-128q-131 0 -342 -73q-5 -2 -29 -10.5 t-35.5 -12.5t-35 -11.5t-38 -11t-33 -6.5t-31.5 -3h-32v-640h32q16 0 35.5 -9t40 -27t38.5 -35.5t40 -44t34.5 -42.5t31.5 -41t23 -30q55 -68 77 -91q41 -43 59.5 -109.5t30.5 -125.5t38 -85q96 0 128 47t32 145q0 59 -48 160.5t-48 159.5h352q50 0 89 38.5t39 89.5z M1536 511q0 -103 -76 -179t-180 -76h-176q48 -99 48 -192q0 -118 -35 -186q-35 -69 -102 -101.5t-151 -32.5q-51 0 -90 37q-34 33 -54 82t-25.5 90.5t-17.5 84.5t-31 64q-48 50 -107 127q-101 131 -137 155h-274q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5 h288q22 0 138 40q128 44 223 66t200 22h112q140 0 226.5 -79t85.5 -216v-5q60 -77 60 -178q0 -22 -3 -43q38 -67 38 -144q0 -36 -9 -69q49 -74 49 -163z" />
|
||||
<glyph unicode="" horiz-adv-x="896" d="M832 1504v-1339l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1664 940q0 81 -21.5 143t-55 98.5t-81.5 59.5t-94 31t-98 8t-112 -25.5t-110.5 -64t-86.5 -72t-60 -61.5q-18 -22 -49 -22t-49 22q-24 28 -60 61.5t-86.5 72t-110.5 64t-112 25.5t-98 -8t-94 -31t-81.5 -59.5t-55 -98.5t-21.5 -143q0 -168 187 -355l581 -560l580 559 q188 188 188 356zM1792 940q0 -221 -229 -450l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5 q224 0 351 -124t127 -344z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M640 96q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h320q13 0 22.5 -9.5t9.5 -22.5q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-66 0 -113 -47t-47 -113v-704 q0 -66 47 -113t113 -47h288h11h13t11.5 -1t11.5 -3t8 -5.5t7 -9t2 -13.5zM1568 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45z" />
|
||||
<glyph unicode="" d="M237 122h231v694h-231v-694zM483 1030q-1 52 -36 86t-93 34t-94.5 -34t-36.5 -86q0 -51 35.5 -85.5t92.5 -34.5h1q59 0 95 34.5t36 85.5zM1068 122h231v398q0 154 -73 233t-193 79q-136 0 -209 -117h2v101h-231q3 -66 0 -694h231v388q0 38 7 56q15 35 45 59.5t74 24.5 q116 0 116 -157v-371zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M480 672v448q0 14 -9 23t-23 9t-23 -9t-9 -23v-448q0 -14 9 -23t23 -9t23 9t9 23zM1152 320q0 -26 -19 -45t-45 -19h-429l-51 -483q-2 -12 -10.5 -20.5t-20.5 -8.5h-1q-27 0 -32 27l-76 485h-404q-26 0 -45 19t-19 45q0 123 78.5 221.5t177.5 98.5v512q-52 0 -90 38 t-38 90t38 90t90 38h640q52 0 90 -38t38 -90t-38 -90t-90 -38v-512q99 0 177.5 -98.5t78.5 -221.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1408 608v-320q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v320 q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1792 1472v-512q0 -26 -19 -45t-45 -19t-45 19l-176 176l-652 -652q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l652 652l-176 176q-19 19 -19 45t19 45t45 19h512q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" d="M1184 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45zM1536 992v-704q0 -119 -84.5 -203.5t-203.5 -84.5h-320q-13 0 -22.5 9.5t-9.5 22.5 q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q66 0 113 47t47 113v704q0 66 -47 113t-113 47h-288h-11h-13t-11.5 1t-11.5 3t-8 5.5t-7 9t-2 13.5q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M458 653q-74 162 -74 371h-256v-96q0 -78 94.5 -162t235.5 -113zM1536 928v96h-256q0 -209 -74 -371q141 29 235.5 113t94.5 162zM1664 1056v-128q0 -71 -41.5 -143t-112 -130t-173 -97.5t-215.5 -44.5q-42 -54 -95 -95q-38 -34 -52.5 -72.5t-14.5 -89.5q0 -54 30.5 -91 t97.5 -37q75 0 133.5 -45.5t58.5 -114.5v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 69 58.5 114.5t133.5 45.5q67 0 97.5 37t30.5 91q0 51 -14.5 89.5t-52.5 72.5q-53 41 -95 95q-113 5 -215.5 44.5t-173 97.5t-112 130t-41.5 143v128q0 40 28 68t68 28h288v96 q0 66 47 113t113 47h576q66 0 113 -47t47 -113v-96h288q40 0 68 -28t28 -68z" />
|
||||
<glyph unicode="" d="M394 184q-8 -9 -20 3q-13 11 -4 19q8 9 20 -3q12 -11 4 -19zM352 245q9 -12 0 -19q-8 -6 -17 7t0 18q9 7 17 -6zM291 305q-5 -7 -13 -2q-10 5 -7 12q3 5 13 2q10 -5 7 -12zM322 271q-6 -7 -16 3q-9 11 -2 16q6 6 16 -3q9 -11 2 -16zM451 159q-4 -12 -19 -6q-17 4 -13 15 t19 7q16 -5 13 -16zM514 154q0 -11 -16 -11q-17 -2 -17 11q0 11 16 11q17 2 17 -11zM572 164q2 -10 -14 -14t-18 8t14 15q16 2 18 -9zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-224q-16 0 -24.5 1t-19.5 5t-16 14.5t-5 27.5v239q0 97 -52 142q57 6 102.5 18t94 39 t81 66.5t53 105t20.5 150.5q0 121 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-86 13.5q-44 -113 -7 -204q-79 -85 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-40 -36 -49 -103 q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -103t0.5 -68q0 -22 -11 -33.5t-22 -13t-33 -1.5 h-224q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1280 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 288v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h427q21 -56 70.5 -92 t110.5 -36h256q61 0 110.5 36t70.5 92h427q40 0 68 -28t28 -68zM1339 936q-17 -40 -59 -40h-256v-448q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v448h-256q-42 0 -59 40q-17 39 14 69l448 448q18 19 45 19t45 -19l448 -448q31 -30 14 -69z" />
|
||||
<glyph unicode="" d="M1407 710q0 44 -7 113.5t-18 96.5q-12 30 -17 44t-9 36.5t-4 48.5q0 23 5 68.5t5 67.5q0 37 -10 55q-4 1 -13 1q-19 0 -58 -4.5t-59 -4.5q-60 0 -176 24t-175 24q-43 0 -94.5 -11.5t-85 -23.5t-89.5 -34q-137 -54 -202 -103q-96 -73 -159.5 -189.5t-88 -236t-24.5 -248.5 q0 -40 12.5 -120t12.5 -121q0 -23 -11 -66.5t-11 -65.5t12 -36.5t34 -14.5q24 0 72.5 11t73.5 11q57 0 169.5 -15.5t169.5 -15.5q181 0 284 36q129 45 235.5 152.5t166 245.5t59.5 275zM1535 712q0 -165 -70 -327.5t-196 -288t-281 -180.5q-124 -44 -326 -44 q-57 0 -170 14.5t-169 14.5q-24 0 -72.5 -14.5t-73.5 -14.5q-73 0 -123.5 55.5t-50.5 128.5q0 24 11 68t11 67q0 40 -12.5 120.5t-12.5 121.5q0 111 18 217.5t54.5 209.5t100.5 194t150 156q78 59 232 120q194 78 316 78q60 0 175.5 -24t173.5 -24q19 0 57 5t58 5 q81 0 118 -50.5t37 -134.5q0 -23 -5 -68t-5 -68q0 -10 1 -18.5t3 -17t4 -13.5t6.5 -16t6.5 -17q16 -40 25 -118.5t9 -136.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1408 296q0 -27 -10 -70.5t-21 -68.5q-21 -50 -122 -106q-94 -51 -186 -51q-27 0 -52.5 3.5t-57.5 12.5t-47.5 14.5t-55.5 20.5t-49 18q-98 35 -175 83q-128 79 -264.5 215.5t-215.5 264.5q-48 77 -83 175q-3 9 -18 49t-20.5 55.5t-14.5 47.5t-12.5 57.5t-3.5 52.5 q0 92 51 186q56 101 106 122q25 11 68.5 21t70.5 10q14 0 21 -3q18 -6 53 -76q11 -19 30 -54t35 -63.5t31 -53.5q3 -4 17.5 -25t21.5 -35.5t7 -28.5q0 -20 -28.5 -50t-62 -55t-62 -53t-28.5 -46q0 -9 5 -22.5t8.5 -20.5t14 -24t11.5 -19q76 -137 174 -235t235 -174 q2 -1 19 -11.5t24 -14t20.5 -8.5t22.5 -5q18 0 46 28.5t53 62t55 62t50 28.5q14 0 28.5 -7t35.5 -21.5t25 -17.5q25 -15 53.5 -31t63.5 -35t54 -30q70 -35 76 -53q3 -7 3 -21z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1120 1280h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v832q0 66 -47 113t-113 47zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1280" d="M1152 1280h-1024v-1242l423 406l89 85l89 -85l423 -406v1242zM1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289 q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
|
||||
<glyph unicode="" d="M1280 343q0 11 -2 16q-3 8 -38.5 29.5t-88.5 49.5l-53 29q-5 3 -19 13t-25 15t-21 5q-18 0 -47 -32.5t-57 -65.5t-44 -33q-7 0 -16.5 3.5t-15.5 6.5t-17 9.5t-14 8.5q-99 55 -170.5 126.5t-126.5 170.5q-2 3 -8.5 14t-9.5 17t-6.5 15.5t-3.5 16.5q0 13 20.5 33.5t45 38.5 t45 39.5t20.5 36.5q0 10 -5 21t-15 25t-13 19q-3 6 -15 28.5t-25 45.5t-26.5 47.5t-25 40.5t-16.5 18t-16 2q-48 0 -101 -22q-46 -21 -80 -94.5t-34 -130.5q0 -16 2.5 -34t5 -30.5t9 -33t10 -29.5t12.5 -33t11 -30q60 -164 216.5 -320.5t320.5 -216.5q6 -2 30 -11t33 -12.5 t29.5 -10t33 -9t30.5 -5t34 -2.5q57 0 130.5 34t94.5 80q22 53 22 101zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1620 1128q-67 -98 -162 -167q1 -14 1 -42q0 -130 -38 -259.5t-115.5 -248.5t-184.5 -210.5t-258 -146t-323 -54.5q-271 0 -496 145q35 -4 78 -4q225 0 401 138q-105 2 -188 64.5t-114 159.5q33 -5 61 -5q43 0 85 11q-112 23 -185.5 111.5t-73.5 205.5v4q68 -38 146 -41 q-66 44 -105 115t-39 154q0 88 44 163q121 -149 294.5 -238.5t371.5 -99.5q-8 38 -8 74q0 134 94.5 228.5t228.5 94.5q140 0 236 -102q109 21 205 78q-37 -115 -142 -178q93 10 186 50z" />
|
||||
<glyph unicode="" horiz-adv-x="768" d="M511 980h257l-30 -284h-227v-824h-341v824h-170v284h170v171q0 182 86 275.5t283 93.5h227v-284h-142q-39 0 -62.5 -6.5t-34 -23.5t-13.5 -34.5t-3 -49.5v-142z" />
|
||||
<glyph unicode="" d="M1536 640q0 -251 -146.5 -451.5t-378.5 -277.5q-27 -5 -39.5 7t-12.5 30v211q0 97 -52 142q57 6 102.5 18t94 39t81 66.5t53 105t20.5 150.5q0 121 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-86 13.5 q-44 -113 -7 -204q-79 -85 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-40 -36 -49 -103q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23 q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -89t0.5 -54q0 -18 -13 -30t-40 -7q-232 77 -378.5 277.5t-146.5 451.5q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1664 960v-256q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-192h96q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h672v192q0 185 131.5 316.5t316.5 131.5 t316.5 -131.5t131.5 -316.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1760 1408q66 0 113 -47t47 -113v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600zM160 1280q-13 0 -22.5 -9.5t-9.5 -22.5v-224h1664v224q0 13 -9.5 22.5t-22.5 9.5h-1600zM1760 0q13 0 22.5 9.5t9.5 22.5v608h-1664v-608 q0 -13 9.5 -22.5t22.5 -9.5h1600zM256 128v128h256v-128h-256zM640 128v128h384v-128h-384z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 69q2 -28 -17 -48q-18 -21 -47 -21h-135q-25 0 -43 16.5t-20 41.5q-22 229 -184.5 391.5t-391.5 184.5q-25 2 -41.5 20t-16.5 43v135q0 29 21 47q17 17 43 17h5q160 -13 306 -80.5 t259 -181.5q114 -113 181.5 -259t80.5 -306zM1408 67q2 -27 -18 -47q-18 -20 -46 -20h-143q-26 0 -44.5 17.5t-19.5 42.5q-12 215 -101 408.5t-231.5 336t-336 231.5t-408.5 102q-25 1 -42.5 19.5t-17.5 43.5v143q0 28 20 46q18 18 44 18h3q262 -13 501.5 -120t425.5 -294 q187 -186 294 -425.5t120 -501.5z" />
|
||||
<glyph unicode="" d="M1040 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1296 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1408 160v320q0 13 -9.5 22.5t-22.5 9.5 h-1216q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5zM178 640h1180l-157 482q-4 13 -16 21.5t-26 8.5h-782q-14 0 -26 -8.5t-16 -21.5zM1536 480v-320q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v320q0 25 16 75 l197 606q17 53 63 86t101 33h782q55 0 101 -33t63 -86l197 -606q16 -50 16 -75z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1664 896q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5v-384q0 -52 -38 -90t-90 -38q-417 347 -812 380q-58 -19 -91 -66t-31 -100.5t40 -92.5q-20 -33 -23 -65.5t6 -58t33.5 -55t48 -50t61.5 -50.5q-29 -58 -111.5 -83t-168.5 -11.5t-132 55.5q-7 23 -29.5 87.5 t-32 94.5t-23 89t-15 101t3.5 98.5t22 110.5h-122q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h480q435 0 896 384q52 0 90 -38t38 -90v-384zM1536 292v954q-394 -302 -768 -343v-270q377 -42 768 -341z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M848 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM183 128h1298q-164 181 -246.5 411.5t-82.5 484.5q0 256 -320 256t-320 -256q0 -254 -82.5 -484.5t-246.5 -411.5zM1664 128q0 -52 -38 -90t-90 -38 h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q190 161 287 397.5t97 498.5q0 165 96 262t264 117q-8 18 -8 37q0 40 28 68t68 28t68 -28t28 -68q0 -19 -8 -37q168 -20 264 -117t96 -262q0 -262 97 -498.5t287 -397.5z" />
|
||||
<glyph unicode="" d="M1376 640l138 -135q30 -28 20 -70q-12 -41 -52 -51l-188 -48l53 -186q12 -41 -19 -70q-29 -31 -70 -19l-186 53l-48 -188q-10 -40 -51 -52q-12 -2 -19 -2q-31 0 -51 22l-135 138l-135 -138q-28 -30 -70 -20q-41 11 -51 52l-48 188l-186 -53q-41 -12 -70 19q-31 29 -19 70 l53 186l-188 48q-40 10 -52 51q-10 42 20 70l138 135l-138 135q-30 28 -20 70q12 41 52 51l188 48l-53 186q-12 41 19 70q29 31 70 19l186 -53l48 188q10 41 51 51q41 12 70 -19l135 -139l135 139q29 30 70 19q41 -10 51 -51l48 -188l186 53q41 12 70 -19q31 -29 19 -70 l-53 -186l188 -48q40 -10 52 -51q10 -42 -20 -70z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 768q0 51 -39 89.5t-89 38.5h-576q0 20 15 48.5t33 55t33 68t15 84.5q0 67 -44.5 97.5t-115.5 30.5q-24 0 -90 -139q-24 -44 -37 -65q-40 -64 -112 -145q-71 -81 -101 -106 q-69 -57 -140 -57h-32v-640h32q72 0 167 -32t193.5 -64t179.5 -32q189 0 189 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5h331q52 0 90 38t38 90zM1792 769q0 -105 -75.5 -181t-180.5 -76h-169q-4 -62 -37 -119q3 -21 3 -43 q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5q-133 0 -322 69q-164 59 -223 59h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h288q10 0 21.5 4.5t23.5 14t22.5 18t24 22.5t20.5 21.5t19 21.5t14 17q65 74 100 129q13 21 33 62t37 72t40.5 63t55 49.5 t69.5 17.5q125 0 206.5 -67t81.5 -189q0 -68 -22 -128h374q104 0 180 -76t76 -179z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1376 128h32v640h-32q-35 0 -67.5 12t-62.5 37t-50 46t-49 54q-2 3 -3.5 4.5t-4 4.5t-4.5 5q-72 81 -112 145q-14 22 -38 68q-1 3 -10.5 22.5t-18.5 36t-20 35.5t-21.5 30.5t-18.5 11.5q-71 0 -115.5 -30.5t-44.5 -97.5q0 -43 15 -84.5t33 -68t33 -55t15 -48.5h-576 q-50 0 -89 -38.5t-39 -89.5q0 -52 38 -90t90 -38h331q-15 -17 -25 -47.5t-10 -55.5q0 -69 53 -119q-18 -32 -18 -69t17.5 -73.5t47.5 -52.5q-4 -24 -4 -56q0 -85 48.5 -126t135.5 -41q84 0 183 32t194 64t167 32zM1664 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45 t45 -19t45 19t19 45zM1792 768v-640q0 -53 -37.5 -90.5t-90.5 -37.5h-288q-59 0 -223 -59q-190 -69 -317 -69q-142 0 -230 77.5t-87 217.5l1 5q-61 76 -61 178q0 22 3 43q-33 57 -37 119h-169q-105 0 -180.5 76t-75.5 181q0 103 76 179t180 76h374q-22 60 -22 128 q0 122 81.5 189t206.5 67q38 0 69.5 -17.5t55 -49.5t40.5 -63t37 -72t33 -62q35 -55 100 -129q2 -3 14 -17t19 -21.5t20.5 -21.5t24 -22.5t22.5 -18t23.5 -14t21.5 -4.5h288q53 0 90.5 -37.5t37.5 -90.5z" />
|
||||
<glyph unicode="" d="M1280 -64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 700q0 189 -167 189q-26 0 -56 -5q-16 30 -52.5 47.5t-73.5 17.5t-69 -18q-50 53 -119 53q-25 0 -55.5 -10t-47.5 -25v331q0 52 -38 90t-90 38q-51 0 -89.5 -39t-38.5 -89v-576 q-20 0 -48.5 15t-55 33t-68 33t-84.5 15q-67 0 -97.5 -44.5t-30.5 -115.5q0 -24 139 -90q44 -24 65 -37q64 -40 145 -112q81 -71 106 -101q57 -69 57 -140v-32h640v32q0 72 32 167t64 193.5t32 179.5zM1536 705q0 -133 -69 -322q-59 -164 -59 -223v-288q0 -53 -37.5 -90.5 t-90.5 -37.5h-640q-53 0 -90.5 37.5t-37.5 90.5v288q0 10 -4.5 21.5t-14 23.5t-18 22.5t-22.5 24t-21.5 20.5t-21.5 19t-17 14q-74 65 -129 100q-21 13 -62 33t-72 37t-63 40.5t-49.5 55t-17.5 69.5q0 125 67 206.5t189 81.5q68 0 128 -22v374q0 104 76 180t179 76 q105 0 181 -75.5t76 -180.5v-169q62 -4 119 -37q21 3 43 3q101 0 178 -60q139 1 219.5 -85t80.5 -227z" />
|
||||
<glyph unicode="" d="M1408 576q0 84 -32 183t-64 194t-32 167v32h-640v-32q0 -35 -12 -67.5t-37 -62.5t-46 -50t-54 -49q-9 -8 -14 -12q-81 -72 -145 -112q-22 -14 -68 -38q-3 -1 -22.5 -10.5t-36 -18.5t-35.5 -20t-30.5 -21.5t-11.5 -18.5q0 -71 30.5 -115.5t97.5 -44.5q43 0 84.5 15t68 33 t55 33t48.5 15v-576q0 -50 38.5 -89t89.5 -39q52 0 90 38t38 90v331q46 -35 103 -35q69 0 119 53q32 -18 69 -18t73.5 17.5t52.5 47.5q24 -4 56 -4q85 0 126 48.5t41 135.5zM1280 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 580 q0 -142 -77.5 -230t-217.5 -87l-5 1q-76 -61 -178 -61q-22 0 -43 3q-54 -30 -119 -37v-169q0 -105 -76 -180.5t-181 -75.5q-103 0 -179 76t-76 180v374q-54 -22 -128 -22q-121 0 -188.5 81.5t-67.5 206.5q0 38 17.5 69.5t49.5 55t63 40.5t72 37t62 33q55 35 129 100 q3 2 17 14t21.5 19t21.5 20.5t22.5 24t18 22.5t14 23.5t4.5 21.5v288q0 53 37.5 90.5t90.5 37.5h640q53 0 90.5 -37.5t37.5 -90.5v-288q0 -59 59 -223q69 -190 69 -317z" />
|
||||
<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-502l189 189q19 19 19 45t-19 45l-91 91q-18 18 -45 18t-45 -18l-362 -362l-91 -91q-18 -18 -18 -45t18 -45l91 -91l362 -362q18 -18 45 -18t45 18l91 91q18 18 18 45t-18 45l-189 189h502q26 0 45 19t19 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1285 640q0 27 -18 45l-91 91l-362 362q-18 18 -45 18t-45 -18l-91 -91q-18 -18 -18 -45t18 -45l189 -189h-502q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h502l-189 -189q-19 -19 -19 -45t19 -45l91 -91q18 -18 45 -18t45 18l362 362l91 91q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1284 641q0 27 -18 45l-362 362l-91 91q-18 18 -45 18t-45 -18l-91 -91l-362 -362q-18 -18 -18 -45t18 -45l91 -91q18 -18 45 -18t45 18l189 189v-502q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v502l189 -189q19 -19 45 -19t45 19l91 91q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1284 639q0 27 -18 45l-91 91q-18 18 -45 18t-45 -18l-189 -189v502q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-502l-189 189q-19 19 -45 19t-45 -19l-91 -91q-18 -18 -18 -45t18 -45l362 -362l91 -91q18 -18 45 -18t45 18l91 91l362 362q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1042 887q-2 -1 -9.5 -9.5t-13.5 -9.5q2 0 4.5 5t5 11t3.5 7q6 7 22 15q14 6 52 12q34 8 51 -11 q-2 2 9.5 13t14.5 12q3 2 15 4.5t15 7.5l2 22q-12 -1 -17.5 7t-6.5 21q0 -2 -6 -8q0 7 -4.5 8t-11.5 -1t-9 -1q-10 3 -15 7.5t-8 16.5t-4 15q-2 5 -9.5 10.5t-9.5 10.5q-1 2 -2.5 5.5t-3 6.5t-4 5.5t-5.5 2.5t-7 -5t-7.5 -10t-4.5 -5q-3 2 -6 1.5t-4.5 -1t-4.5 -3t-5 -3.5 q-3 -2 -8.5 -3t-8.5 -2q15 5 -1 11q-10 4 -16 3q9 4 7.5 12t-8.5 14h5q-1 4 -8.5 8.5t-17.5 8.5t-13 6q-8 5 -34 9.5t-33 0.5q-5 -6 -4.5 -10.5t4 -14t3.5 -12.5q1 -6 -5.5 -13t-6.5 -12q0 -7 14 -15.5t10 -21.5q-3 -8 -16 -16t-16 -12q-5 -8 -1.5 -18.5t10.5 -16.5 q2 -2 1.5 -4t-3.5 -4.5t-5.5 -4t-6.5 -3.5l-3 -2q-11 -5 -20.5 6t-13.5 26q-7 25 -16 30q-23 8 -29 -1q-5 13 -41 26q-25 9 -58 4q6 1 0 15q-7 15 -19 12q3 6 4 17.5t1 13.5q3 13 12 23q1 1 7 8.5t9.5 13.5t0.5 6q35 -4 50 11q5 5 11.5 17t10.5 17q9 6 14 5.5t14.5 -5.5 t14.5 -5q14 -1 15.5 11t-7.5 20q12 -1 3 17q-5 7 -8 9q-12 4 -27 -5q-8 -4 2 -8q-1 1 -9.5 -10.5t-16.5 -17.5t-16 5q-1 1 -5.5 13.5t-9.5 13.5q-8 0 -16 -15q3 8 -11 15t-24 8q19 12 -8 27q-7 4 -20.5 5t-19.5 -4q-5 -7 -5.5 -11.5t5 -8t10.5 -5.5t11.5 -4t8.5 -3 q14 -10 8 -14q-2 -1 -8.5 -3.5t-11.5 -4.5t-6 -4q-3 -4 0 -14t-2 -14q-5 5 -9 17.5t-7 16.5q7 -9 -25 -6l-10 1q-4 0 -16 -2t-20.5 -1t-13.5 8q-4 8 0 20q1 4 4 2q-4 3 -11 9.5t-10 8.5q-46 -15 -94 -41q6 -1 12 1q5 2 13 6.5t10 5.5q34 14 42 7l5 5q14 -16 20 -25 q-7 4 -30 1q-20 -6 -22 -12q7 -12 5 -18q-4 3 -11.5 10t-14.5 11t-15 5q-16 0 -22 -1q-146 -80 -235 -222q7 -7 12 -8q4 -1 5 -9t2.5 -11t11.5 3q9 -8 3 -19q1 1 44 -27q19 -17 21 -21q3 -11 -10 -18q-1 2 -9 9t-9 4q-3 -5 0.5 -18.5t10.5 -12.5q-7 0 -9.5 -16t-2.5 -35.5 t-1 -23.5l2 -1q-3 -12 5.5 -34.5t21.5 -19.5q-13 -3 20 -43q6 -8 8 -9q3 -2 12 -7.5t15 -10t10 -10.5q4 -5 10 -22.5t14 -23.5q-2 -6 9.5 -20t10.5 -23q-1 0 -2.5 -1t-2.5 -1q3 -7 15.5 -14t15.5 -13q1 -3 2 -10t3 -11t8 -2q2 20 -24 62q-15 25 -17 29q-3 5 -5.5 15.5 t-4.5 14.5q2 0 6 -1.5t8.5 -3.5t7.5 -4t2 -3q-3 -7 2 -17.5t12 -18.5t17 -19t12 -13q6 -6 14 -19.5t0 -13.5q9 0 20 -10t17 -20q5 -8 8 -26t5 -24q2 -7 8.5 -13.5t12.5 -9.5l16 -8t13 -7q5 -2 18.5 -10.5t21.5 -11.5q10 -4 16 -4t14.5 2.5t13.5 3.5q15 2 29 -15t21 -21 q36 -19 55 -11q-2 -1 0.5 -7.5t8 -15.5t9 -14.5t5.5 -8.5q5 -6 18 -15t18 -15q6 4 7 9q-3 -8 7 -20t18 -10q14 3 14 32q-31 -15 -49 18q0 1 -2.5 5.5t-4 8.5t-2.5 8.5t0 7.5t5 3q9 0 10 3.5t-2 12.5t-4 13q-1 8 -11 20t-12 15q-5 -9 -16 -8t-16 9q0 -1 -1.5 -5.5t-1.5 -6.5 q-13 0 -15 1q1 3 2.5 17.5t3.5 22.5q1 4 5.5 12t7.5 14.5t4 12.5t-4.5 9.5t-17.5 2.5q-19 -1 -26 -20q-1 -3 -3 -10.5t-5 -11.5t-9 -7q-7 -3 -24 -2t-24 5q-13 8 -22.5 29t-9.5 37q0 10 2.5 26.5t3 25t-5.5 24.5q3 2 9 9.5t10 10.5q2 1 4.5 1.5t4.5 0t4 1.5t3 6q-1 1 -4 3 q-3 3 -4 3q7 -3 28.5 1.5t27.5 -1.5q15 -11 22 2q0 1 -2.5 9.5t-0.5 13.5q5 -27 29 -9q3 -3 15.5 -5t17.5 -5q3 -2 7 -5.5t5.5 -4.5t5 0.5t8.5 6.5q10 -14 12 -24q11 -40 19 -44q7 -3 11 -2t4.5 9.5t0 14t-1.5 12.5l-1 8v18l-1 8q-15 3 -18.5 12t1.5 18.5t15 18.5q1 1 8 3.5 t15.5 6.5t12.5 8q21 19 15 35q7 0 11 9q-1 0 -5 3t-7.5 5t-4.5 2q9 5 2 16q5 3 7.5 11t7.5 10q9 -12 21 -2q7 8 1 16q5 7 20.5 10.5t18.5 9.5q7 -2 8 2t1 12t3 12q4 5 15 9t13 5l17 11q3 4 0 4q18 -2 31 11q10 11 -6 20q3 6 -3 9.5t-15 5.5q3 1 11.5 0.5t10.5 1.5 q15 10 -7 16q-17 5 -43 -12zM879 10q206 36 351 189q-3 3 -12.5 4.5t-12.5 3.5q-18 7 -24 8q1 7 -2.5 13t-8 9t-12.5 8t-11 7q-2 2 -7 6t-7 5.5t-7.5 4.5t-8.5 2t-10 -1l-3 -1q-3 -1 -5.5 -2.5t-5.5 -3t-4 -3t0 -2.5q-21 17 -36 22q-5 1 -11 5.5t-10.5 7t-10 1.5t-11.5 -7 q-5 -5 -6 -15t-2 -13q-7 5 0 17.5t2 18.5q-3 6 -10.5 4.5t-12 -4.5t-11.5 -8.5t-9 -6.5t-8.5 -5.5t-8.5 -7.5q-3 -4 -6 -12t-5 -11q-2 4 -11.5 6.5t-9.5 5.5q2 -10 4 -35t5 -38q7 -31 -12 -48q-27 -25 -29 -40q-4 -22 12 -26q0 -7 -8 -20.5t-7 -21.5q0 -6 2 -16z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M384 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1028 484l-682 -682q-37 -37 -90 -37q-52 0 -91 37l-106 108q-38 36 -38 90q0 53 38 91l681 681q39 -98 114.5 -173.5t173.5 -114.5zM1662 919q0 -39 -23 -106q-47 -134 -164.5 -217.5 t-258.5 -83.5q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q58 0 121.5 -16.5t107.5 -46.5q16 -11 16 -28t-16 -28l-293 -169v-224l193 -107q5 3 79 48.5t135.5 81t70.5 35.5q15 0 23.5 -10t8.5 -25z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1024 128h640v128h-640v-128zM640 640h1024v128h-1024v-128zM1280 1152h384v128h-384v-128zM1792 320v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 832v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19 t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1403 1241q17 -41 -14 -70l-493 -493v-742q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-256 256q-19 19 -19 45v486l-493 493q-31 29 -14 70q17 39 59 39h1280q42 0 59 -39z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M640 1280h512v128h-512v-128zM1792 640v-480q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v480h672v-160q0 -26 19 -45t45 -19h320q26 0 45 19t19 45v160h672zM1024 640v-128h-256v128h256zM1792 1120v-384h-1792v384q0 66 47 113t113 47h352v160q0 40 28 68 t68 28h576q40 0 68 -28t28 -68v-160h352q66 0 113 -47t47 -113z" />
|
||||
<glyph unicode="" d="M1283 995l-355 -355l355 -355l144 144q29 31 70 14q39 -17 39 -59v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l144 144l-355 355l-355 -355l144 -144q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l144 -144 l355 355l-355 355l-144 -144q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v448q0 26 19 45t45 19h448q42 0 59 -40q17 -39 -14 -69l-144 -144l355 -355l355 355l-144 144q-31 30 -14 69q17 40 59 40h448q26 0 45 -19t19 -45v-448q0 -42 -39 -59q-13 -5 -25 -5q-26 0 -45 19z " />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M593 640q-162 -5 -265 -128h-134q-82 0 -138 40.5t-56 118.5q0 353 124 353q6 0 43.5 -21t97.5 -42.5t119 -21.5q67 0 133 23q-5 -37 -5 -66q0 -139 81 -256zM1664 3q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5 t43 97.5t62 81t85.5 53.5t111.5 20q10 0 43 -21.5t73 -48t107 -48t135 -21.5t135 21.5t107 48t73 48t43 21.5q61 0 111.5 -20t85.5 -53.5t62 -81t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM640 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75 t75 -181zM1344 896q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5zM1920 671q0 -78 -56 -118.5t-138 -40.5h-134q-103 123 -265 128q81 117 81 256q0 29 -5 66q66 -23 133 -23q59 0 119 21.5t97.5 42.5 t43.5 21q124 0 124 -353zM1792 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1456 320q0 40 -28 68l-208 208q-28 28 -68 28q-42 0 -72 -32q3 -3 19 -18.5t21.5 -21.5t15 -19t13 -25.5t3.5 -27.5q0 -40 -28 -68t-68 -28q-15 0 -27.5 3.5t-25.5 13t-19 15t-21.5 21.5t-18.5 19q-33 -31 -33 -73q0 -40 28 -68l206 -207q27 -27 68 -27q40 0 68 26 l147 146q28 28 28 67zM753 1025q0 40 -28 68l-206 207q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l208 -208q27 -27 68 -27q42 0 72 31q-3 3 -19 18.5t-21.5 21.5t-15 19t-13 25.5t-3.5 27.5q0 40 28 68t68 28q15 0 27.5 -3.5t25.5 -13t19 -15 t21.5 -21.5t18.5 -19q33 31 33 73zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-206 207q-83 83 -83 203q0 123 88 209l-88 88q-86 -88 -208 -88q-120 0 -204 84l-208 208q-84 84 -84 204t85 203l147 146q83 83 203 83q121 0 204 -85l206 -207 q83 -83 83 -203q0 -123 -88 -209l88 -88q86 88 208 88q120 0 204 -84l208 -208q84 -84 84 -204z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088q-185 0 -316.5 131.5t-131.5 316.5q0 132 71 241.5t187 163.5q-2 28 -2 43q0 212 150 362t362 150q158 0 286.5 -88t187.5 -230q70 62 166 62q106 0 181 -75t75 -181q0 -75 -41 -138q129 -30 213 -134.5t84 -239.5z " />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1527 88q56 -89 21.5 -152.5t-140.5 -63.5h-1152q-106 0 -140.5 63.5t21.5 152.5l503 793v399h-64q-26 0 -45 19t-19 45t19 45t45 19h512q26 0 45 -19t19 -45t-19 -45t-45 -19h-64v-399zM748 813l-272 -429h712l-272 429l-20 31v37v399h-128v-399v-37z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M960 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1260 576l507 -398q28 -20 25 -56q-5 -35 -35 -51l-128 -64q-13 -7 -29 -7q-17 0 -31 8l-690 387l-110 -66q-8 -4 -12 -5q14 -49 10 -97q-7 -77 -56 -147.5t-132 -123.5q-132 -84 -277 -84 q-136 0 -222 78q-90 84 -79 207q7 76 56 147t131 124q132 84 278 84q83 0 151 -31q9 13 22 22l122 73l-122 73q-13 9 -22 22q-68 -31 -151 -31q-146 0 -278 84q-82 53 -131 124t-56 147q-5 59 15.5 113t63.5 93q85 79 222 79q145 0 277 -84q83 -52 132 -123t56 -148 q4 -48 -10 -97q4 -1 12 -5l110 -66l690 387q14 8 31 8q16 0 29 -7l128 -64q30 -16 35 -51q3 -36 -25 -56zM579 836q46 42 21 108t-106 117q-92 59 -192 59q-74 0 -113 -36q-46 -42 -21 -108t106 -117q92 -59 192 -59q74 0 113 36zM494 91q81 51 106 117t-21 108 q-39 36 -113 36q-100 0 -192 -59q-81 -51 -106 -117t21 -108q39 -36 113 -36q100 0 192 59zM672 704l96 -58v11q0 36 33 56l14 8l-79 47l-26 -26q-3 -3 -10 -11t-12 -12q-2 -2 -4 -3.5t-3 -2.5zM896 480l96 -32l736 576l-128 64l-768 -431v-113l-160 -96l9 -8q2 -2 7 -6 q4 -4 11 -12t11 -12l26 -26zM1600 64l128 64l-520 408l-177 -138q-2 -3 -13 -7z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1696 1152q40 0 68 -28t28 -68v-1216q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v288h-544q-40 0 -68 28t-28 68v672q0 40 20 88t48 76l408 408q28 28 76 48t88 20h416q40 0 68 -28t28 -68v-328q68 40 128 40h416zM1152 939l-299 -299h299v299zM512 1323l-299 -299 h299v299zM708 676l316 316v416h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h512v256q0 40 20 88t48 76zM1664 -128v1152h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h896z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1404 151q0 -117 -79 -196t-196 -79q-135 0 -235 100l-777 776q-113 115 -113 271q0 159 110 270t269 111q158 0 273 -113l605 -606q10 -10 10 -22q0 -16 -30.5 -46.5t-46.5 -30.5q-13 0 -23 10l-606 607q-79 77 -181 77q-106 0 -179 -75t-73 -181q0 -105 76 -181 l776 -777q63 -63 145 -63q64 0 106 42t42 106q0 82 -63 145l-581 581q-26 24 -60 24q-29 0 -48 -19t-19 -48q0 -32 25 -59l410 -410q10 -10 10 -22q0 -16 -31 -47t-47 -31q-12 0 -22 10l-410 410q-63 61 -63 149q0 82 57 139t139 57q88 0 149 -63l581 -581q100 -98 100 -235 z" />
|
||||
<glyph unicode="" d="M384 0h768v384h-768v-384zM1280 0h128v896q0 14 -10 38.5t-20 34.5l-281 281q-10 10 -34 20t-39 10v-416q0 -40 -28 -68t-68 -28h-576q-40 0 -68 28t-28 68v416h-128v-1280h128v416q0 40 28 68t68 28h832q40 0 68 -28t28 -68v-416zM896 928v320q0 13 -9.5 22.5t-22.5 9.5 h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5zM1536 896v-928q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h928q40 0 88 -20t76 -48l280 -280q28 -28 48 -76t20 -88z" />
|
||||
<glyph unicode="" d="M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M1536 192v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 704v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 1216v-128q0 -26 -19 -45 t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M384 128q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 640q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1152q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z M1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M381 -84q0 -80 -54.5 -126t-135.5 -46q-106 0 -172 66l57 88q49 -45 106 -45q29 0 50.5 14.5t21.5 42.5q0 64 -105 56l-26 56q8 10 32.5 43.5t42.5 54t37 38.5v1q-16 0 -48.5 -1t-48.5 -1v-53h-106v152h333v-88l-95 -115q51 -12 81 -49t30 -88zM383 543v-159h-362 q-6 36 -6 54q0 51 23.5 93t56.5 68t66 47.5t56.5 43.5t23.5 45q0 25 -14.5 38.5t-39.5 13.5q-46 0 -81 -58l-85 59q24 51 71.5 79.5t105.5 28.5q73 0 123 -41.5t50 -112.5q0 -50 -34 -91.5t-75 -64.5t-75.5 -50.5t-35.5 -52.5h127v60h105zM1792 224v-192q0 -13 -9.5 -22.5 t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1123v-99h-335v99h107q0 41 0.5 122t0.5 121v12h-2q-8 -17 -50 -54l-71 76l136 127h106v-404h108zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5 t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1760 640q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h1728zM483 704q-28 35 -51 80q-48 97 -48 188q0 181 134 309q133 127 393 127q50 0 167 -19q66 -12 177 -48q10 -38 21 -118q14 -123 14 -183q0 -18 -5 -45l-12 -3l-84 6 l-14 2q-50 149 -103 205q-88 91 -210 91q-114 0 -182 -59q-67 -58 -67 -146q0 -73 66 -140t279 -129q69 -20 173 -66q58 -28 95 -52h-743zM990 448h411q7 -39 7 -92q0 -111 -41 -212q-23 -55 -71 -104q-37 -35 -109 -81q-80 -48 -153 -66q-80 -21 -203 -21q-114 0 -195 23 l-140 40q-57 16 -72 28q-8 8 -8 22v13q0 108 -2 156q-1 30 0 68l2 37v44l102 2q15 -34 30 -71t22.5 -56t12.5 -27q35 -57 80 -94q43 -36 105 -57q59 -22 132 -22q64 0 139 27q77 26 122 86q47 61 47 129q0 84 -81 157q-34 29 -137 71z" />
|
||||
<glyph unicode="" d="M48 1313q-37 2 -45 4l-3 88q13 1 40 1q60 0 112 -4q132 -7 166 -7q86 0 168 3q116 4 146 5q56 0 86 2l-1 -14l2 -64v-9q-60 -9 -124 -9q-60 0 -79 -25q-13 -14 -13 -132q0 -13 0.5 -32.5t0.5 -25.5l1 -229l14 -280q6 -124 51 -202q35 -59 96 -92q88 -47 177 -47 q104 0 191 28q56 18 99 51q48 36 65 64q36 56 53 114q21 73 21 229q0 79 -3.5 128t-11 122.5t-13.5 159.5l-4 59q-5 67 -24 88q-34 35 -77 34l-100 -2l-14 3l2 86h84l205 -10q76 -3 196 10l18 -2q6 -38 6 -51q0 -7 -4 -31q-45 -12 -84 -13q-73 -11 -79 -17q-15 -15 -15 -41 q0 -7 1.5 -27t1.5 -31q8 -19 22 -396q6 -195 -15 -304q-15 -76 -41 -122q-38 -65 -112 -123q-75 -57 -182 -89q-109 -33 -255 -33q-167 0 -284 46q-119 47 -179 122q-61 76 -83 195q-16 80 -16 237v333q0 188 -17 213q-25 36 -147 39zM1536 -96v64q0 14 -9 23t-23 9h-1472 q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h1472q14 0 23 9t9 23z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M512 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23 v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 160v192 q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192 q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1664 1248v-1088q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1344q66 0 113 -47t47 -113 z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1190 955l293 293l-107 107l-293 -293zM1637 1248q0 -27 -18 -45l-1286 -1286q-18 -18 -45 -18t-45 18l-198 198q-18 18 -18 45t18 45l1286 1286q18 18 45 18t45 -18l198 -198q18 -18 18 -45zM286 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM636 1276 l196 -60l-196 -60l-60 -196l-60 196l-196 60l196 60l60 196zM1566 798l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM926 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M640 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM256 640h384v256h-158q-13 0 -22 -9l-195 -195q-9 -9 -9 -22v-30zM1536 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1792 1216v-1024q0 -15 -4 -26.5t-13.5 -18.5 t-16.5 -11.5t-23.5 -6t-22.5 -2t-25.5 0t-22.5 0.5q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-64q-3 0 -22.5 -0.5t-25.5 0t-22.5 2t-23.5 6t-16.5 11.5t-13.5 18.5t-4 26.5q0 26 19 45t45 19v320q0 8 -0.5 35t0 38 t2.5 34.5t6.5 37t14 30.5t22.5 30l198 198q19 19 50.5 32t58.5 13h160v192q0 26 19 45t45 19h1024q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103q-111 0 -218 32q59 93 78 164q9 34 54 211q20 -39 73 -67.5t114 -28.5q121 0 216 68.5t147 188.5t52 270q0 114 -59.5 214t-172.5 163t-255 63q-105 0 -196 -29t-154.5 -77t-109 -110.5t-67 -129.5t-21.5 -134 q0 -104 40 -183t117 -111q30 -12 38 20q2 7 8 31t8 30q6 23 -11 43q-51 61 -51 151q0 151 104.5 259.5t273.5 108.5q151 0 235.5 -82t84.5 -213q0 -170 -68.5 -289t-175.5 -119q-61 0 -98 43.5t-23 104.5q8 35 26.5 93.5t30 103t11.5 75.5q0 50 -27 83t-77 33 q-62 0 -105 -57t-43 -142q0 -73 25 -122l-99 -418q-17 -70 -13 -177q-206 91 -333 281t-127 423q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-725q85 122 108 210q9 34 53 209q21 -39 73.5 -67t112.5 -28q181 0 295.5 147.5t114.5 373.5q0 84 -35 162.5t-96.5 139t-152.5 97t-197 36.5q-104 0 -194.5 -28.5t-153 -76.5 t-107.5 -109.5t-66.5 -128t-21.5 -132.5q0 -102 39.5 -180t116.5 -110q13 -5 23.5 0t14.5 19q10 44 15 61q6 23 -11 42q-50 62 -50 150q0 150 103.5 256.5t270.5 106.5q149 0 232.5 -81t83.5 -210q0 -168 -67.5 -286t-173.5 -118q-60 0 -97 43.5t-23 103.5q8 34 26.5 92.5 t29.5 102t11 74.5q0 49 -26.5 81.5t-75.5 32.5q-61 0 -103.5 -56.5t-42.5 -139.5q0 -72 24 -121l-98 -414q-24 -100 -7 -254h-183q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960z" />
|
||||
<glyph unicode="" d="M678 -57q0 -38 -10 -71h-380q-95 0 -171.5 56.5t-103.5 147.5q24 45 69 77.5t100 49.5t107 24t107 7q32 0 49 -2q6 -4 30.5 -21t33 -23t31 -23t32 -25.5t27.5 -25.5t26.5 -29.5t21 -30.5t17.5 -34.5t9.5 -36t4.5 -40.5zM385 294q-234 -7 -385 -85v433q103 -118 273 -118 q32 0 70 5q-21 -61 -21 -86q0 -67 63 -149zM558 805q0 -100 -43.5 -160.5t-140.5 -60.5q-51 0 -97 26t-78 67.5t-56 93.5t-35.5 104t-11.5 99q0 96 51.5 165t144.5 69q66 0 119 -41t84 -104t47 -130t16 -128zM1536 896v-736q0 -119 -84.5 -203.5t-203.5 -84.5h-468 q39 73 39 157q0 66 -22 122.5t-55.5 93t-72 71t-72 59.5t-55.5 54.5t-22 59.5q0 36 23 68t56 61.5t65.5 64.5t55.5 93t23 131t-26.5 145.5t-75.5 118.5q-6 6 -14 11t-12.5 7.5t-10 9.5t-10.5 17h135l135 64h-437q-138 0 -244.5 -38.5t-182.5 -133.5q0 126 81 213t207 87h960 q119 0 203.5 -84.5t84.5 -203.5v-96h-256v256h-128v-256h-256v-128h256v-256h128v256h256z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M876 71q0 21 -4.5 40.5t-9.5 36t-17.5 34.5t-21 30.5t-26.5 29.5t-27.5 25.5t-32 25.5t-31 23t-33 23t-30.5 21q-17 2 -50 2q-54 0 -106 -7t-108 -25t-98 -46t-69 -75t-27 -107q0 -68 35.5 -121.5t93 -84t120.5 -45.5t127 -15q59 0 112.5 12.5t100.5 39t74.5 73.5 t27.5 110zM756 933q0 60 -16.5 127.5t-47 130.5t-84 104t-119.5 41q-93 0 -144 -69t-51 -165q0 -47 11.5 -99t35.5 -104t56 -93.5t78 -67.5t97 -26q97 0 140.5 60.5t43.5 160.5zM625 1408h437l-135 -79h-135q71 -45 110 -126t39 -169q0 -74 -23 -131.5t-56 -92.5t-66 -64.5 t-56 -61t-23 -67.5q0 -26 16.5 -51t43 -48t58.5 -48t64 -55.5t58.5 -66t43 -85t16.5 -106.5q0 -160 -140 -282q-152 -131 -420 -131q-59 0 -119.5 10t-122 33.5t-108.5 58t-77 89t-30 121.5q0 61 37 135q32 64 96 110.5t145 71t155 36t150 13.5q-64 83 -64 149q0 12 2 23.5 t5 19.5t8 21.5t7 21.5q-40 -5 -70 -5q-149 0 -255.5 98t-106.5 246q0 140 95 250.5t234 141.5q94 20 187 20zM1664 1152v-128h-256v-256h-128v256h-256v128h256v256h128v-256h256z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M768 384h384v96h-128v448h-114l-148 -137l77 -80q42 37 55 57h2v-288h-128v-96zM1280 640q0 -70 -21 -142t-59.5 -134t-101.5 -101t-138 -39t-138 39t-101.5 101t-59.5 134t-21 142t21 142t59.5 134t101.5 101t138 39t138 -39t101.5 -101t59.5 -134t21 -142zM1792 384 v512q-106 0 -181 75t-75 181h-1152q0 -106 -75 -181t-181 -75v-512q106 0 181 -75t75 -181h1152q0 106 75 181t181 75zM1920 1216v-1152q0 -26 -19 -45t-45 -19h-1792q-26 0 -45 19t-19 45v1152q0 26 19 45t45 19h1792q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M1024 832q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M1024 320q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="640" d="M640 1088v-896q0 -26 -19 -45t-45 -19t-45 19l-448 448q-19 19 -19 45t19 45l448 448q19 19 45 19t45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="640" d="M576 640q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19t-19 45v896q0 26 19 45t45 19t45 -19l448 -448q19 -19 19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M160 0h608v1152h-640v-1120q0 -13 9.5 -22.5t22.5 -9.5zM1536 32v1120h-640v-1152h608q13 0 22.5 9.5t9.5 22.5zM1664 1248v-1216q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1344q66 0 113 -47t47 -113z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45zM1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 826v-794q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v794q44 -49 101 -87q362 -246 497 -345q57 -42 92.5 -65.5t94.5 -48t110 -24.5h1h1q51 0 110 24.5t94.5 48t92.5 65.5q170 123 498 345q57 39 100 87zM1792 1120q0 -79 -49 -151t-122 -123 q-376 -261 -468 -325q-10 -7 -42.5 -30.5t-54 -38t-52 -32.5t-57.5 -27t-50 -9h-1h-1q-23 0 -50 9t-57.5 27t-52 32.5t-54 38t-42.5 30.5q-91 64 -262 182.5t-205 142.5q-62 42 -117 115.5t-55 136.5q0 78 41.5 130t118.5 52h1472q65 0 112.5 -47t47.5 -113z" />
|
||||
<glyph unicode="" d="M349 911v-991h-330v991h330zM370 1217q1 -73 -50.5 -122t-135.5 -49h-2q-82 0 -132 49t-50 122q0 74 51.5 122.5t134.5 48.5t133 -48.5t51 -122.5zM1536 488v-568h-329v530q0 105 -40.5 164.5t-126.5 59.5q-63 0 -105.5 -34.5t-63.5 -85.5q-11 -30 -11 -81v-553h-329 q2 399 2 647t-1 296l-1 48h329v-144h-2q20 32 41 56t56.5 52t87 43.5t114.5 15.5q171 0 275 -113.5t104 -332.5z" />
|
||||
<glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5 t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1771 0q0 -53 -37 -90l-107 -108q-39 -37 -91 -37q-53 0 -90 37l-363 364q-38 36 -38 90q0 53 43 96l-256 256l-126 -126q-14 -14 -34 -14t-34 14q2 -2 12.5 -12t12.5 -13t10 -11.5t10 -13.5t6 -13.5t5.5 -16.5t1.5 -18q0 -38 -28 -68q-3 -3 -16.5 -18t-19 -20.5 t-18.5 -16.5t-22 -15.5t-22 -9t-26 -4.5q-40 0 -68 28l-408 408q-28 28 -28 68q0 13 4.5 26t9 22t15.5 22t16.5 18.5t20.5 19t18 16.5q30 28 68 28q10 0 18 -1.5t16.5 -5.5t13.5 -6t13.5 -10t11.5 -10t13 -12.5t12 -12.5q-14 14 -14 34t14 34l348 348q14 14 34 14t34 -14 q-2 2 -12.5 12t-12.5 13t-10 11.5t-10 13.5t-6 13.5t-5.5 16.5t-1.5 18q0 38 28 68q3 3 16.5 18t19 20.5t18.5 16.5t22 15.5t22 9t26 4.5q40 0 68 -28l408 -408q28 -28 28 -68q0 -13 -4.5 -26t-9 -22t-15.5 -22t-16.5 -18.5t-20.5 -19t-18 -16.5q-30 -28 -68 -28 q-10 0 -18 1.5t-16.5 5.5t-13.5 6t-13.5 10t-11.5 10t-13 12.5t-12 12.5q14 -14 14 -34t-14 -34l-126 -126l256 -256q43 43 96 43q52 0 91 -37l363 -363q37 -39 37 -91z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM576 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1004 351l101 382q6 26 -7.5 48.5t-38.5 29.5 t-48 -6.5t-30 -39.5l-101 -382q-60 -5 -107 -43.5t-63 -98.5q-20 -77 20 -146t117 -89t146 20t89 117q16 60 -6 117t-72 91zM1664 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 1024q0 53 -37.5 90.5 t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1472 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 384q0 -261 -141 -483q-19 -29 -54 -29h-1402q-35 0 -54 29 q-141 221 -141 483q0 182 71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640 q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 174 120 321.5 t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M704 1152q-153 0 -286 -52t-211.5 -141t-78.5 -191q0 -82 53 -158t149 -132l97 -56l-35 -84q34 20 62 39l44 31l53 -10q78 -14 153 -14q153 0 286 52t211.5 141t78.5 191t-78.5 191t-211.5 141t-286 52zM704 1280q191 0 353.5 -68.5t256.5 -186.5t94 -257t-94 -257 t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224q0 139 94 257t256.5 186.5 t353.5 68.5zM1526 111q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129 q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230q0 -120 -71 -224.5t-195 -176.5z" />
|
||||
<glyph unicode="" horiz-adv-x="896" d="M885 970q18 -20 7 -44l-540 -1157q-13 -25 -42 -25q-4 0 -14 2q-17 5 -25.5 19t-4.5 30l197 808l-406 -101q-4 -1 -12 -1q-18 0 -31 11q-18 15 -13 39l201 825q4 14 16 23t28 9h328q19 0 32 -12.5t13 -29.5q0 -8 -5 -18l-171 -463l396 98q8 2 12 2q19 0 34 -15z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 288v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320 q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192q0 52 38 90t90 38h512v192h-96q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h320q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-96v-192h512q52 0 90 -38t38 -90v-192h96q40 0 68 -28t28 -68 z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M896 708v-580q0 -104 -76 -180t-180 -76t-180 76t-76 180q0 26 19 45t45 19t45 -19t19 -45q0 -50 39 -89t89 -39t89 39t39 89v580q33 11 64 11t64 -11zM1664 681q0 -13 -9.5 -22.5t-22.5 -9.5q-11 0 -23 10q-49 46 -93 69t-102 23q-68 0 -128 -37t-103 -97 q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -28 -17q-18 0 -29 17q-4 6 -14.5 24t-17.5 28q-43 60 -102.5 97t-127.5 37t-127.5 -37t-102.5 -97q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -29 -17q-17 0 -28 17q-4 6 -14.5 24t-17.5 28q-43 60 -103 97t-128 37q-58 0 -102 -23t-93 -69 q-12 -10 -23 -10q-13 0 -22.5 9.5t-9.5 22.5q0 5 1 7q45 183 172.5 319.5t298 204.5t360.5 68q140 0 274.5 -40t246.5 -113.5t194.5 -187t115.5 -251.5q1 -2 1 -7zM896 1408v-98q-42 2 -64 2t-64 -2v98q0 26 19 45t45 19t45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M768 -128h896v640h-416q-40 0 -68 28t-28 68v416h-384v-1152zM1024 1312v64q0 13 -9.5 22.5t-22.5 9.5h-704q-13 0 -22.5 -9.5t-9.5 -22.5v-64q0 -13 9.5 -22.5t22.5 -9.5h704q13 0 22.5 9.5t9.5 22.5zM1280 640h299l-299 299v-299zM1792 512v-672q0 -40 -28 -68t-68 -28 h-960q-40 0 -68 28t-28 68v160h-544q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1088q40 0 68 -28t28 -68v-328q21 -13 36 -28l408 -408q28 -28 48 -76t20 -88z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M736 960q0 -13 -9.5 -22.5t-22.5 -9.5t-22.5 9.5t-9.5 22.5q0 46 -54 71t-106 25q-13 0 -22.5 9.5t-9.5 22.5t9.5 22.5t22.5 9.5q50 0 99.5 -16t87 -54t37.5 -90zM896 960q0 72 -34.5 134t-90 101.5t-123 62t-136.5 22.5t-136.5 -22.5t-123 -62t-90 -101.5t-34.5 -134 q0 -101 68 -180q10 -11 30.5 -33t30.5 -33q128 -153 141 -298h228q13 145 141 298q10 11 30.5 33t30.5 33q68 79 68 180zM1024 960q0 -155 -103 -268q-45 -49 -74.5 -87t-59.5 -95.5t-34 -107.5q47 -28 47 -82q0 -37 -25 -64q25 -27 25 -64q0 -52 -45 -81q13 -23 13 -47 q0 -46 -31.5 -71t-77.5 -25q-20 -44 -60 -70t-87 -26t-87 26t-60 70q-46 0 -77.5 25t-31.5 71q0 24 13 47q-45 29 -45 81q0 37 25 64q-25 27 -25 64q0 54 47 82q-4 50 -34 107.5t-59.5 95.5t-74.5 87q-103 113 -103 268q0 99 44.5 184.5t117 142t164 89t186.5 32.5 t186.5 -32.5t164 -89t117 -142t44.5 -184.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 352v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5q-12 0 -24 10l-319 320q-9 9 -9 22q0 14 9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h1376q13 0 22.5 -9.5t9.5 -22.5zM1792 896q0 -14 -9 -23l-320 -320q-9 -9 -23 -9 q-13 0 -22.5 9.5t-9.5 22.5v192h-1376q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1376v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1280 608q0 14 -9 23t-23 9h-224v352q0 13 -9.5 22.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-352h-224q-13 0 -22.5 -9.5t-9.5 -22.5q0 -14 9 -23l352 -352q9 -9 23 -9t23 9l351 351q10 12 10 24zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1280 672q0 14 -9 23l-352 352q-9 9 -23 9t-23 -9l-351 -351q-10 -12 -10 -24q0 -14 9 -23t23 -9h224v-352q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5v352h224q13 0 22.5 9.5t9.5 22.5zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M384 192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 68 5.5 131t24 138t47.5 132.5t81 103t120 60.5q-22 -52 -22 -120v-203q-58 -20 -93 -70t-35 -111q0 -80 56 -136t136 -56 t136 56t56 136q0 61 -35.5 111t-92.5 70v203q0 62 25 93q132 -104 295 -104t295 104q25 -31 25 -93v-64q-106 0 -181 -75t-75 -181v-89q-32 -29 -32 -71q0 -40 28 -68t68 -28t68 28t28 68q0 42 -32 71v89q0 52 38 90t90 38t90 -38t38 -90v-89q-32 -29 -32 -71q0 -40 28 -68 t68 -28t68 28t28 68q0 42 -32 71v89q0 68 -34.5 127.5t-93.5 93.5q0 10 0.5 42.5t0 48t-2.5 41.5t-7 47t-13 40q68 -15 120 -60.5t81 -103t47.5 -132.5t24 -138t5.5 -131zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5 t271.5 -112.5t112.5 -271.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1280 832q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 832q0 -62 -35.5 -111t-92.5 -70v-395q0 -159 -131.5 -271.5t-316.5 -112.5t-316.5 112.5t-131.5 271.5v132q-164 20 -274 128t-110 252v512q0 26 19 45t45 19q6 0 16 -2q17 30 47 48 t65 18q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5q-33 0 -64 18v-402q0 -106 94 -181t226 -75t226 75t94 181v402q-31 -18 -64 -18q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5q35 0 65 -18t47 -48q10 2 16 2q26 0 45 -19t19 -45v-512q0 -144 -110 -252 t-274 -128v-132q0 -106 94 -181t226 -75t226 75t94 181v395q-57 21 -92.5 70t-35.5 111q0 80 56 136t136 56t136 -56t56 -136z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M640 1152h512v128h-512v-128zM288 1152v-1280h-64q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h64zM1408 1152v-1280h-1024v1280h128v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h128zM1792 928v-832q0 -92 -66 -158t-158 -66h-64v1280h64q92 0 158 -66 t66 -158z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M848 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM1664 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q190 161 287 397.5t97 498.5 q0 165 96 262t264 117q-8 18 -8 37q0 40 28 68t68 28t68 -28t28 -68q0 -19 -8 -37q168 -20 264 -117t96 -262q0 -262 97 -498.5t287 -397.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1664 896q0 80 -56 136t-136 56h-64v-384h64q80 0 136 56t56 136zM0 128h1792q0 -106 -75 -181t-181 -75h-1280q-106 0 -181 75t-75 181zM1856 896q0 -159 -112.5 -271.5t-271.5 -112.5h-64v-32q0 -92 -66 -158t-158 -66h-704q-92 0 -158 66t-66 158v736q0 26 19 45 t45 19h1152q159 0 271.5 -112.5t112.5 -271.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M640 1472v-640q0 -61 -35.5 -111t-92.5 -70v-779q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v779q-57 20 -92.5 70t-35.5 111v640q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45 t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45zM1408 1472v-1600q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v512h-224q-13 0 -22.5 9.5t-9.5 22.5v800q0 132 94 226t226 94h256q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1280" d="M1024 352v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM1024 608v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM128 0h1024v768h-416q-40 0 -68 28t-28 68v416h-512v-1280z M768 896h376q-10 29 -22 41l-313 313q-12 12 -41 22v-376zM1280 864v-896q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h640q40 0 88 -20t76 -48l312 -312q28 -28 48 -76t20 -88z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 -128h384v1536h-1152v-1536h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM1408 1472v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 -128h384v1152h-256v-32q0 -40 -28 -68t-68 -28h-448q-40 0 -68 28t-28 68v32h-256v-1152h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM896 1056v320q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-96h-128v96q0 13 -9.5 22.5 t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5v96h128v-96q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1408 1088v-1280q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1280q0 26 19 45t45 19h320 v288q0 40 28 68t68 28h448q40 0 68 -28t28 -68v-288h320q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M640 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM256 640h384v256h-158q-14 -2 -22 -9l-195 -195q-7 -12 -9 -22v-30zM1536 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5zM1664 800v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM1920 1344v-1152 q0 -26 -19 -45t-45 -19h-192q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-128q-26 0 -45 19t-19 45t19 45t45 19v416q0 26 13 58t32 51l198 198q19 19 51 32t58 13h160v320q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1280 416v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM640 1152h512v128h-512v-128zM256 1152v-1280h-32 q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h32zM1440 1152v-1280h-1088v1280h160v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h160zM1792 928v-832q0 -92 -66 -158t-158 -66h-32v1280h32q92 0 158 -66t66 -158z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1920 576q-1 -32 -288 -96l-352 -32l-224 -64h-64l-293 -352h69q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-96h-160h-64v32h64v416h-160l-192 -224h-96l-32 32v192h32v32h128v8l-192 24v128l192 24v8h-128v32h-32v192l32 32h96l192 -224h160v416h-64v32h64h160h96 q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-69l293 -352h64l224 -64l352 -32q261 -58 287 -93z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M640 640v384h-256v-256q0 -53 37.5 -90.5t90.5 -37.5h128zM1664 192v-192h-1152v192l128 192h-128q-159 0 -271.5 112.5t-112.5 271.5v320l-64 64l32 128h480l32 128h960l32 -192l-64 -32v-800z" />
|
||||
<glyph unicode="" d="M1280 192v896q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-512v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-896q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h512v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-320v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-320q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h320v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h320q26 0 45 19t19 45zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M627 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23zM1011 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM979 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23 l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M1075 224q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM1075 608q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393 q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M1075 672q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23zM1075 1056q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="640" d="M627 992q0 -13 -10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="640" d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M1075 352q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M1075 800q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1792 544v832q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1376v-1088q0 -66 -47 -113t-113 -47h-544q0 -37 16 -77.5t32 -71t16 -43.5q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19 t-19 45q0 14 16 44t32 70t16 78h-544q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M416 256q-66 0 -113 47t-47 113v704q0 66 47 113t113 47h1088q66 0 113 -47t47 -113v-704q0 -66 -47 -113t-113 -47h-1088zM384 1120v-704q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5v704q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5z M1760 192h160v-96q0 -40 -47 -68t-113 -28h-1600q-66 0 -113 28t-47 68v96h160h1600zM1040 96q16 0 16 16t-16 16h-160q-16 0 -16 -16t16 -16h160z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M640 128q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1024 288v960q0 13 -9.5 22.5t-22.5 9.5h-832q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h832q13 0 22.5 9.5t9.5 22.5zM1152 1248v-1088q0 -66 -47 -113t-113 -47h-832 q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h832q66 0 113 -47t47 -113z" />
|
||||
<glyph unicode="" horiz-adv-x="768" d="M464 128q0 33 -23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5t56.5 23.5t23.5 56.5zM672 288v704q0 13 -9.5 22.5t-22.5 9.5h-512q-13 0 -22.5 -9.5t-9.5 -22.5v-704q0 -13 9.5 -22.5t22.5 -9.5h512q13 0 22.5 9.5t9.5 22.5zM480 1136 q0 16 -16 16h-160q-16 0 -16 -16t16 -16h160q16 0 16 16zM768 1152v-1024q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v1024q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
|
||||
<glyph unicode="" d="M768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103 t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M768 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z M1664 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M768 1216v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136zM1664 1216 v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136z" />
|
||||
<glyph unicode="" horiz-adv-x="1568" d="M496 192q0 -60 -42.5 -102t-101.5 -42q-60 0 -102 42t-42 102t42 102t102 42q59 0 101.5 -42t42.5 -102zM928 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM320 640q0 -66 -47 -113t-113 -47t-113 47t-47 113 t47 113t113 47t113 -47t47 -113zM1360 192q0 -46 -33 -79t-79 -33t-79 33t-33 79t33 79t79 33t79 -33t33 -79zM528 1088q0 -73 -51.5 -124.5t-124.5 -51.5t-124.5 51.5t-51.5 124.5t51.5 124.5t124.5 51.5t124.5 -51.5t51.5 -124.5zM992 1280q0 -80 -56 -136t-136 -56 t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1536 640q0 -40 -28 -68t-68 -28t-68 28t-28 68t28 68t68 28t68 -28t28 -68zM1328 1088q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5z" />
|
||||
<glyph unicode="" d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 416q0 -166 -127 -451q-3 -7 -10.5 -24t-13.5 -30t-13 -22q-12 -17 -28 -17q-15 0 -23.5 10t-8.5 25q0 9 2.5 26.5t2.5 23.5q5 68 5 123q0 101 -17.5 181t-48.5 138.5t-80 101t-105.5 69.5t-133 42.5t-154 21.5t-175.5 6h-224v-256q0 -26 -19 -45t-45 -19t-45 19 l-512 512q-19 19 -19 45t19 45l512 512q19 19 45 19t45 -19t19 -45v-256h224q713 0 875 -403q53 -134 53 -333z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M640 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1280 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1440 320 q0 120 -69 204t-187 84q-41 0 -195 -21q-71 -11 -157 -11t-157 11q-152 21 -195 21q-118 0 -187 -84t-69 -204q0 -88 32 -153.5t81 -103t122 -60t140 -29.5t149 -7h168q82 0 149 7t140 29.5t122 60t81 103t32 153.5zM1664 496q0 -207 -61 -331q-38 -77 -105.5 -133t-141 -86 t-170 -47.5t-171.5 -22t-167 -4.5q-78 0 -142 3t-147.5 12.5t-152.5 30t-137 51.5t-121 81t-86 115q-62 123 -62 331q0 237 136 396q-27 82 -27 170q0 116 51 218q108 0 190 -39.5t189 -123.5q147 35 309 35q148 0 280 -32q105 82 187 121t189 39q51 -102 51 -218 q0 -87 -27 -168q136 -160 136 -398z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1536 224v704q0 40 -28 68t-68 28h-704q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68v-960q0 -40 28 -68t68 -28h1216q40 0 68 28t28 68zM1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320 q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1781 605q0 35 -53 35h-1088q-40 0 -85.5 -21.5t-71.5 -52.5l-294 -363q-18 -24 -18 -40q0 -35 53 -35h1088q40 0 86 22t71 53l294 363q18 22 18 39zM640 768h768v160q0 40 -28 68t-68 28h-576q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68 v-853l256 315q44 53 116 87.5t140 34.5zM1909 605q0 -62 -46 -120l-295 -363q-43 -53 -116 -87.5t-140 -34.5h-1088q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158v-160h192q54 0 99 -24.5t67 -70.5q15 -32 15 -68z " />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M896 608v-64q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v224q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-224h224q14 0 23 -9t9 -23zM1024 224v704q0 40 -28 68t-68 28h-704q-40 0 -68 -28 t-28 -68v-704q0 -40 28 -68t68 -28h704q40 0 68 28t28 68zM1152 928v-704q0 -92 -65.5 -158t-158.5 -66h-704q-93 0 -158.5 66t-65.5 158v704q0 93 65.5 158.5t158.5 65.5h704q93 0 158.5 -65.5t65.5 -158.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M928 1152q93 0 158.5 -65.5t65.5 -158.5v-704q0 -92 -65.5 -158t-158.5 -66h-704q-93 0 -158.5 66t-65.5 158v704q0 93 65.5 158.5t158.5 65.5h704zM1024 224v704q0 40 -28 68t-68 28h-704q-40 0 -68 -28t-28 -68v-704q0 -40 28 -68t68 -28h704q40 0 68 28t28 68z M864 640q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576z" />
|
||||
<glyph unicode="" d="M1134 461q-37 -121 -138 -195t-228 -74t-228 74t-138 195q-8 25 4 48.5t38 31.5q25 8 48.5 -4t31.5 -38q25 -80 92.5 -129.5t151.5 -49.5t151.5 49.5t92.5 129.5q8 26 32 38t49 4t37 -31.5t4 -48.5zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5 t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5 t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1134 307q8 -25 -4 -48.5t-37 -31.5t-49 4t-32 38q-25 80 -92.5 129.5t-151.5 49.5t-151.5 -49.5t-92.5 -129.5q-8 -26 -31.5 -38t-48.5 -4q-26 8 -38 31.5t-4 48.5q37 121 138 195t228 74t228 -74t138 -195zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204 t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1152 448q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h640q26 0 45 -19t19 -45zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M832 448v128q0 14 -9 23t-23 9h-192v192q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-192h-192q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h192v-192q0 -14 9 -23t23 -9h128q14 0 23 9t9 23v192h192q14 0 23 9t9 23zM1408 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5 t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1920 512q0 -212 -150 -362t-362 -150q-192 0 -338 128h-220q-146 -128 -338 -128q-212 0 -362 150 t-150 362t150 362t362 150h896q212 0 362 -150t150 -362z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M384 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM512 624v-96q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h224q16 0 16 -16zM384 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 368v-96q0 -16 -16 -16 h-864q-16 0 -16 16v96q0 16 16 16h864q16 0 16 -16zM768 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM640 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1024 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16 h96q16 0 16 -16zM896 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1280 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1152 880v-96 q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 880v-352q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h112v240q0 16 16 16h96q16 0 16 -16zM1792 128v896h-1664v-896 h1664zM1920 1024v-896q0 -53 -37.5 -90.5t-90.5 -37.5h-1664q-53 0 -90.5 37.5t-37.5 90.5v896q0 53 37.5 90.5t90.5 37.5h1664q53 0 90.5 -37.5t37.5 -90.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1664 491v616q-169 -91 -306 -91q-82 0 -145 32q-100 49 -184 76.5t-178 27.5q-173 0 -403 -127v-599q245 113 433 113q55 0 103.5 -7.5t98 -26t77 -31t82.5 -39.5l28 -14q44 -22 101 -22q120 0 293 92zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9 h-64q-14 0 -23 9t-9 23v1266q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102 q-15 -9 -33 -9q-16 0 -32 8q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M832 536v192q-181 -16 -384 -117v-185q205 96 384 110zM832 954v197q-172 -8 -384 -126v-189q215 111 384 118zM1664 491v184q-235 -116 -384 -71v224q-20 6 -39 15q-5 3 -33 17t-34.5 17t-31.5 15t-34.5 15.5t-32.5 13t-36 12.5t-35 8.5t-39.5 7.5t-39.5 4t-44 2 q-23 0 -49 -3v-222h19q102 0 192.5 -29t197.5 -82q19 -9 39 -15v-188q42 -17 91 -17q120 0 293 92zM1664 918v189q-169 -91 -306 -91q-45 0 -78 8v-196q148 -42 384 90zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v1266 q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102q-15 -9 -33 -9q-16 0 -32 8 q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M585 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23zM1664 96v-64q0 -14 -9 -23t-23 -9h-960q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h960q14 0 23 -9 t9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M617 137l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23zM1208 1204l-373 -1291q-4 -13 -15.5 -19.5t-23.5 -2.5l-62 17q-13 4 -19.5 15.5t-2.5 24.5 l373 1291q4 13 15.5 19.5t23.5 2.5l62 -17q13 -4 19.5 -15.5t2.5 -24.5zM1865 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M640 454v-70q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-69l-397 -398q-19 -19 -19 -45t19 -45zM1792 416q0 -58 -17 -133.5t-38.5 -138t-48 -125t-40.5 -90.5l-20 -40q-8 -17 -28 -17q-6 0 -9 1 q-25 8 -23 34q43 400 -106 565q-64 71 -170.5 110.5t-267.5 52.5v-251q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-262q411 -28 599 -221q169 -173 169 -509z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1186 579l257 250l-356 52l-66 10l-30 60l-159 322v-963l59 -31l318 -168l-60 355l-12 66zM1638 841l-363 -354l86 -500q5 -33 -6 -51.5t-34 -18.5q-17 0 -40 12l-449 236l-449 -236q-23 -12 -40 -12q-23 0 -34 18.5t-6 51.5l86 500l-364 354q-32 32 -23 59.5t54 34.5 l502 73l225 455q20 41 49 41q28 0 49 -41l225 -455l502 -73q45 -7 54 -34.5t-24 -59.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1401 1187l-640 -1280q-17 -35 -57 -35q-5 0 -15 2q-22 5 -35.5 22.5t-13.5 39.5v576h-576q-22 0 -39.5 13.5t-22.5 35.5t4 42t29 30l1280 640q13 7 29 7q27 0 45 -19q15 -14 18.5 -34.5t-6.5 -39.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M557 256h595v595zM512 301l595 595h-595v-595zM1664 224v-192q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v224h-864q-14 0 -23 9t-9 23v864h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224v224q0 14 9 23t23 9h192q14 0 23 -9t9 -23 v-224h851l246 247q10 9 23 9t23 -9q9 -10 9 -23t-9 -23l-247 -246v-851h224q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M288 64q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM288 1216q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM928 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1024 1088q0 -52 -26 -96.5t-70 -69.5 q-2 -287 -226 -414q-68 -38 -203 -81q-128 -40 -169.5 -71t-41.5 -100v-26q44 -25 70 -69.5t26 -96.5q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 52 26 96.5t70 69.5v820q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136q0 -52 -26 -96.5t-70 -69.5v-497 q54 26 154 57q55 17 87.5 29.5t70.5 31t59 39.5t40.5 51t28 69.5t8.5 91.5q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M439 265l-256 -256q-10 -9 -23 -9q-12 0 -23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23zM608 224v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM384 448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23t9 23t23 9h320 q14 0 23 -9t9 -23zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-334 335q-21 21 -42 56l239 18l273 -274q27 -27 68 -27.5t68 26.5l147 146q28 28 28 67q0 40 -28 68l-274 275l18 239q35 -21 56 -42l336 -336q84 -86 84 -204zM1031 1044l-239 -18 l-273 274q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l274 -274l-18 -240q-35 21 -56 42l-336 336q-84 86 -84 204q0 120 85 203l147 146q83 83 203 83q121 0 204 -85l334 -335q21 -21 42 -56zM1664 960q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9 t-9 23t9 23t23 9h320q14 0 23 -9t9 -23zM1120 1504v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM1527 1353l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M704 280v-240q0 -16 -12 -28t-28 -12h-240q-16 0 -28 12t-12 28v240q0 16 12 28t28 12h240q16 0 28 -12t12 -28zM1020 880q0 -54 -15.5 -101t-35 -76.5t-55 -59.5t-57.5 -43.5t-61 -35.5q-41 -23 -68.5 -65t-27.5 -67q0 -17 -12 -32.5t-28 -15.5h-240q-15 0 -25.5 18.5 t-10.5 37.5v45q0 83 65 156.5t143 108.5q59 27 84 56t25 76q0 42 -46.5 74t-107.5 32q-65 0 -108 -29q-35 -25 -107 -115q-13 -16 -31 -16q-12 0 -25 8l-164 125q-13 10 -15.5 25t5.5 28q160 266 464 266q80 0 161 -31t146 -83t106 -127.5t41 -158.5z" />
|
||||
<glyph unicode="" horiz-adv-x="640" d="M640 192v-128q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64v384h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-576h64q26 0 45 -19t19 -45zM512 1344v-192q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v192 q0 26 19 45t45 19h256q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="640" d="M512 288v-224q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v224q0 26 19 45t45 19h256q26 0 45 -19t19 -45zM542 1344l-28 -768q-1 -26 -20.5 -45t-45.5 -19h-256q-26 0 -45.5 19t-20.5 45l-28 768q-1 26 17.5 45t44.5 19h320q26 0 44.5 -19t17.5 -45z" />
|
||||
<glyph unicode="" d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3l-9 -21q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109zM1534 846v-206h-514l-3 27 q-4 28 -4 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q83 65 188 65q110 0 178 -59.5t68 -158.5q0 -56 -24.5 -103t-62 -76.5t-81.5 -58.5t-82 -50.5t-65.5 -51.5t-30.5 -63h232v80 h126z" />
|
||||
<glyph unicode="" d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3l-9 -21q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109zM1536 -50v-206h-514l-4 27 q-3 45 -3 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q80 65 188 65q110 0 178 -59.5t68 -158.5q0 -66 -34.5 -118.5t-84 -86t-99.5 -62.5t-87 -63t-41 -73h232v80h126z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M896 128l336 384h-768l-336 -384h768zM1909 1205q15 -34 9.5 -71.5t-30.5 -65.5l-896 -1024q-38 -44 -96 -44h-768q-38 0 -69.5 20.5t-47.5 54.5q-15 34 -9.5 71.5t30.5 65.5l896 1024q38 44 96 44h768q38 0 69.5 -20.5t47.5 -54.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1664 438q0 -81 -44.5 -135t-123.5 -54q-41 0 -77.5 17.5t-59 38t-56.5 38t-71 17.5q-110 0 -110 -124q0 -39 16 -115t15 -115v-5q-22 0 -33 -1q-34 -3 -97.5 -11.5t-115.5 -13.5t-98 -5q-61 0 -103 26.5t-42 83.5q0 37 17.5 71t38 56.5t38 59t17.5 77.5q0 79 -54 123.5 t-135 44.5q-84 0 -143 -45.5t-59 -127.5q0 -43 15 -83t33.5 -64.5t33.5 -53t15 -50.5q0 -45 -46 -89q-37 -35 -117 -35q-95 0 -245 24q-9 2 -27.5 4t-27.5 4l-13 2q-1 0 -3 1q-2 0 -2 1v1024q2 -1 17.5 -3.5t34 -5t21.5 -3.5q150 -24 245 -24q80 0 117 35q46 44 46 89 q0 22 -15 50.5t-33.5 53t-33.5 64.5t-15 83q0 82 59 127.5t144 45.5q80 0 134 -44.5t54 -123.5q0 -41 -17.5 -77.5t-38 -59t-38 -56.5t-17.5 -71q0 -57 42 -83.5t103 -26.5q64 0 180 15t163 17v-2q-1 -2 -3.5 -17.5t-5 -34t-3.5 -21.5q-24 -150 -24 -245q0 -80 35 -117 q44 -46 89 -46q22 0 50.5 15t53 33.5t64.5 33.5t83 15q82 0 127.5 -59t45.5 -143z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M1152 832v-128q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-217 24 -364.5 187.5t-147.5 384.5v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -185 131.5 -316.5t316.5 -131.5 t316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45zM896 1216v-512q0 -132 -94 -226t-226 -94t-226 94t-94 226v512q0 132 94 226t226 94t226 -94t94 -226z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M271 591l-101 -101q-42 103 -42 214v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -53 15 -113zM1385 1193l-361 -361v-128q0 -132 -94 -226t-226 -94q-55 0 -109 19l-96 -96q97 -51 205 -51q185 0 316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45v-128 q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-125 13 -235 81l-254 -254q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l1234 1234q10 10 23 10t23 -10l82 -82q10 -10 10 -23 t-10 -23zM1005 1325l-621 -621v512q0 132 94 226t226 94q102 0 184.5 -59t116.5 -152z" />
|
||||
<glyph unicode="" horiz-adv-x="1280" d="M1088 576v640h-448v-1137q119 63 213 137q235 184 235 360zM1280 1344v-768q0 -86 -33.5 -170.5t-83 -150t-118 -127.5t-126.5 -103t-121 -77.5t-89.5 -49.5t-42.5 -20q-12 -6 -26 -6t-26 6q-16 7 -42.5 20t-89.5 49.5t-121 77.5t-126.5 103t-118 127.5t-83 150 t-33.5 170.5v768q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280 q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M512 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 1376v-320q0 -16 -12 -25q-8 -7 -20 -7q-4 0 -7 1l-448 96q-11 2 -18 11t-7 20h-256v-102q111 -23 183.5 -111t72.5 -203v-800q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v800 q0 106 62.5 190.5t161.5 114.5v111h-32q-59 0 -115 -23.5t-91.5 -53t-66 -66.5t-40.5 -53.5t-14 -24.5q-17 -35 -57 -35q-16 0 -29 7q-23 12 -31.5 37t3.5 49q5 10 14.5 26t37.5 53.5t60.5 70t85 67t108.5 52.5q-25 42 -25 86q0 66 47 113t113 47t113 -47t47 -113 q0 -33 -14 -64h302q0 11 7 20t18 11l448 96q3 1 7 1q12 0 20 -7q12 -9 12 -25z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1440 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1664 1376q0 -249 -75.5 -430.5t-253.5 -360.5q-81 -80 -195 -176l-20 -379q-2 -16 -16 -26l-384 -224q-7 -4 -16 -4q-12 0 -23 9l-64 64q-13 14 -8 32l85 276l-281 281l-276 -85q-3 -1 -9 -1 q-14 0 -23 9l-64 64q-17 19 -5 39l224 384q10 14 26 16l379 20q96 114 176 195q188 187 358 258t431 71q14 0 24 -9.5t10 -22.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1708 881l-188 -881h-304l181 849q4 21 1 43q-4 20 -16 35q-10 14 -28 24q-18 9 -40 9h-197l-205 -960h-303l204 960h-304l-205 -960h-304l272 1280h1139q157 0 245 -118q86 -116 52 -281z" />
|
||||
<glyph unicode="" d="M909 141l102 102q19 19 19 45t-19 45l-307 307l307 307q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M717 141l454 454q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l307 -307l-307 -307q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1165 397l102 102q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l307 307l307 -307q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M813 237l454 454q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-307 -307l-307 307q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1130 939l16 175h-884l47 -534h612l-22 -228l-197 -53l-196 53l-13 140h-175l22 -278l362 -100h4v1l359 99l50 544h-644l-15 181h674zM0 1408h1408l-128 -1438l-578 -162l-574 162z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M275 1408h1505l-266 -1333l-804 -267l-698 267l71 356h297l-29 -147l422 -161l486 161l68 339h-1208l58 297h1209l38 191h-1208z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M960 1280q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1792 352v-352q0 -22 -20 -30q-8 -2 -12 -2q-13 0 -23 9l-93 93q-119 -143 -318.5 -226.5t-429.5 -83.5t-429.5 83.5t-318.5 226.5l-93 -93q-9 -9 -23 -9q-4 0 -12 2q-20 8 -20 30v352 q0 14 9 23t23 9h352q22 0 30 -20q8 -19 -7 -35l-100 -100q67 -91 189.5 -153.5t271.5 -82.5v647h-192q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h192v163q-58 34 -93 92.5t-35 128.5q0 106 75 181t181 75t181 -75t75 -181q0 -70 -35 -128.5t-93 -92.5v-163h192q26 0 45 -19 t19 -45v-128q0 -26 -19 -45t-45 -19h-192v-647q149 20 271.5 82.5t189.5 153.5l-100 100q-15 16 -7 35q8 20 30 20h352q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1152" d="M1056 768q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v320q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45q0 106 -75 181t-181 75t-181 -75t-75 -181 v-320h736z" />
|
||||
<glyph unicode="" d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM1152 640q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1280 640q0 -212 -150 -362t-362 -150t-362 150 t-150 362t150 362t362 150t362 -150t150 -362zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM896 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM1408 800v-192q0 -40 -28 -68t-68 -28h-192 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="384" d="M384 288v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 1312v-192q0 -40 -28 -68t-68 -28h-192 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
|
||||
<glyph unicode="" d="M512 256q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM863 162q-13 232 -177 396t-396 177q-14 1 -24 -9t-10 -23v-128q0 -13 8.5 -22t21.5 -10q154 -11 264 -121t121 -264q1 -13 10 -21.5t22 -8.5h128q13 0 23 10 t9 24zM1247 161q-5 154 -56 297.5t-139.5 260t-205 205t-260 139.5t-297.5 56q-14 1 -23 -9q-10 -10 -10 -23v-128q0 -13 9 -22t22 -10q204 -7 378 -111.5t278.5 -278.5t111.5 -378q1 -13 10 -22t22 -9h128q13 0 23 10q11 9 9 23zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1152 585q32 18 32 55t-32 55l-544 320q-31 19 -64 1q-32 -19 -32 -56v-640q0 -37 32 -56 q16 -8 32 -8q17 0 32 9z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1024 1084l316 -316l-572 -572l-316 316zM813 105l618 618q19 19 19 45t-19 45l-362 362q-18 18 -45 18t-45 -18l-618 -618q-19 -19 -19 -45t19 -45l362 -362q18 -18 45 -18t45 18zM1702 742l-907 -908q-37 -37 -90.5 -37t-90.5 37l-126 126q56 56 56 136t-56 136 t-136 56t-136 -56l-125 126q-37 37 -37 90.5t37 90.5l907 906q37 37 90.5 37t90.5 -37l125 -125q-56 -56 -56 -136t56 -136t136 -56t136 56l126 -125q37 -37 37 -90.5t-37 -90.5z" />
|
||||
<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h896q26 0 45 19t19 45zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5 t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1152 736v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h832q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5 t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M1018 933q-18 -37 -58 -37h-192v-864q0 -14 -9 -23t-23 -9h-704q-21 0 -29 18q-8 20 4 35l160 192q9 11 25 11h320v640h-192q-40 0 -58 37q-17 37 9 68l320 384q18 22 49 22t49 -22l320 -384q27 -32 9 -68z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M32 1280h704q13 0 22.5 -9.5t9.5 -23.5v-863h192q40 0 58 -37t-9 -69l-320 -384q-18 -22 -49 -22t-49 22l-320 384q-26 31 -9 69q18 37 58 37h192v640h-320q-14 0 -25 11l-160 192q-13 14 -4 34q9 19 29 19z" />
|
||||
<glyph unicode="" d="M685 237l614 614q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-467 -467l-211 211q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l358 -358q19 -19 45 -19t45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5 t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M404 428l152 -152l-52 -52h-56v96h-96v56zM818 818q14 -13 -3 -30l-291 -291q-17 -17 -30 -3q-14 13 3 30l291 291q17 17 30 3zM544 128l544 544l-288 288l-544 -544v-288h288zM1152 736l92 92q28 28 28 68t-28 68l-152 152q-28 28 -68 28t-68 -28l-92 -92zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M1280 608v480q0 26 -19 45t-45 19h-480q-42 0 -59 -39q-17 -41 14 -70l144 -144l-534 -534q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l534 534l144 -144q18 -19 45 -19q12 0 25 5q39 17 39 59zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M1005 435l352 352q19 19 19 45t-19 45l-352 352q-30 31 -69 14q-40 -17 -40 -59v-160q-119 0 -216 -19.5t-162.5 -51t-114 -79t-76.5 -95.5t-44.5 -109t-21.5 -111.5t-5 -110.5q0 -181 167 -404q10 -12 25 -12q7 0 13 3q22 9 19 33q-44 354 62 473q46 52 130 75.5 t224 23.5v-160q0 -42 40 -59q12 -5 24 -5q26 0 45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M640 448l256 128l-256 128v-256zM1024 1039v-542l-512 -256v542zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1145 861q18 -35 -5 -66l-320 -448q-19 -27 -52 -27t-52 27l-320 448q-23 31 -5 66q17 35 57 35h640q40 0 57 -35zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M1145 419q-17 -35 -57 -35h-640q-40 0 -57 35q-18 35 5 66l320 448q19 27 52 27t52 -27l320 -448q23 -31 5 -66zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M1088 640q0 -33 -27 -52l-448 -320q-31 -23 -66 -5q-35 17 -35 57v640q0 40 35 57q35 18 66 -5l448 -320q27 -19 27 -52zM1280 160v960q0 14 -9 23t-23 9h-960q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h960q14 0 23 9t9 23zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M976 229l35 -159q3 -12 -3 -22.5t-17 -14.5l-5 -1q-4 -2 -10.5 -3.5t-16 -4.5t-21.5 -5.5t-25.5 -5t-30 -5t-33.5 -4.5t-36.5 -3t-38.5 -1q-234 0 -409 130.5t-238 351.5h-95q-13 0 -22.5 9.5t-9.5 22.5v113q0 13 9.5 22.5t22.5 9.5h66q-2 57 1 105h-67q-14 0 -23 9 t-9 23v114q0 14 9 23t23 9h98q67 210 243.5 338t400.5 128q102 0 194 -23q11 -3 20 -15q6 -11 3 -24l-43 -159q-3 -13 -14 -19.5t-24 -2.5l-4 1q-4 1 -11.5 2.5l-17.5 3.5t-22.5 3.5t-26 3t-29 2.5t-29.5 1q-126 0 -226 -64t-150 -176h468q16 0 25 -12q10 -12 7 -26 l-24 -114q-5 -26 -32 -26h-488q-3 -37 0 -105h459q15 0 25 -12q9 -12 6 -27l-24 -112q-2 -11 -11 -18.5t-20 -7.5h-387q48 -117 149.5 -185.5t228.5 -68.5q18 0 36 1.5t33.5 3.5t29.5 4.5t24.5 5t18.5 4.5l12 3l5 2q13 5 26 -2q12 -7 15 -21z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M1020 399v-367q0 -14 -9 -23t-23 -9h-956q-14 0 -23 9t-9 23v150q0 13 9.5 22.5t22.5 9.5h97v383h-95q-14 0 -23 9.5t-9 22.5v131q0 14 9 23t23 9h95v223q0 171 123.5 282t314.5 111q185 0 335 -125q9 -8 10 -20.5t-7 -22.5l-103 -127q-9 -11 -22 -12q-13 -2 -23 7 q-5 5 -26 19t-69 32t-93 18q-85 0 -137 -47t-52 -123v-215h305q13 0 22.5 -9t9.5 -23v-131q0 -13 -9.5 -22.5t-22.5 -9.5h-305v-379h414v181q0 13 9 22.5t23 9.5h162q14 0 23 -9.5t9 -22.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M978 351q0 -153 -99.5 -263.5t-258.5 -136.5v-175q0 -14 -9 -23t-23 -9h-135q-13 0 -22.5 9.5t-9.5 22.5v175q-66 9 -127.5 31t-101.5 44.5t-74 48t-46.5 37.5t-17.5 18q-17 21 -2 41l103 135q7 10 23 12q15 2 24 -9l2 -2q113 -99 243 -125q37 -8 74 -8q81 0 142.5 43 t61.5 122q0 28 -15 53t-33.5 42t-58.5 37.5t-66 32t-80 32.5q-39 16 -61.5 25t-61.5 26.5t-62.5 31t-56.5 35.5t-53.5 42.5t-43.5 49t-35.5 58t-21 66.5t-8.5 78q0 138 98 242t255 134v180q0 13 9.5 22.5t22.5 9.5h135q14 0 23 -9t9 -23v-176q57 -6 110.5 -23t87 -33.5 t63.5 -37.5t39 -29t15 -14q17 -18 5 -38l-81 -146q-8 -15 -23 -16q-14 -3 -27 7q-3 3 -14.5 12t-39 26.5t-58.5 32t-74.5 26t-85.5 11.5q-95 0 -155 -43t-60 -111q0 -26 8.5 -48t29.5 -41.5t39.5 -33t56 -31t60.5 -27t70 -27.5q53 -20 81 -31.5t76 -35t75.5 -42.5t62 -50 t53 -63.5t31.5 -76.5t13 -94z" />
|
||||
<glyph unicode="" horiz-adv-x="898" d="M898 1066v-102q0 -14 -9 -23t-23 -9h-168q-23 -144 -129 -234t-276 -110q167 -178 459 -536q14 -16 4 -34q-8 -18 -29 -18h-195q-16 0 -25 12q-306 367 -498 571q-9 9 -9 22v127q0 13 9.5 22.5t22.5 9.5h112q132 0 212.5 43t102.5 125h-427q-14 0 -23 9t-9 23v102 q0 14 9 23t23 9h413q-57 113 -268 113h-145q-13 0 -22.5 9.5t-9.5 22.5v133q0 14 9 23t23 9h832q14 0 23 -9t9 -23v-102q0 -14 -9 -23t-23 -9h-233q47 -61 64 -144h171q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1027" d="M603 0h-172q-13 0 -22.5 9t-9.5 23v330h-288q-13 0 -22.5 9t-9.5 23v103q0 13 9.5 22.5t22.5 9.5h288v85h-288q-13 0 -22.5 9t-9.5 23v104q0 13 9.5 22.5t22.5 9.5h214l-321 578q-8 16 0 32q10 16 28 16h194q19 0 29 -18l215 -425q19 -38 56 -125q10 24 30.5 68t27.5 61 l191 420q8 19 29 19h191q17 0 27 -16q9 -14 1 -31l-313 -579h215q13 0 22.5 -9.5t9.5 -22.5v-104q0 -14 -9.5 -23t-22.5 -9h-290v-85h290q13 0 22.5 -9.5t9.5 -22.5v-103q0 -14 -9.5 -23t-22.5 -9h-290v-330q0 -13 -9.5 -22.5t-22.5 -9.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1664 352v-32q0 -132 -94 -226t-226 -94h-128q-132 0 -226 94t-94 226v480h-224q-2 -102 -14.5 -190.5t-30.5 -156t-48.5 -126.5t-57 -99.5t-67.5 -77.5t-69.5 -58.5t-74 -44t-69 -32t-65.5 -25.5q-4 -2 -32 -13q-8 -2 -12 -2q-22 0 -30 20l-71 178q-5 13 0 25t17 17 q7 3 20 7.5t18 6.5q31 12 46.5 18.5t44.5 20t45.5 26t42 32.5t40.5 42.5t34.5 53.5t30.5 68.5t22.5 83.5t17 103t6.5 123h-256q-14 0 -23 9t-9 23v160q0 14 9 23t23 9h1216q14 0 23 -9t9 -23v-160q0 -14 -9 -23t-23 -9h-224v-512q0 -26 19 -45t45 -19h128q26 0 45 19t19 45 v64q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1280 1376v-160q0 -14 -9 -23t-23 -9h-960q-14 0 -23 9t-9 23v160q0 14 9 23t23 9h960q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M514 341l81 299h-159l75 -300q1 -1 1 -3t1 -3q0 1 0.5 3.5t0.5 3.5zM630 768l35 128h-292l32 -128h225zM822 768h139l-35 128h-70zM1271 340l78 300h-162l81 -299q0 -1 0.5 -3.5t1.5 -3.5q0 1 0.5 3t0.5 3zM1382 768l33 128h-297l34 -128h230zM1792 736v-64q0 -14 -9 -23 t-23 -9h-213l-164 -616q-7 -24 -31 -24h-159q-24 0 -31 24l-166 616h-209l-167 -616q-7 -24 -31 -24h-159q-11 0 -19.5 7t-10.5 17l-160 616h-208q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h175l-33 128h-142q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h109l-89 344q-5 15 5 28 q10 12 26 12h137q26 0 31 -24l90 -360h359l97 360q7 24 31 24h126q24 0 31 -24l98 -360h365l93 360q5 24 31 24h137q16 0 26 -12q10 -13 5 -28l-91 -344h111q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-145l-34 -128h179q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1280" d="M1167 896q18 -182 -131 -258q117 -28 175 -103t45 -214q-7 -71 -32.5 -125t-64.5 -89t-97 -58.5t-121.5 -34.5t-145.5 -15v-255h-154v251q-80 0 -122 1v-252h-154v255q-18 0 -54 0.5t-55 0.5h-200l31 183h111q50 0 58 51v402h16q-6 1 -16 1v287q-13 68 -89 68h-111v164 l212 -1q64 0 97 1v252h154v-247q82 2 122 2v245h154v-252q79 -7 140 -22.5t113 -45t82.5 -78t36.5 -114.5zM952 351q0 36 -15 64t-37 46t-57.5 30.5t-65.5 18.5t-74 9t-69 3t-64.5 -1t-47.5 -1v-338q8 0 37 -0.5t48 -0.5t53 1.5t58.5 4t57 8.5t55.5 14t47.5 21t39.5 30 t24.5 40t9.5 51zM881 827q0 33 -12.5 58.5t-30.5 42t-48 28t-55 16.5t-61.5 8t-58 2.5t-54 -1t-39.5 -0.5v-307q5 0 34.5 -0.5t46.5 0t50 2t55 5.5t51.5 11t48.5 18.5t37 27t27 38.5t9 51z" />
|
||||
<glyph unicode="" horiz-adv-x="1280" d="M1280 768v-800q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h544v-544q0 -40 28 -68t68 -28h544zM1277 896h-509v509q82 -15 132 -65l312 -312q50 -50 65 -132z" />
|
||||
<glyph unicode="" horiz-adv-x="1280" d="M1024 160v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1024 416v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1280 768v-800q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28 t-28 68v1344q0 40 28 68t68 28h544v-544q0 -40 28 -68t68 -28h544zM1277 896h-509v509q82 -15 132 -65l312 -312q50 -50 65 -132z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1191 1128h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1572 -23 v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -11v-2l14 2q9 2 30 2h248v119h121zM1661 874v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162 l230 -662h70z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1191 104h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1661 -150 v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162l230 -662h70zM1572 1001v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -10v-3l14 3q9 1 30 1h248 v119h121z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1792 -32v-192q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832 q14 0 23 -9t9 -23zM1600 480v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1408 992v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1216 1504v-192q0 -14 -9 -23t-23 -9h-256 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1216 -32v-192q0 -14 -9 -23t-23 -9h-256q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192 q14 0 23 -9t9 -23zM1408 480v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1600 992v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1792 1504v-192q0 -14 -9 -23t-23 -9h-832 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" d="M1346 223q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23 zM1486 165q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5 t82 -252.5zM1456 882v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165z" />
|
||||
<glyph unicode="" d="M1346 1247q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9 t9 -23zM1456 -142v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165zM1486 1189q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13 q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5t82 -252.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M256 192q0 26 -19 45t-45 19q-27 0 -45.5 -19t-18.5 -45q0 -27 18.5 -45.5t45.5 -18.5q26 0 45 18.5t19 45.5zM416 704v-640q0 -26 -19 -45t-45 -19h-288q-26 0 -45 19t-19 45v640q0 26 19 45t45 19h288q26 0 45 -19t19 -45zM1600 704q0 -86 -55 -149q15 -44 15 -76 q3 -76 -43 -137q17 -56 0 -117q-15 -57 -54 -94q9 -112 -49 -181q-64 -76 -197 -78h-36h-76h-17q-66 0 -144 15.5t-121.5 29t-120.5 39.5q-123 43 -158 44q-26 1 -45 19.5t-19 44.5v641q0 25 18 43.5t43 20.5q24 2 76 59t101 121q68 87 101 120q18 18 31 48t17.5 48.5 t13.5 60.5q7 39 12.5 61t19.5 52t34 50q19 19 45 19q46 0 82.5 -10.5t60 -26t40 -40.5t24 -45t12 -50t5 -45t0.5 -39q0 -38 -9.5 -76t-19 -60t-27.5 -56q-3 -6 -10 -18t-11 -22t-8 -24h277q78 0 135 -57t57 -135z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M256 960q0 -26 -19 -45t-45 -19q-27 0 -45.5 19t-18.5 45q0 27 18.5 45.5t45.5 18.5q26 0 45 -18.5t19 -45.5zM416 448v640q0 26 -19 45t-45 19h-288q-26 0 -45 -19t-19 -45v-640q0 -26 19 -45t45 -19h288q26 0 45 19t19 45zM1545 597q55 -61 55 -149q-1 -78 -57.5 -135 t-134.5 -57h-277q4 -14 8 -24t11 -22t10 -18q18 -37 27 -57t19 -58.5t10 -76.5q0 -24 -0.5 -39t-5 -45t-12 -50t-24 -45t-40 -40.5t-60 -26t-82.5 -10.5q-26 0 -45 19q-20 20 -34 50t-19.5 52t-12.5 61q-9 42 -13.5 60.5t-17.5 48.5t-31 48q-33 33 -101 120q-49 64 -101 121 t-76 59q-25 2 -43 20.5t-18 43.5v641q0 26 19 44.5t45 19.5q35 1 158 44q77 26 120.5 39.5t121.5 29t144 15.5h17h76h36q133 -2 197 -78q58 -69 49 -181q39 -37 54 -94q17 -61 0 -117q46 -61 43 -137q0 -32 -15 -76z" />
|
||||
<glyph unicode="" d="M919 233v157q0 50 -29 50q-17 0 -33 -16v-224q16 -16 33 -16q29 0 29 49zM1103 355h66v34q0 51 -33 51t-33 -51v-34zM532 621v-70h-80v-423h-74v423h-78v70h232zM733 495v-367h-67v40q-39 -45 -76 -45q-33 0 -42 28q-6 16 -6 54v290h66v-270q0 -24 1 -26q1 -15 15 -15 q20 0 42 31v280h67zM985 384v-146q0 -52 -7 -73q-12 -42 -53 -42q-35 0 -68 41v-36h-67v493h67v-161q32 40 68 40q41 0 53 -42q7 -21 7 -74zM1236 255v-9q0 -29 -2 -43q-3 -22 -15 -40q-27 -40 -80 -40q-52 0 -81 38q-21 27 -21 86v129q0 59 20 86q29 38 80 38t78 -38 q21 -28 21 -86v-76h-133v-65q0 -51 34 -51q24 0 30 26q0 1 0.5 7t0.5 16.5v21.5h68zM785 1079v-156q0 -51 -32 -51t-32 51v156q0 52 32 52t32 -52zM1318 366q0 177 -19 260q-10 44 -43 73.5t-76 34.5q-136 15 -412 15q-275 0 -411 -15q-44 -5 -76.5 -34.5t-42.5 -73.5 q-20 -87 -20 -260q0 -176 20 -260q10 -43 42.5 -73t75.5 -35q137 -15 412 -15t412 15q43 5 75.5 35t42.5 73q20 84 20 260zM563 1017l90 296h-75l-51 -195l-53 195h-78l24 -69t23 -69q35 -103 46 -158v-201h74v201zM852 936v130q0 58 -21 87q-29 38 -78 38q-51 0 -78 -38 q-21 -29 -21 -87v-130q0 -58 21 -87q27 -38 78 -38q49 0 78 38q21 27 21 87zM1033 816h67v370h-67v-283q-22 -31 -42 -31q-15 0 -16 16q-1 2 -1 26v272h-67v-293q0 -37 6 -55q11 -27 43 -27q36 0 77 45v-40zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" d="M971 292v-211q0 -67 -39 -67q-23 0 -45 22v301q22 22 45 22q39 0 39 -67zM1309 291v-46h-90v46q0 68 45 68t45 -68zM343 509h107v94h-312v-94h105v-569h100v569zM631 -60h89v494h-89v-378q-30 -42 -57 -42q-18 0 -21 21q-1 3 -1 35v364h-89v-391q0 -49 8 -73 q12 -37 58 -37q48 0 102 61v-54zM1060 88v197q0 73 -9 99q-17 56 -71 56q-50 0 -93 -54v217h-89v-663h89v48q45 -55 93 -55q54 0 71 55q9 27 9 100zM1398 98v13h-91q0 -51 -2 -61q-7 -36 -40 -36q-46 0 -46 69v87h179v103q0 79 -27 116q-39 51 -106 51q-68 0 -107 -51 q-28 -37 -28 -116v-173q0 -79 29 -116q39 -51 108 -51q72 0 108 53q18 27 21 54q2 9 2 58zM790 1011v210q0 69 -43 69t-43 -69v-210q0 -70 43 -70t43 70zM1509 260q0 -234 -26 -350q-14 -59 -58 -99t-102 -46q-184 -21 -555 -21t-555 21q-58 6 -102.5 46t-57.5 99 q-26 112 -26 350q0 234 26 350q14 59 58 99t103 47q183 20 554 20t555 -20q58 -7 102.5 -47t57.5 -99q26 -112 26 -350zM511 1536h102l-121 -399v-271h-100v271q-14 74 -61 212q-37 103 -65 187h106l71 -263zM881 1203v-175q0 -81 -28 -118q-37 -51 -106 -51q-67 0 -105 51 q-28 38 -28 118v175q0 80 28 117q38 51 105 51q69 0 106 -51q28 -37 28 -117zM1216 1365v-499h-91v55q-53 -62 -103 -62q-46 0 -59 37q-8 24 -8 75v394h91v-367q0 -33 1 -35q3 -22 21 -22q27 0 57 43v381h91z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M597 869q-10 -18 -257 -456q-27 -46 -65 -46h-239q-21 0 -31 17t0 36l253 448q1 0 0 1l-161 279q-12 22 -1 37q9 15 32 15h239q40 0 66 -45zM1403 1511q11 -16 0 -37l-528 -934v-1l336 -615q11 -20 1 -37q-10 -15 -32 -15h-239q-42 0 -66 45l-339 622q18 32 531 942 q25 45 64 45h241q22 0 31 -15z" />
|
||||
<glyph unicode="" d="M685 771q0 1 -126 222q-21 34 -52 34h-184q-18 0 -26 -11q-7 -12 1 -29l125 -216v-1l-196 -346q-9 -14 0 -28q8 -13 24 -13h185q31 0 50 36zM1309 1268q-7 12 -24 12h-187q-30 0 -49 -35l-411 -729q1 -2 262 -481q20 -35 52 -35h184q18 0 25 12q8 13 -1 28l-260 476v1 l409 723q8 16 0 28zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1280 640q0 37 -30 54l-512 320q-31 20 -65 2q-33 -18 -33 -56v-640q0 -38 33 -56q16 -8 31 -8q20 0 34 10l512 320q30 17 30 54zM1792 640q0 -96 -1 -150t-8.5 -136.5t-22.5 -147.5q-16 -73 -69 -123t-124 -58q-222 -25 -671 -25t-671 25q-71 8 -124.5 58t-69.5 123 q-14 65 -21.5 147.5t-8.5 136.5t-1 150t1 150t8.5 136.5t22.5 147.5q16 73 69 123t124 58q222 25 671 25t671 -25q71 -8 124.5 -58t69.5 -123q14 -65 21.5 -147.5t8.5 -136.5t1 -150z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M402 829l494 -305l-342 -285l-490 319zM1388 274v-108l-490 -293v-1l-1 1l-1 -1v1l-489 293v108l147 -96l342 284v2l1 -1l1 1v-2l343 -284zM554 1418l342 -285l-494 -304l-338 270zM1390 829l338 -271l-489 -319l-343 285zM1239 1418l489 -319l-338 -270l-494 304z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M928 135v-151l-707 -1v151zM1169 481v-701l-1 -35v-1h-1132l-35 1h-1v736h121v-618h928v618h120zM241 393l704 -65l-13 -150l-705 65zM309 709l683 -183l-39 -146l-683 183zM472 1058l609 -360l-77 -130l-609 360zM832 1389l398 -585l-124 -85l-399 584zM1285 1536 l121 -697l-149 -26l-121 697z" />
|
||||
<glyph unicode="" d="M1362 110v648h-135q20 -63 20 -131q0 -126 -64 -232.5t-174 -168.5t-240 -62q-197 0 -337 135.5t-140 327.5q0 68 20 131h-141v-648q0 -26 17.5 -43.5t43.5 -17.5h1069q25 0 43 17.5t18 43.5zM1078 643q0 124 -90.5 211.5t-218.5 87.5q-127 0 -217.5 -87.5t-90.5 -211.5 t90.5 -211.5t217.5 -87.5q128 0 218.5 87.5t90.5 211.5zM1362 1003v165q0 28 -20 48.5t-49 20.5h-174q-29 0 -49 -20.5t-20 -48.5v-165q0 -29 20 -49t49 -20h174q29 0 49 20t20 49zM1536 1211v-1142q0 -81 -58 -139t-139 -58h-1142q-81 0 -139 58t-58 139v1142q0 81 58 139 t139 58h1142q81 0 139 -58t58 -139z" />
|
||||
<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM698 640q0 88 -62 150t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150zM1262 640q0 88 -62 150 t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150z" />
|
||||
<glyph unicode="" d="M768 914l201 -306h-402zM1133 384h94l-459 691l-459 -691h94l104 160h522zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M815 677q8 -63 -50.5 -101t-111.5 -6q-39 17 -53.5 58t-0.5 82t52 58q36 18 72.5 12t64 -35.5t27.5 -67.5zM926 698q-14 107 -113 164t-197 13q-63 -28 -100.5 -88.5t-34.5 -129.5q4 -91 77.5 -155t165.5 -56q91 8 152 84t50 168zM1165 1240q-20 27 -56 44.5t-58 22 t-71 12.5q-291 47 -566 -2q-43 -7 -66 -12t-55 -22t-50 -43q30 -28 76 -45.5t73.5 -22t87.5 -11.5q228 -29 448 -1q63 8 89.5 12t72.5 21.5t75 46.5zM1222 205q-8 -26 -15.5 -76.5t-14 -84t-28.5 -70t-58 -56.5q-86 -48 -189.5 -71.5t-202 -22t-201.5 18.5q-46 8 -81.5 18 t-76.5 27t-73 43.5t-52 61.5q-25 96 -57 292l6 16l18 9q223 -148 506.5 -148t507.5 148q21 -6 24 -23t-5 -45t-8 -37zM1403 1166q-26 -167 -111 -655q-5 -30 -27 -56t-43.5 -40t-54.5 -31q-252 -126 -610 -88q-248 27 -394 139q-15 12 -25.5 26.5t-17 35t-9 34t-6 39.5 t-5.5 35q-9 50 -26.5 150t-28 161.5t-23.5 147.5t-22 158q3 26 17.5 48.5t31.5 37.5t45 30t46 22.5t48 18.5q125 46 313 64q379 37 676 -50q155 -46 215 -122q16 -20 16.5 -51t-5.5 -54z" />
|
||||
<glyph unicode="" d="M848 666q0 43 -41 66t-77 1q-43 -20 -42.5 -72.5t43.5 -70.5q39 -23 81 4t36 72zM928 682q8 -66 -36 -121t-110 -61t-119 40t-56 113q-2 49 25.5 93t72.5 64q70 31 141.5 -10t81.5 -118zM1100 1073q-20 -21 -53.5 -34t-53 -16t-63.5 -8q-155 -20 -324 0q-44 6 -63 9.5 t-52.5 16t-54.5 32.5q13 19 36 31t40 15.5t47 8.5q198 35 408 1q33 -5 51 -8.5t43 -16t39 -31.5zM1142 327q0 7 5.5 26.5t3 32t-17.5 16.5q-161 -106 -365 -106t-366 106l-12 -6l-5 -12q26 -154 41 -210q47 -81 204 -108q249 -46 428 53q34 19 49 51.5t22.5 85.5t12.5 71z M1272 1020q9 53 -8 75q-43 55 -155 88q-216 63 -487 36q-132 -12 -226 -46q-38 -15 -59.5 -25t-47 -34t-29.5 -54q8 -68 19 -138t29 -171t24 -137q1 -5 5 -31t7 -36t12 -27t22 -28q105 -80 284 -100q259 -28 440 63q24 13 39.5 23t31 29t19.5 40q48 267 80 473zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M390 1408h219v-388h364v-241h-364v-394q0 -136 14 -172q13 -37 52 -60q50 -31 117 -31q117 0 232 76v-242q-102 -48 -178 -65q-77 -19 -173 -19q-105 0 -186 27q-78 25 -138 75q-58 51 -79 105q-22 54 -22 161v539h-170v217q91 30 155 84q64 55 103 132q39 78 54 196z " />
|
||||
<glyph unicode="" d="M1123 127v181q-88 -56 -174 -56q-51 0 -88 23q-29 17 -39 45q-11 30 -11 129v295h274v181h-274v291h-164q-11 -90 -40 -147t-78 -99q-48 -40 -116 -63v-163h127v-404q0 -78 17 -121q17 -42 59 -78q43 -37 104 -57q62 -20 140 -20q67 0 129 14q57 13 134 49zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
||||
<glyph unicode="" horiz-adv-x="768" d="M765 237q8 -19 -5 -35l-350 -384q-10 -10 -23 -10q-14 0 -24 10l-355 384q-13 16 -5 35q9 19 29 19h224v1248q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1248h224q21 0 29 -19z" />
|
||||
<glyph unicode="" horiz-adv-x="768" d="M765 1043q-9 -19 -29 -19h-224v-1248q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1248h-224q-21 0 -29 19t5 35l350 384q10 10 23 10q14 0 24 -10l355 -384q13 -16 5 -35z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1792 736v-192q0 -14 -9 -23t-23 -9h-1248v-224q0 -21 -19 -29t-35 5l-384 350q-10 10 -10 23q0 14 10 24l384 354q16 14 35 6q19 -9 19 -29v-224h1248q14 0 23 -9t9 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1728 643q0 -14 -10 -24l-384 -354q-16 -14 -35 -6q-19 9 -19 29v224h-1248q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h1248v224q0 21 19 29t35 -5l384 -350q10 -10 10 -23z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M1393 321q-39 -125 -123 -250q-129 -196 -257 -196q-49 0 -140 32q-86 32 -151 32q-61 0 -142 -33q-81 -34 -132 -34q-152 0 -301 259q-147 261 -147 503q0 228 113 374q112 144 284 144q72 0 177 -30q104 -30 138 -30q45 0 143 34q102 34 173 34q119 0 213 -65 q52 -36 104 -100q-79 -67 -114 -118q-65 -94 -65 -207q0 -124 69 -223t158 -126zM1017 1494q0 -61 -29 -136q-30 -75 -93 -138q-54 -54 -108 -72q-37 -11 -104 -17q3 149 78 257q74 107 250 148q1 -3 2.5 -11t2.5 -11q0 -4 0.5 -10t0.5 -10z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M682 530v-651l-682 94v557h682zM682 1273v-659h-682v565zM1664 530v-786l-907 125v661h907zM1664 1408v-794h-907v669z" />
|
||||
<glyph unicode="" horiz-adv-x="1408" d="M493 1053q16 0 27.5 11.5t11.5 27.5t-11.5 27.5t-27.5 11.5t-27 -11.5t-11 -27.5t11 -27.5t27 -11.5zM915 1053q16 0 27 11.5t11 27.5t-11 27.5t-27 11.5t-27.5 -11.5t-11.5 -27.5t11.5 -27.5t27.5 -11.5zM103 869q42 0 72 -30t30 -72v-430q0 -43 -29.5 -73t-72.5 -30 t-73 30t-30 73v430q0 42 30 72t73 30zM1163 850v-666q0 -46 -32 -78t-77 -32h-75v-227q0 -43 -30 -73t-73 -30t-73 30t-30 73v227h-138v-227q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73l-1 227h-74q-46 0 -78 32t-32 78v666h918zM931 1255q107 -55 171 -153.5t64 -215.5 h-925q0 117 64 215.5t172 153.5l-71 131q-7 13 5 20q13 6 20 -6l72 -132q95 42 201 42t201 -42l72 132q7 12 20 6q12 -7 5 -20zM1408 767v-430q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73v430q0 43 30 72.5t72 29.5q43 0 73 -29.5t30 -72.5z" />
|
||||
<glyph unicode="" d="M663 1125q-11 -1 -15.5 -10.5t-8.5 -9.5q-5 -1 -5 5q0 12 19 15h10zM750 1111q-4 -1 -11.5 6.5t-17.5 4.5q24 11 32 -2q3 -6 -3 -9zM399 684q-4 1 -6 -3t-4.5 -12.5t-5.5 -13.5t-10 -13q-7 -10 -1 -12q4 -1 12.5 7t12.5 18q1 3 2 7t2 6t1.5 4.5t0.5 4v3t-1 2.5t-3 2z M1254 325q0 18 -55 42q4 15 7.5 27.5t5 26t3 21.5t0.5 22.5t-1 19.5t-3.5 22t-4 20.5t-5 25t-5.5 26.5q-10 48 -47 103t-72 75q24 -20 57 -83q87 -162 54 -278q-11 -40 -50 -42q-31 -4 -38.5 18.5t-8 83.5t-11.5 107q-9 39 -19.5 69t-19.5 45.5t-15.5 24.5t-13 15t-7.5 7 q-14 62 -31 103t-29.5 56t-23.5 33t-15 40q-4 21 6 53.5t4.5 49.5t-44.5 25q-15 3 -44.5 18t-35.5 16q-8 1 -11 26t8 51t36 27q37 3 51 -30t4 -58q-11 -19 -2 -26.5t30 -0.5q13 4 13 36v37q-5 30 -13.5 50t-21 30.5t-23.5 15t-27 7.5q-107 -8 -89 -134q0 -15 -1 -15 q-9 9 -29.5 10.5t-33 -0.5t-15.5 5q1 57 -16 90t-45 34q-27 1 -41.5 -27.5t-16.5 -59.5q-1 -15 3.5 -37t13 -37.5t15.5 -13.5q10 3 16 14q4 9 -7 8q-7 0 -15.5 14.5t-9.5 33.5q-1 22 9 37t34 14q17 0 27 -21t9.5 -39t-1.5 -22q-22 -15 -31 -29q-8 -12 -27.5 -23.5 t-20.5 -12.5q-13 -14 -15.5 -27t7.5 -18q14 -8 25 -19.5t16 -19t18.5 -13t35.5 -6.5q47 -2 102 15q2 1 23 7t34.5 10.5t29.5 13t21 17.5q9 14 20 8q5 -3 6.5 -8.5t-3 -12t-16.5 -9.5q-20 -6 -56.5 -21.5t-45.5 -19.5q-44 -19 -70 -23q-25 -5 -79 2q-10 2 -9 -2t17 -19 q25 -23 67 -22q17 1 36 7t36 14t33.5 17.5t30 17t24.5 12t17.5 2.5t8.5 -11q0 -2 -1 -4.5t-4 -5t-6 -4.5t-8.5 -5t-9 -4.5t-10 -5t-9.5 -4.5q-28 -14 -67.5 -44t-66.5 -43t-49 -1q-21 11 -63 73q-22 31 -25 22q-1 -3 -1 -10q0 -25 -15 -56.5t-29.5 -55.5t-21 -58t11.5 -63 q-23 -6 -62.5 -90t-47.5 -141q-2 -18 -1.5 -69t-5.5 -59q-8 -24 -29 -3q-32 31 -36 94q-2 28 4 56q4 19 -1 18l-4 -5q-36 -65 10 -166q5 -12 25 -28t24 -20q20 -23 104 -90.5t93 -76.5q16 -15 17.5 -38t-14 -43t-45.5 -23q8 -15 29 -44.5t28 -54t7 -70.5q46 24 7 92 q-4 8 -10.5 16t-9.5 12t-2 6q3 5 13 9.5t20 -2.5q46 -52 166 -36q133 15 177 87q23 38 34 30q12 -6 10 -52q-1 -25 -23 -92q-9 -23 -6 -37.5t24 -15.5q3 19 14.5 77t13.5 90q2 21 -6.5 73.5t-7.5 97t23 70.5q15 18 51 18q1 37 34.5 53t72.5 10.5t60 -22.5zM626 1152 q3 17 -2.5 30t-11.5 15q-9 2 -9 -7q2 -5 5 -6q10 0 7 -15q-3 -20 8 -20q3 0 3 3zM1045 955q-2 8 -6.5 11.5t-13 5t-14.5 5.5q-5 3 -9.5 8t-7 8t-5.5 6.5t-4 4t-4 -1.5q-14 -16 7 -43.5t39 -31.5q9 -1 14.5 8t3.5 20zM867 1168q0 11 -5 19.5t-11 12.5t-9 3q-14 -1 -7 -7l4 -2 q14 -4 18 -31q0 -3 8 2zM921 1401q0 2 -2.5 5t-9 7t-9.5 6q-15 15 -24 15q-9 -1 -11.5 -7.5t-1 -13t-0.5 -12.5q-1 -4 -6 -10.5t-6 -9t3 -8.5q4 -3 8 0t11 9t15 9q1 1 9 1t15 2t9 7zM1486 60q20 -12 31 -24.5t12 -24t-2.5 -22.5t-15.5 -22t-23.5 -19.5t-30 -18.5 t-31.5 -16.5t-32 -15.5t-27 -13q-38 -19 -85.5 -56t-75.5 -64q-17 -16 -68 -19.5t-89 14.5q-18 9 -29.5 23.5t-16.5 25.5t-22 19.5t-47 9.5q-44 1 -130 1q-19 0 -57 -1.5t-58 -2.5q-44 -1 -79.5 -15t-53.5 -30t-43.5 -28.5t-53.5 -11.5q-29 1 -111 31t-146 43q-19 4 -51 9.5 t-50 9t-39.5 9.5t-33.5 14.5t-17 19.5q-10 23 7 66.5t18 54.5q1 16 -4 40t-10 42.5t-4.5 36.5t10.5 27q14 12 57 14t60 12q30 18 42 35t12 51q21 -73 -32 -106q-32 -20 -83 -15q-34 3 -43 -10q-13 -15 5 -57q2 -6 8 -18t8.5 -18t4.5 -17t1 -22q0 -15 -17 -49t-14 -48 q3 -17 37 -26q20 -6 84.5 -18.5t99.5 -20.5q24 -6 74 -22t82.5 -23t55.5 -4q43 6 64.5 28t23 48t-7.5 58.5t-19 52t-20 36.5q-121 190 -169 242q-68 74 -113 40q-11 -9 -15 15q-3 16 -2 38q1 29 10 52t24 47t22 42q8 21 26.5 72t29.5 78t30 61t39 54q110 143 124 195 q-12 112 -16 310q-2 90 24 151.5t106 104.5q39 21 104 21q53 1 106 -13.5t89 -41.5q57 -42 91.5 -121.5t29.5 -147.5q-5 -95 30 -214q34 -113 133 -218q55 -59 99.5 -163t59.5 -191q8 -49 5 -84.5t-12 -55.5t-20 -22q-10 -2 -23.5 -19t-27 -35.5t-40.5 -33.5t-61 -14 q-18 1 -31.5 5t-22.5 13.5t-13.5 15.5t-11.5 20.5t-9 19.5q-22 37 -41 30t-28 -49t7 -97q20 -70 1 -195q-10 -65 18 -100.5t73 -33t85 35.5q59 49 89.5 66.5t103.5 42.5q53 18 77 36.5t18.5 34.5t-25 28.5t-51.5 23.5q-33 11 -49.5 48t-15 72.5t15.5 47.5q1 -31 8 -56.5 t14.5 -40.5t20.5 -28.5t21 -19t21.5 -13t16.5 -9.5z" />
|
||||
<glyph unicode="" d="M1024 36q-42 241 -140 498h-2l-2 -1q-16 -6 -43 -16.5t-101 -49t-137 -82t-131 -114.5t-103 -148l-15 11q184 -150 418 -150q132 0 256 52zM839 643q-21 49 -53 111q-311 -93 -673 -93q-1 -7 -1 -21q0 -124 44 -236.5t124 -201.5q50 89 123.5 166.5t142.5 124.5t130.5 81 t99.5 48l37 13q4 1 13 3.5t13 4.5zM732 855q-120 213 -244 378q-138 -65 -234 -186t-128 -272q302 0 606 80zM1416 536q-210 60 -409 29q87 -239 128 -469q111 75 185 189.5t96 250.5zM611 1277q-1 0 -2 -1q1 1 2 1zM1201 1132q-185 164 -433 164q-76 0 -155 -19 q131 -170 246 -382q69 26 130 60.5t96.5 61.5t65.5 57t37.5 40.5zM1424 647q-3 232 -149 410l-1 -1q-9 -12 -19 -24.5t-43.5 -44.5t-71 -60.5t-100 -65t-131.5 -64.5q25 -53 44 -95q2 -6 6.5 -17.5t7.5 -16.5q36 5 74.5 7t73.5 2t69 -1.5t64 -4t56.5 -5.5t48 -6.5t36.5 -6 t25 -4.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" d="M1173 473q0 50 -19.5 91.5t-48.5 68.5t-73 49t-82.5 34t-87.5 23l-104 24q-30 7 -44 10.5t-35 11.5t-30 16t-16.5 21t-7.5 30q0 77 144 77q43 0 77 -12t54 -28.5t38 -33.5t40 -29t48 -12q47 0 75.5 32t28.5 77q0 55 -56 99.5t-142 67.5t-182 23q-68 0 -132 -15.5 t-119.5 -47t-89 -87t-33.5 -128.5q0 -61 19 -106.5t56 -75.5t80 -48.5t103 -32.5l146 -36q90 -22 112 -36q32 -20 32 -60q0 -39 -40 -64.5t-105 -25.5q-51 0 -91.5 16t-65 38.5t-45.5 45t-46 38.5t-54 16q-50 0 -75.5 -30t-25.5 -75q0 -92 122 -157.5t291 -65.5 q73 0 140 18.5t122.5 53.5t88.5 93.5t33 131.5zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5q-130 0 -234 80q-77 -16 -150 -16q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5q0 73 16 150q-80 104 -80 234q0 159 112.5 271.5t271.5 112.5q130 0 234 -80 q77 16 150 16q143 0 273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -73 -16 -150q80 -104 80 -234z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1483 512l-587 -587q-52 -53 -127.5 -53t-128.5 53l-587 587q-53 53 -53 128t53 128l587 587q53 53 128 53t128 -53l265 -265l-398 -399l-188 188q-42 42 -99 42q-59 0 -100 -41l-120 -121q-42 -40 -42 -99q0 -58 42 -100l406 -408q30 -28 67 -37l6 -4h28q60 0 99 41 l619 619l2 -3q53 -53 53 -128t-53 -128zM1406 1138l120 -120q14 -15 14 -36t-14 -36l-730 -730q-17 -15 -37 -15v0q-4 0 -6 1q-18 2 -30 14l-407 408q-14 15 -14 36t14 35l121 120q13 15 35 15t36 -15l252 -252l574 575q15 15 36 15t36 -15z" />
|
||||
<glyph unicode="" d="M704 192v1024q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-1024q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1376 576v640q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-640q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408 q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1280" d="M1280 480q0 -40 -28 -68t-68 -28q-51 0 -80 43l-227 341h-45v-132l247 -411q9 -15 9 -33q0 -26 -19 -45t-45 -19h-192v-272q0 -46 -33 -79t-79 -33h-160q-46 0 -79 33t-33 79v272h-192q-26 0 -45 19t-19 45q0 18 9 33l247 411v132h-45l-227 -341q-29 -43 -80 -43 q-40 0 -68 28t-28 68q0 29 16 53l256 384q73 107 176 107h384q103 0 176 -107l256 -384q16 -24 16 -53zM864 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1024" d="M1024 832v-416q0 -40 -28 -68t-68 -28t-68 28t-28 68v352h-64v-912q0 -46 -33 -79t-79 -33t-79 33t-33 79v464h-64v-464q0 -46 -33 -79t-79 -33t-79 33t-33 79v912h-64v-352q0 -40 -28 -68t-68 -28t-68 28t-28 68v416q0 80 56 136t136 56h640q80 0 136 -56t56 -136z M736 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
|
||||
<glyph unicode="" d="M773 234l350 473q16 22 24.5 59t-6 85t-61.5 79q-40 26 -83 25.5t-73.5 -17.5t-54.5 -45q-36 -40 -96 -40q-59 0 -95 40q-24 28 -54.5 45t-73.5 17.5t-84 -25.5q-46 -31 -60.5 -79t-6 -85t24.5 -59zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1472 640q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5t-223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5t45.5 -223.5t123 -184t184 -123t223.5 -45.5t223.5 45.5t184 123t123 184t45.5 223.5zM1748 363q-4 -15 -20 -20l-292 -96v-306q0 -16 -13 -26q-15 -10 -29 -4 l-292 94l-180 -248q-10 -13 -26 -13t-26 13l-180 248l-292 -94q-14 -6 -29 4q-13 10 -13 26v306l-292 96q-16 5 -20 20q-5 17 4 29l180 248l-180 248q-9 13 -4 29q4 15 20 20l292 96v306q0 16 13 26q15 10 29 4l292 -94l180 248q9 12 26 12t26 -12l180 -248l292 94 q14 6 29 -4q13 -10 13 -26v-306l292 -96q16 -5 20 -20q5 -16 -4 -29l-180 -248l180 -248q9 -12 4 -29z" />
|
||||
<glyph unicode="" d="M1262 233q-54 -9 -110 -9q-182 0 -337 90t-245 245t-90 337q0 192 104 357q-201 -60 -328.5 -229t-127.5 -384q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51q144 0 273.5 61.5t220.5 171.5zM1465 318q-94 -203 -283.5 -324.5t-413.5 -121.5q-156 0 -298 61 t-245 164t-164 245t-61 298q0 153 57.5 292.5t156 241.5t235.5 164.5t290 68.5q44 2 61 -39q18 -41 -15 -72q-86 -78 -131.5 -181.5t-45.5 -218.5q0 -148 73 -273t198 -198t273 -73q118 0 228 51q41 18 72 -13q14 -14 17.5 -34t-4.5 -38z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M1088 704q0 26 -19 45t-45 19h-256q-26 0 -45 -19t-19 -45t19 -45t45 -19h256q26 0 45 19t19 45zM1664 896v-960q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v960q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1728 1344v-256q0 -26 -19 -45t-45 -19h-1536 q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1536q26 0 45 -19t19 -45z" />
|
||||
<glyph unicode="" horiz-adv-x="1664" d="M1632 576q0 -26 -19 -45t-45 -19h-224q0 -171 -67 -290l208 -209q19 -19 19 -45t-19 -45q-18 -19 -45 -19t-45 19l-198 197q-5 -5 -15 -13t-42 -28.5t-65 -36.5t-82 -29t-97 -13v896h-128v-896q-51 0 -101.5 13.5t-87 33t-66 39t-43.5 32.5l-15 14l-183 -207 q-20 -21 -48 -21q-24 0 -43 16q-19 18 -20.5 44.5t15.5 46.5l202 227q-58 114 -58 274h-224q-26 0 -45 19t-19 45t19 45t45 19h224v294l-173 173q-19 19 -19 45t19 45t45 19t45 -19l173 -173h844l173 173q19 19 45 19t45 -19t19 -45t-19 -45l-173 -173v-294h224q26 0 45 -19 t19 -45zM1152 1152h-640q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M1917 1016q23 -64 -150 -294q-24 -32 -65 -85q-78 -100 -90 -131q-17 -41 14 -81q17 -21 81 -82h1l1 -1l1 -1l2 -2q141 -131 191 -221q3 -5 6.5 -12.5t7 -26.5t-0.5 -34t-25 -27.5t-59 -12.5l-256 -4q-24 -5 -56 5t-52 22l-20 12q-30 21 -70 64t-68.5 77.5t-61 58 t-56.5 15.5q-3 -1 -8 -3.5t-17 -14.5t-21.5 -29.5t-17 -52t-6.5 -77.5q0 -15 -3.5 -27.5t-7.5 -18.5l-4 -5q-18 -19 -53 -22h-115q-71 -4 -146 16.5t-131.5 53t-103 66t-70.5 57.5l-25 24q-10 10 -27.5 30t-71.5 91t-106 151t-122.5 211t-130.5 272q-6 16 -6 27t3 16l4 6 q15 19 57 19l274 2q12 -2 23 -6.5t16 -8.5l5 -3q16 -11 24 -32q20 -50 46 -103.5t41 -81.5l16 -29q29 -60 56 -104t48.5 -68.5t41.5 -38.5t34 -14t27 5q2 1 5 5t12 22t13.5 47t9.5 81t0 125q-2 40 -9 73t-14 46l-6 12q-25 34 -85 43q-13 2 5 24q17 19 38 30q53 26 239 24 q82 -1 135 -13q20 -5 33.5 -13.5t20.5 -24t10.5 -32t3.5 -45.5t-1 -55t-2.5 -70.5t-1.5 -82.5q0 -11 -1 -42t-0.5 -48t3.5 -40.5t11.5 -39t22.5 -24.5q8 -2 17 -4t26 11t38 34.5t52 67t68 107.5q60 104 107 225q4 10 10 17.5t11 10.5l4 3l5 2.5t13 3t20 0.5l288 2 q39 5 64 -2.5t31 -16.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" d="M675 252q21 34 11 69t-45 50q-34 14 -73 1t-60 -46q-22 -34 -13 -68.5t43 -50.5t74.5 -2.5t62.5 47.5zM769 373q8 13 3.5 26.5t-17.5 18.5q-14 5 -28.5 -0.5t-21.5 -18.5q-17 -31 13 -45q14 -5 29 0.5t22 18.5zM943 266q-45 -102 -158 -150t-224 -12 q-107 34 -147.5 126.5t6.5 187.5q47 93 151.5 139t210.5 19q111 -29 158.5 -119.5t2.5 -190.5zM1255 426q-9 96 -89 170t-208.5 109t-274.5 21q-223 -23 -369.5 -141.5t-132.5 -264.5q9 -96 89 -170t208.5 -109t274.5 -21q223 23 369.5 141.5t132.5 264.5zM1563 422 q0 -68 -37 -139.5t-109 -137t-168.5 -117.5t-226 -83t-270.5 -31t-275 33.5t-240.5 93t-171.5 151t-65 199.5q0 115 69.5 245t197.5 258q169 169 341.5 236t246.5 -7q65 -64 20 -209q-4 -14 -1 -20t10 -7t14.5 0.5t13.5 3.5l6 2q139 59 246 59t153 -61q45 -63 0 -178 q-2 -13 -4.5 -20t4.5 -12.5t12 -7.5t17 -6q57 -18 103 -47t80 -81.5t34 -116.5zM1489 1046q42 -47 54.5 -108.5t-6.5 -117.5q-8 -23 -29.5 -34t-44.5 -4q-23 8 -34 29.5t-4 44.5q20 63 -24 111t-107 35q-24 -5 -45 8t-25 37q-5 24 8 44.5t37 25.5q60 13 119 -5.5t101 -65.5z M1670 1209q87 -96 112.5 -222.5t-13.5 -241.5q-9 -27 -34 -40t-52 -4t-40 34t-5 52q28 82 10 172t-80 158q-62 69 -148 95.5t-173 8.5q-28 -6 -52 9.5t-30 43.5t9.5 51.5t43.5 29.5q123 26 244 -11.5t208 -134.5z" />
|
||||
<glyph unicode="" horiz-adv-x="1920" d="M805 163q-122 -67 -261 -67q-141 0 -261 67q98 61 167 149t94 191q25 -103 94 -191t167 -149zM453 1176v-344q0 -179 -89.5 -326t-234.5 -217q-129 152 -129 351q0 200 129.5 352t323.5 184zM958 991q-128 -152 -128 -351q0 -201 128 -351q-145 70 -234.5 218t-89.5 328 v341q196 -33 324 -185zM1638 163q-122 -67 -261 -67q-141 0 -261 67q98 61 167 149t94 191q25 -103 94 -191t167 -149zM1286 1176v-344q0 -179 -91 -326t-237 -217v0q133 154 133 351q0 195 -133 351q129 151 328 185zM1920 640q0 -201 -129 -351q-145 70 -234.5 218 t-89.5 328v341q194 -32 323.5 -184t129.5 -352z" />
|
||||
<glyph unicode="" horiz-adv-x="1792" />
|
||||
<glyph unicode="" horiz-adv-x="1792" />
|
||||
<glyph unicode="" horiz-adv-x="1792" />
|
||||
<glyph unicode="" horiz-adv-x="1792" />
|
||||
</font>
|
||||
</defs></svg>
|
||||
|
After Width: | Height: | Size: 193 KiB |
BIN
app/assets/css/cascade/font/fontawesome-webfont.ttf
Normal file
BIN
app/assets/css/cascade/font/fontawesome-webfont.ttf
Normal file
Binary file not shown.
BIN
app/assets/css/cascade/font/fontawesome-webfont.woff
Normal file
BIN
app/assets/css/cascade/font/fontawesome-webfont.woff
Normal file
Binary file not shown.
1
app/assets/css/cascade/production/build-core+typography+responsive.min.css
vendored
Normal file
1
app/assets/css/cascade/production/build-core+typography+responsive.min.css
vendored
Normal file
File diff suppressed because one or more lines are too long
1
app/assets/css/cascade/production/build-core+typography.min.css
vendored
Normal file
1
app/assets/css/cascade/production/build-core+typography.min.css
vendored
Normal file
File diff suppressed because one or more lines are too long
1
app/assets/css/cascade/production/build-full-no-icons.min.css
vendored
Normal file
1
app/assets/css/cascade/production/build-full-no-icons.min.css
vendored
Normal file
File diff suppressed because one or more lines are too long
1
app/assets/css/cascade/production/build-full.min.css
vendored
Normal file
1
app/assets/css/cascade/production/build-full.min.css
vendored
Normal file
File diff suppressed because one or more lines are too long
1
app/assets/css/cascade/production/colors.min.css
vendored
Normal file
1
app/assets/css/cascade/production/colors.min.css
vendored
Normal file
File diff suppressed because one or more lines are too long
1
app/assets/css/cascade/production/core.min.css
vendored
Normal file
1
app/assets/css/cascade/production/core.min.css
vendored
Normal file
File diff suppressed because one or more lines are too long
1
app/assets/css/cascade/production/grids.min.css
vendored
Normal file
1
app/assets/css/cascade/production/grids.min.css
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
.width-1of24{width:4.1666666%}.width-1of16{width:6.25%}.width-1of12,.width-2of24{width:8.3333333%}.width-1of10{width:10%}.width-1of9{width:11.1111111%}.width-1of8,.width-2of16,.width-3of24{width:12.5%}.width-1of7{width:14.2857143%}.width-1of6,.width-2of12,.width-4of24{width:16.6666666%}.width-3of16{width:18.75%}.width-1of5,.width-2of10{width:20%}.width-5of24{width:20.8333333%}.width-2of9{width:22.2222222%}.width-1of4,.width-2of8,.width-3of12,.width-4of16,.width-6of24{width:25%}.width-2of7{width:28.5714286%}.width-7of24{width:29.1666666%}.width-3of10{width:30%}.width-5of16{width:31.25%}.width-1of3,.width-2of6,.width-3of9,.width-4of12,.width-8of24{width:33.3333333%}.width-3of8,.width-6of16,.width-9of24{width:37.5%}.width-2of5,.width-4of10{width:40%}.width-5of12,.width-10of24{width:41.6666666%}.width-3of7{width:42.8571429%}.width-7of16{width:43.75%}.width-4of9{width:44.4444444%}.width-11of24{width:45.8333333%}.width-1of2,.width-2of4,.width-3of6,.width-4of8,.width-5of10,.width-6of12,.width-8of16,.width-12of24{width:50%}.width-13of24{width:54.1666666%}.width-5of9{width:55.5555555%}.width-9of16{width:56.25%}.width-4of7{width:57.1428572%}.width-7of12,.width-14of24{width:58.3333333%}.width-3of5,.width-6of10{width:60%}.width-5of8,.width-10of16,.width-15of24{width:62.5%}.width-2of3,.width-4of6,.width-6of9,.width-8of12,.width-16of24{width:66.6666666%}.width-11of16{width:68.75%}.width-7of10{width:70%}.width-17of24{width:70.8333333%}.width-5of7{width:71.4285715%}.width-3of4,.width-6of8,.width-9of12,.width-12of16,.width-18of24{width:75%}.width-7of9{width:77.7777777%}.width-19of24{width:79.1666666%}.width-4of5,.width-8of10{width:80%}.width-13of16{width:81.25%}.width-5of6,.width-10of12,.width-20of24{width:83.3333333%}.width-6of7{width:85.7142858%}.width-7of8,.width-14of16,.width-21of24{width:87.5%}.width-8of9{width:88.8888888%}.width-9of10{width:90%}.width-11of12,.width-22of24{width:91.6666666%}.width-15of16{width:93.75%}.width-23of24{width:95.8333333%}
|
||||
1
app/assets/css/cascade/production/helpers.min.css
vendored
Normal file
1
app/assets/css/cascade/production/helpers.min.css
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
.no-margin{margin:0 !important}.no-padding{padding:0 !important}.float-left{float:left !important}.float-right{float:right !important}.float-right .text,.float-left .text{float:left}.border-bottom{border-bottom-width:1px !important}.border-left{border-left-width:1px !important}.border-right{border-right-width:1px !important}.border-top{border-top-width:1px !important}.no-border{border-width:0 !important}.width-full{width:100% !important}.invisible{visibility:hidden !important;border:none !important}.collapsed .collapse-section{position:absolute !important;top:-999999em !important;left:auto !important;width:1px !important;height:1px !important;overflow:hidden !important}.collapse-section{overflow:hidden}.hidden-tab,.collapsible .collapsed-only{display:none !important}.collapsed .collapsed-only,.collapsible .uncollapsed-only{display:inline !important}.collapsed .uncollapsed-only{display:none !important}.desktop-hidden{*display:none !important}@media \0 screen{.desktop-hidden{display:none !important}}@media(min-width:768px){.desktop-hidden,.col.desktop-hidden{display:none !important}}@media(max-width:767px){.mobile-hidden,.col.mobile-hidden{display:none !important}}@media(min-width:481px) and (max-width:767px){.tablet-hidden,.col.tablet-hidden{display:none !important}}@media(max-width:480px){.phone-hidden,.col.phone-hidden{display:none !important}}
|
||||
1
app/assets/css/cascade/production/icons-ie7.min.css
vendored
Normal file
1
app/assets/css/cascade/production/icons-ie7.min.css
vendored
Normal file
File diff suppressed because one or more lines are too long
1
app/assets/css/cascade/production/icons.min.css
vendored
Normal file
1
app/assets/css/cascade/production/icons.min.css
vendored
Normal file
File diff suppressed because one or more lines are too long
1
app/assets/css/cascade/production/mobile-grids.min.css
vendored
Normal file
1
app/assets/css/cascade/production/mobile-grids.min.css
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
@media(max-width:767px){.mobile-width-1of24{width:4.1666666% !important}.mobile-width-1of16{width:6.25% !important}.mobile-width-1of12,.mobile-width-2of24{width:8.3333333% !important}.mobile-width-1of10{width:10% !important}.mobile-width-1of9{width:11.1111111% !important}.mobile-width-1of8,.mobile-width-2of16,.mobile-width-3of24{width:12.5% !important}.mobile-width-1of7{width:14.2857143% !important}.mobile-width-1of6,.mobile-width-2of12,.mobile-width-4of24{width:16.6666666% !important}.mobile-width-3of16{width:18.75% !important}.mobile-width-1of5,.mobile-width-2of10{width:20% !important}.mobile-width-5of24{width:20.8333333% !important}.mobile-width-2of9{width:22.2222222% !important}.mobile-width-1of4,.mobile-width-2of8,.mobile-width-3of12,.mobile-width-4of16,.mobile-width-6of24{width:25% !important}.width-2of7{width:28.5714286% !important}.mobile-width-7of24{width:29.1666666% !important}.mobile-width-3of10{width:30% !important}.mobile-width-5of16{width:31.25% !important}.mobile-width-1of3,.mobile-width-2of6,.mobile-width-3of9,.mobile-width-4of12,.mobile-width-8of24{width:33.3333333% !important}.mobile-width-3of8,.mobile-width-6of16,.mobile-width-9of24{width:37.5% !important}.mobile-width-2of5,.mobile-width-4of10{width:40% !important}.mobile-width-5of12,.mobile-width-10of24{width:41.6666666% !important}.mobile-width-3of7{width:42.8571429% !important}.mobile-width-7of16{width:43.75% !important}.mobile-width-4of9{width:44.4444444% !important}.mobile-width-11of24{width:45.8333333% !important}.mobile-width-1of2,.mobile-width-2of4,.mobile-width-3of6,.mobile-width-4of8,.mobile-width-5of10,.mobile-width-6of12,.mobile-width-8of16,.mobile-width-12of24{width:50% !important}.mobile-width-13of24{width:54.1666666% !important}.mobile-width-5of9{width:55.5555555% !important}.mobile-width-9of16{width:56.25% !important}.mobile-width-4of7{width:57.1428572% !important}.mobile-width-7of12,.mobile-width-14of24{width:58.3333333% !important}.mobile-width-3of5,.mobile-width-6of10{width:60% !important}.mobile-width-5of8,.mobile-width-10of16,.mobile-width-15of24{width:62.5% !important}.mobile-width-2of3,.mobile-width-4of6,.mobile-width-6of9,.mobile-width-8of12,.mobile-width-16of24{width:66.6666666% !important}.mobile-width-11of16{width:68.75% !important}.mobile-width-7of10{width:70% !important}.mobile-width-17of24{width:70.8333333% !important}.mobile-width-5of7{width:71.4285715% !important}.mobile-width-3of4,.mobile-width-6of8,.mobile-width-9of12,.mobile-width-12of16,.mobile-width-18of24{width:75% !important}.mobile-width-7of9{width:77.7777777% !important}.mobile-width-19of24{width:79.1666666% !important}.mobile-width-4of5,.mobile-width-8of10{width:80% !important}.mobile-width-13of16{width:81.25% !important}.mobile-width-5of6,.mobile-width-10of12,.mobile-width-20of24{width:83.3333333% !important}.mobile-width-6of7{width:85.7142858% !important}.mobile-width-7of8,.mobile-width-14of16,.mobile-width-21of24{width:87.5% !important}.mobile-width-8of9{width:88.8888888% !important}.mobile-width-9of10{width:90% !important}.mobile-width-11of12,.mobile-width-22of24{width:91.6666666% !important}.mobile-width-15of16{width:93.75% !important}.mobile-width-23of24{width:95.8333333% !important}}
|
||||
1
app/assets/css/cascade/production/modern.min.css
vendored
Normal file
1
app/assets/css/cascade/production/modern.min.css
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
input,textarea,select,code,.label,.icon{-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.menu-tabs .menu a,.icon-64{-webkit-border-radius:4px;-moz-radius:4px;border-radius:4px}button,.button,.button-group,.tags .blocks a,.pagination a,.tags .blocks li.disabled,.icon-128,.files .tree a:hover{-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px}pre{-webkit-border-radius:8px;-moz-border-radius:8px;border-radius:8px}.button-group .button{-webkit-border-radius:0;-moz-radius:0;border-radius:0}.button-group .button:first-child{-webkit-border-radius:5px 0 0 5px;-moz-border-radius:5px 0 0 5px;border-radius:5px 0 0 5px}.button-group .button:last-child{-webkit-border-radius:0 5px 5px 0;-moz-border-radius:0 5px 5px 0;border-radius:0 5px 5px 0}.menu .collapse-trigger{-moz-border-radius:0 !important;-webkit-border-radius:0 !important;border-radius:0 !important}.tabs a{-webkit-border-radius:4px 4px 0 0;-moz-radius:4px 4px 0 0;border-radius:4px 4px 0 0}.tabs .bottom a{-webkit-border-radius:0 0 4px 4px;-moz-radius:0 0 4px 4px;border-radius:0 0 4px 4px}.tabs .left a{-webkit-border-radius:4px 0 0 4px;-moz-radius:4px 0 0 4px;border-radius:4px 0 0 4px}.tabs .right a{-webkit-border-radius:0 4px 4px 0;-moz-radius:0 4px 4px 0;border-radius:0 4px 4px 0}.panel,.panel>:first-child,.panel>:first-child>:first-child{-webkit-border-top-left-radius:8px;-moz-border-radius-topleft:8px;border-top-left-radius:8px;-webkit-border-top-right-radius:8px;-moz-border-radius-topright:8px;border-top-right-radius:8px}.panel,.panel>:last-child,.panel>:last-child>:last-child,.collapsed:last-child>.collapse-trigger{-webkit-border-bottom-left-radius:8px;-moz-border-radius-bottomleft:8px;border-bottom-left-radius:8px;-webkit-border-bottom-right-radius:8px;-moz-border-radius-bottomright:8px;border-bottom-right-radius:8px}.panel,pre{-moz-box-shadow:0 0 3px rgba(0,0,0,.1);-webkit-box-shadow:0 0 3px rgba(0,0,0,.1);box-shadow:1px 2px 3px rgba(0,0,0,.05)}.site-header{-webkit-box-shadow:0 1px 2px rgba(0,0,0,0.2);-moz-box-shadow:0 1px 2px rgba(0,0,0,0.2);box-shadow:0 1px 2px rgba(0,0,0,0.2)}:not(.menu)>.nav a,.button,button,select,input,textarea{-webkit-box-shadow:none !important;-moz-box-shadow:none !important;box-shadow:none !important;-webkit-transition:.2s ease;-moz-transition:.2s ease;-ms-transition:.2s ease;-o-transition:.2s ease;transition:.2s ease}.spin{-moz-animation:spin 2s infinite linear;-o-animation:spin 2s infinite linear;-webkit-animation:spin 2s infinite linear;animation:spin 2s infinite linear}@-moz-keyframes spin{0{-moz-transform:rotate(0)}100%{-moz-transform:rotate(359deg)}}@-webkit-keyframes spin{0{-webkit-transform:rotate(0)}100%{-webkit-transform:rotate(359deg)}}@-o-keyframes spin{0{-o-transform:rotate(0)}100%{-o-transform:rotate(359deg)}}@-ms-keyframes spin{0{-ms-transform:rotate(0)}100%{-ms-transform:rotate(359deg)}}@keyframes spin{0{transform:rotate(0)}100%{transform:rotate(359deg)}}
|
||||
1
app/assets/css/cascade/production/phone-grids.min.css
vendored
Normal file
1
app/assets/css/cascade/production/phone-grids.min.css
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
@media(max-width:480px){.phone-width-1of24{width:4.1666666%!important}.phone-width-1of16{width:6.25%!important}.phone-width-1of12,.phone-width-2of24{width:8.3333333%!important}.phone-width-1of10{width:10%!important}.phone-width-1of9{width:11.1111111%!important}.phone-width-1of8,.phone-width-2of16,.phone-width-3of24{width:12.5%!important}.phone-width-1of7{width:14.2857143%!important}.phone-width-1of6,.phone-width-2of12,.phone-width-4of24{width:16.6666666%!important}.phone-width-3of16{width:18.75%!important}.phone-width-1of5,.phone-width-2of10{width:20%!important}.phone-width-5of24{width:20.8333333%!important}.phone-width-2of9{width:22.2222222%!important}.phone-width-1of4,.phone-width-2of8,.phone-width-3of12,.phone-width-4of16,.phone-width-6of24{width:25%!important}.size2of7{width:28.5714286%!important}.phone-width-7of24{width:29.1666666%!important}.phone-width-3of10{width:30%!important}.phone-width-5of16{width:31.25%!important}.phone-width-1of3,.phone-width-2of6,.phone-width-3of9,.phone-width-4of12,.phone-width-8of24{width:33.3333333%!important}.phone-width-3of8,.phone-width-6of16,.phone-width-9of24{width:37.5%!important}.phone-width-2of5,.phone-width-4of10{width:40%!important}.phone-width-5of12,.phone-width-10of24{width:41.6666666%!important}.phone-width-3of7{width:42.8571429%!important}.phone-width-7of16{width:43.75%!important}.phone-width-4of9{width:44.4444444%!important}.phone-width-11of24{width:45.8333333%!important}.phone-width-1of2,.phone-width-2of4,.phone-width-3of6,.phone-width-4of8,.phone-width-5of10,.phone-width-6of12,.phone-width-8of16,.phone-width-12of24{width:50%!important}.phone-width-13of24{width:54.1666666%!important}.phone-width-5of9{width:55.5555555%!important}.phone-width-9of16{width:56.25%!important}.phone-width-4of7{width:57.1428572%!important}.phone-width-7of12,.phone-width-14of24{width:58.3333333%!important}.phone-width-3of5,.phone-width-6of10{width:60%!important}.phone-width-5of8,.phone-width-10of16,.phone-width-15of24{width:62.5%!important}.phone-width-2of3,.phone-width-4of6,.phone-width-6of9,.phone-width-8of12,.phone-width-16of24{width:66.6666666%!important}.phone-width-11of16{width:68.75%!important}.phone-width-7of10{width:70%!important}.phone-width-17of24{width:70.8333333%!important}.phone-width-5of7{width:71.4285715%!important}.phone-width-3of4,.phone-width-6of8,.phone-width-9of12,.phone-width-12of16,.phone-width-18of24{width:75%!important}.phone-width-7of9{width:77.7777777%!important}.phone-width-19of24{width:79.1666666%!important}.phone-width-4of5,.phone-width-8of10{width:80%!important}.phone-width-13of16{width:81.25%!important}.phone-width-5of6,.phone-width-10of12,.phone-width-20of24{width:83.3333333%!important}.phone-width-6of7{width:85.7142858%!important}.phone-width-7of8,.phone-width-14of16,.phone-width-21of24{width:87.5%!important}.phone-width-8of9{width:88.8888888%!important}.phone-width-9of10{width:90%!important}.phone-width-11of12,.phone-width-22of24{width:91.6666666%!important}.phone-width-15of16{width:93.75%!important}.phone-width-23of24{width:95.8333333%!important}}
|
||||
1
app/assets/css/cascade/production/print.min.css
vendored
Normal file
1
app/assets/css/cascade/production/print.min.css
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
@media print{*{background:transparent!important;color:black!important;text-shadow:none!important;filter:none!important;-ms-filter:none!important}a,a:visited{text-decoration:underline}a[href]:after{content:" (" attr(href) ")"}abbr[title]:after{content:" (" attr(title) ")"}.ir a:after,a[href^="javascript:"]:after,a[href^="#"]:after{content:""}pre,blockquote{border:1px solid #999;page-break-inside:avoid}thead{display:table-header-group}tr,img{page-break-inside:avoid}img{max-width:100%!important}@page{margin:.5cm}p,h2,h3{orphans:3;widows:3}h2,h3{page-break-after:avoid}}
|
||||
1
app/assets/css/cascade/production/responsive.min.css
vendored
Normal file
1
app/assets/css/cascade/production/responsive.min.css
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
@media(min-width:1200px){.site-center{width:1160px}.cell{margin:15px}}@media(min-width:768px) and (max-width:979px){.site-center{width:704px}}@media(max-width:767px){.parsley-error-list{position:static;display:block !important;margin-left:3px}main,section,article,header,footer,aside,nav,.col,main.width-fit,main.width-fill,section.width-fit,section.width-fill,article.width-fit,article.width-fill,header.width-fit,header.width-fill,footer.width-fit,footer.width-fill,aside.width-fit,aside.width-fill,nav.width-fit,nav.width-fill,.col.width-fit,.col.width-fill{padding:0 !important;display:block !important;float:left !important;width:100% !important}.site-center,.site-body,.site-header,.site-footer,.site-center>.body{margin:0 !important;width:100% !important;border:none !important;-webkit-box-shadow:none !important;-moz-box-shadow:none !important;box-shadow:none !important;-webkit-border-radius:0 !important;-moz-border-radius:0 !important;border-radius:0 !important}.center{float:none !important}}@media(max-width:767px){main.mobile-width-fill,section.mobile-width-fill,article.mobile-width-fill,header.mobile-width-fill,footer.mobile-width-fill,aside.mobile-width-fill,nav.mobile-width-fill,.col.mobile-width-fill{display:table-cell !important;float:none !important;min-width:50px !important;width:10000px !important}main.mobile-width-fit,section.mobile-width-fit,article.mobile-width-fit,header.mobile-width-fit,footer.mobile-width-fit,aside.mobile-width-fit,nav.mobile-width-fit,.col.mobile-width-fit{width:auto !important}.mobile-center{float:none !important;margin-left:auto !important;margin-right:auto !important}}@media(min-width:481px) and (max-width:767px){main.mobile-width-fill,section.tablet-width-fill,article.tablet-width-fill,header.tablet-width-fill,footer.tablet-width-fill,aside.tablet-width-fill,nav.tablet-width-fill,.col.tablet-width-fill{display:table-cell !important;float:none !important;min-width:50px !important;width:10000px !important}main.mobile-width-fill,section.tablet-width-fit,article.tablet-width-fit,header.tablet-width-fit,footer.tablet-width-fit,aside.tablet-width-fit,nav.tablet-width-fit,.col.tablet-width-fit{width:auto !important}.tablet-center{float:none !important;margin-left:auto !important;margin-right:auto !important}}@media(max-width:480px){main.phone-width-fill,section.phone-width-fill,article.phone-width-fill,header.phone-width-fill,footer.phone-width-fill,aside.phone-width-fill,nav.phone-width-fill,.col.phone-width-fill{display:table-cell !important;float:none !important;min-width:50px !important;width:10000px !important}main.phone-width-fit,section.phone-width-fit,article.phone-width-fit,header.phone-width-fit,footer.phone-width-fit,aside.phone-width-fit,nav.phone-width-fit,.col.phone-width-fit{width:auto !important}.phone-center{float:none !important;margin-left:auto !important;margin-right:auto !important}}
|
||||
1
app/assets/css/cascade/production/tables.min.css
vendored
Normal file
1
app/assets/css/cascade/production/tables.min.css
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
.block th,.block td{padding:10px 20px}.condensed th,.condensed td{padding:4px 5px}.datasheet td,.datasheet th{padding:2px 4px}.outline-header th{font-size:14px;line-height:14px}.datasheet th{line-height:16px;height:18px}.datasheet tbody th{text-align:right}.uppercase-header th{text-transform:uppercase}.box-header th{border-left-width:0;border-right-width:0}.box-header th,.outline td,.outline th{border-bottom-width:0}.outline tr :last-child{border-right-width:0}.block th,.block td{border-width:0 1px 0 0}table.box{border-width:1px}.header-border thead td,.header-border thead th{border-bottom-width:1px}table.block{border-width:1px 0 1px 1px}.datasheet td,.datasheet th{border-width:1px}table.border,table.datasheet{border-width:1px 0 0 1px}.datasheet td,.border th,.border td{border-width:0 1px 1px 0}.box-header thead tr{border-width:0 0 1px 0}table.outline{border-width:2px}.horizontal-border th,.horizontal-border td{border-bottom-width:1px}.outline-header thead td,.outline-header thead th{border-bottom-width:2px}.border .body{border-bottom-width:0}.border .body,.block .body{border-right-width:0}
|
||||
1
app/assets/css/cascade/production/tablet-grids.min.css
vendored
Normal file
1
app/assets/css/cascade/production/tablet-grids.min.css
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
@media(min-width:481px) and (max-width:767px){.tablet-width-1of24{width:4.1666666%!important}.tablet-width-1of16{width:6.25%!important}.tablet-width-1of12,.tablet-width-2of24{width:8.3333333%!important}.tablet-width-1of10{width:10%!important}.tablet-width-1of9{width:11.1111111%!important}.tablet-width-1of8,.tablet-width-2of16,.tablet-width-3of24{width:12.5%!important}.tablet-width-1of7{width:14.2857143%!important}.tablet-width-1of6,.tablet-width-2of12,.tablet-width-4of24{width:16.6666666%!important}.tablet-width-3of16{width:18.75%!important}.tablet-width-1of5,.tablet-width-2of10{width:20%!important}.tablet-width-5of24{width:20.8333333%!important}.tablet-width-2of9{width:22.2222222%!important}.tablet-width-1of4,.tablet-width-2of8,.tablet-width-3of12,.tablet-width-4of16,.tablet-width-6of24{width:25%!important}.size2of7{width:28.5714286%!important}.tablet-width-7of24{width:29.1666666%!important}.tablet-width-3of10{width:30%!important}.tablet-width-5of16{width:31.25%!important}.tablet-width-1of3,.tablet-width-2of6,.tablet-width-3of9,.tablet-width-4of12,.tablet-width-8of24{width:33.3333333%!important}.tablet-width-3of8,.tablet-width-6of16,.tablet-width-9of24{width:37.5%!important}.tablet-width-2of5,.tablet-width-4of10{width:40%!important}.tablet-width-5of12,.tablet-width-10of24{width:41.6666666%!important}.tablet-width-3of7{width:42.8571429%!important}.tablet-width-7of16{width:43.75%!important}.tablet-width-4of9{width:44.4444444%!important}.tablet-width-11of24{width:45.8333333%!important}.tablet-width-1of2,.tablet-width-2of4,.tablet-width-3of6,.tablet-width-4of8,.tablet-width-5of10,.tablet-width-6of12,.tablet-width-8of16,.tablet-width-12of24{width:50%!important}.tablet-width-13of24{width:54.1666666%!important}.tablet-width-5of9{width:55.5555555%!important}.tablet-width-9of16{width:56.25%!important}.tablet-width-4of7{width:57.1428572%!important}.tablet-width-7of12,.tablet-width-14of24{width:58.3333333%!important}.tablet-width-3of5,.tablet-width-6of10{width:60%!important}.tablet-width-5of8,.tablet-width-10of16,.tablet-width-15of24{width:62.5%!important}.tablet-width-2of3,.tablet-width-4of6,.tablet-width-6of9,.tablet-width-8of12,.tablet-width-16of24{width:66.6666666%!important}.tablet-width-11of16{width:68.75%!important}.tablet-width-7of10{width:70%!important}.tablet-width-17of24{width:70.8333333%!important}.tablet-width-5of7{width:71.4285715%!important}.tablet-width-3of4,.tablet-width-6of8,.tablet-width-9of12,.tablet-width-12of16,.tablet-width-18of24{width:75%!important}.tablet-width-7of9{width:77.7777777%!important}.tablet-width-19of24{width:79.1666666%!important}.tablet-width-4of5,.tablet-width-8of10{width:80%!important}.tablet-width-13of16{width:81.25%!important}.tablet-width-5of6,.tablet-width-10of12,.tablet-width-20of24{width:83.3333333%!important}.tablet-width-6of7{width:85.7142858%!important}.tablet-width-7of8,.tablet-width-14of16,.tablet-width-21of24{width:87.5%!important}.tablet-width-8of9{width:88.8888888%!important}.tablet-width-9of10{width:90%!important}.tablet-width-11of12,.tablet-width-22of24{width:91.6666666%!important}.tablet-width-15of16{width:93.75%!important}.tablet-width-23of24{width:95.8333333%!important}}
|
||||
1
app/assets/css/cascade/production/typography.min.css
vendored
Normal file
1
app/assets/css/cascade/production/typography.min.css
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
@font-face{font-family:'FontAwesome';src:url('../font/fontawesome-webfont.eot?v=3.2.1');src:url('../font/fontawesome-webfont.eot?#iefix&v=3.2.1') format('embedded-opentype'),url('../font/fontawesome-webfont.woff?v=3.2.1') format('woff'),url('../font/fontawesome-webfont.ttf?v=3.2.1') format('truetype'),url('../font/fontawesome-webfont.svg#fontawesomeregular?v=3.2.1') format('svg')}body,h1,h2,h3,h4,h5,h6{text-rendering:optimizeLegibility}body{font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%}p,button,input,select,textarea{font-family:inherit}pre,code,kbd,samp{font-family:Menlo,Monaco,"Courier New",monospace}.icon{font-family:FontAwesome}i,dfn,em,figcaption,cite{font-style:italic}address,cite,legend{font-style:inherit;white-space:inherit}.nav li,.label{white-space:nowrap}pre{white-space:pre;white-space:pre-wrap}.left li,.right li{white-space:normal}pre{word-break:break-all;word-wrap:break-word}b,th,strong,h1,h2,h3,h4,h5,h6,dt,.label,.fatty,.panel .header,.tags .blocks a,.tags .blocks .disabled,.pipes .stat a,.parsley-error-list li,.menu .links li,.site-header-ghost .nav a,.site-header .nav a,.tabs .active a{font-weight:700}blockquote p,.menu .header{font-weight:300}small,.pipes .stat span{font-weight:normal}body{font-size:13px}h1{font-size:230%}h2{font-size:185%}.tags .cloud .tag5{font-size:180%}.tags .cloud .tag4{font-size:160%}h3,.pipes .stat a,.tags .cloud .tag3{font-size:140%}.icon-button .icon,.tags .cloud .tag2,blockquote p,.site-header .nav a,.site-header-ghost .nav a{font-size:120%}.panel .header{font-size:113%}.fatty{font-size:110%}h4,.menu .nav a,.menu .nav .disabled{font-size:106%}p,button,.button,input,select,textarea,small,.icon,.tags .cloud .tag1{font-size:100%}abbr,.label,pre,code,kbd,samp,table,h4 small,h5{font-size:95%}h6,p small,sub,sup,.menu .header .nav a{font-size:85%}h2 small,h3 small{font-size:75%}.tiny,.pipes .stat span{font-size:70%}h1 small{font-size:60%}.tabs .nav a{line-height:270%}h6{line-height:170%}body,input,button,.button,select,address,dt,dd,li,p,h2,h3,h5,pre{line-height:150%}table input{line-height:135%}h4,.pipes li,.panel .footer{line-height:130%}.label,h1{line-height:120%}.menu a,.menu .disabled,.panel .header{line-height:110%}td,th,small,.tiny{line-height:100%}sub,sup{line-height:0}.button .icon{line-height:16px}.tags .nav li{line-height:19px}.tags .nav a{line-height:inherit}.icon-16{font-size:14px;line-height:16px}.icon-32{font-size:28px;line-height:32px}.icon-64{font-size:56px;line-height:64px}.icon-128{font-size:112px;line-height:128px}h6,abbr,.tiny{text-transform:uppercase}a:hover{text-decoration:underline}del{text-decoration:line-through}ins,a,.nav a:hover,.button:hover,.collapse-trigger a:hover{text-decoration:none}.tiny{letter-spacing:1px}button,.button,input,select,.radio,.checkbox{vertical-align:bottom;*vertical-align:middle}th,td,.icon,textarea,td img{vertical-align:top}.radio,.checkbox,.icon-16,.icon-32,.icon-64,.icon-128,.button .icon{vertical-align:middle}sub,sup,.label{vertical-align:baseline}
|
||||
|
|
@ -1,197 +0,0 @@
|
|||
html, body {
|
||||
width: 100%;
|
||||
height: 100%;
|
||||
font-size: 1em;
|
||||
font-family: "맑은 고딕", "Malgun Gothic", "Segoe UI", Calibri, Arial, Sans-Serif;
|
||||
}
|
||||
|
||||
input.text {
|
||||
font-size: 1em;
|
||||
font-family: "맑은 고딕", "Malgun Gothic", "Segoe UI", Calibri, Arial, Sans-Serif;
|
||||
}
|
||||
|
||||
#app {
|
||||
background: url(../img/bg.png) repeat-x;
|
||||
}
|
||||
|
||||
#aside {
|
||||
float: left;
|
||||
width: 30%;
|
||||
height: 100%;
|
||||
background-color: #333333;
|
||||
font-size: 0.8em;
|
||||
}
|
||||
|
||||
#aside .searchbox {
|
||||
position: relative;
|
||||
height: 35px;
|
||||
background: #1d1d1d url(../img/search-3-16.png) no-repeat 10px 10px;
|
||||
}
|
||||
|
||||
#aside .searchbox input.text {
|
||||
left: 32px;
|
||||
position: absolute;
|
||||
height: 100%;
|
||||
background: none;
|
||||
border: none;
|
||||
color: #505050;
|
||||
}
|
||||
|
||||
#aside .serverbox ul li {
|
||||
border-top: 1px solid #333;
|
||||
background-color: #27282a;
|
||||
color: #fff;
|
||||
}
|
||||
|
||||
#aside .serverbox ul li a {
|
||||
display: block;
|
||||
text-decoration: none;
|
||||
color: #fff;
|
||||
}
|
||||
|
||||
#aside .serverbox ul li span {
|
||||
display: block;
|
||||
padding: 10px;
|
||||
text-align: center;
|
||||
}
|
||||
|
||||
#aside .serverbox ul li span img {
|
||||
vertical-align: middle;
|
||||
}
|
||||
|
||||
#aside .serverbox ul.sub li {
|
||||
background-color: #3b3c3e;
|
||||
}
|
||||
|
||||
#aside .serverbox ul.sub li span {
|
||||
padding-left: 30px;
|
||||
text-align: left;
|
||||
}
|
||||
|
||||
#content {
|
||||
float: right;
|
||||
width: 70%;
|
||||
height: 100%;
|
||||
background: url(../img/World-Map-PNG-Picture.png) no-repeat center 50px;
|
||||
}
|
||||
|
||||
#content .closebox {
|
||||
position: absolute;
|
||||
padding: 10px;
|
||||
right: 0;
|
||||
top: 0;
|
||||
}
|
||||
|
||||
#content .logobox {
|
||||
margin: 50px 0;
|
||||
text-align: center;
|
||||
}
|
||||
|
||||
#content .loginbox {
|
||||
text-align: center;
|
||||
}
|
||||
|
||||
#content .loginbox label {
|
||||
display: none;
|
||||
}
|
||||
|
||||
#content .loginbox ul li {
|
||||
margin: 8px 0;
|
||||
}
|
||||
|
||||
#content .loginbox ul li input.text {
|
||||
width: 200px;
|
||||
border: 1px solid #888;
|
||||
border-radius: 8px;
|
||||
padding: 5px 10px;
|
||||
}
|
||||
|
||||
#content .loginbox .box2 {
|
||||
margin-top: 30px;
|
||||
}
|
||||
|
||||
#content .loginbox .box2 button.submit {
|
||||
border: 0;
|
||||
background: none;
|
||||
background-color: #43a747;
|
||||
color: #fff;
|
||||
font-weight: bold;
|
||||
padding: 10px 20px;
|
||||
border-radius: 8px;
|
||||
font-size: 1em;
|
||||
cursor: pointer;
|
||||
}
|
||||
|
||||
#content .logoutbox {
|
||||
text-align: center;
|
||||
}
|
||||
|
||||
#content .logoutbox .box1 {
|
||||
margin: 30px 0;
|
||||
}
|
||||
|
||||
#content .logoutbox .box1 p {
|
||||
color: #fff;
|
||||
font-size: 2em;
|
||||
font-weight: bold;
|
||||
}
|
||||
|
||||
#content .logoutbox .box2 {
|
||||
margin: 30px 0;
|
||||
}
|
||||
|
||||
#content .logoutbox .box2 button.logout {
|
||||
border: 0;
|
||||
background: none;
|
||||
background-color: #db0000;
|
||||
color: #fff;
|
||||
font-weight: bold;
|
||||
padding: 10px 20px;
|
||||
border-radius: 8px;
|
||||
font-size: 1em;
|
||||
cursor: pointer;
|
||||
}
|
||||
|
||||
#content .statusbox {
|
||||
width: 360px;
|
||||
margin: 100px auto;
|
||||
}
|
||||
|
||||
#content .statusbox .box1 ul li {
|
||||
float: left;
|
||||
width: 180px;
|
||||
margin: 10px 0;
|
||||
}
|
||||
|
||||
#content .statusbox .box1 ul li dl dt {
|
||||
color: #616686;
|
||||
display: inline;
|
||||
}
|
||||
|
||||
#content .statusbox .box1 ul li dl dd {
|
||||
display: inline;
|
||||
}
|
||||
|
||||
#content .statusbox .box1 button.connect {
|
||||
border: 0;
|
||||
background: none;
|
||||
background-color: #43a747;
|
||||
color: #fff;
|
||||
font-weight: bold;
|
||||
padding: 3px 15px;
|
||||
border-radius: 8px;
|
||||
font-size: 1em;
|
||||
cursor: pointer;
|
||||
}
|
||||
|
||||
#content .statusbox .box1 button.disconnect {
|
||||
border: 0;
|
||||
background: none;
|
||||
background-color: #db0000;
|
||||
color: #fff;
|
||||
font-weight: bold;
|
||||
padding: 3px 15px;
|
||||
border-radius: 8px;
|
||||
font-size: 1em;
|
||||
cursor: pointer;
|
||||
}
|
||||
|
|
@ -1,96 +0,0 @@
|
|||
<!--
|
||||
PIE: CSS3 rendering for IE
|
||||
Version 1.0.0
|
||||
http://css3pie.com
|
||||
Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
|
||||
-->
|
||||
<PUBLIC:COMPONENT lightWeight="true">
|
||||
<!-- saved from url=(0014)about:internet -->
|
||||
<PUBLIC:ATTACH EVENT="oncontentready" FOR="element" ONEVENT="init()" />
|
||||
<PUBLIC:ATTACH EVENT="ondocumentready" FOR="element" ONEVENT="init()" />
|
||||
<PUBLIC:ATTACH EVENT="ondetach" FOR="element" ONEVENT="cleanup()" />
|
||||
|
||||
<script type="text/javascript">
|
||||
var doc = element.document;var f=window.PIE;
|
||||
if(!f){f=window.PIE={F:"-pie-",nb:"Pie",La:"pie_",Ac:{TD:1,TH:1},cc:{TABLE:1,THEAD:1,TBODY:1,TFOOT:1,TR:1,INPUT:1,TEXTAREA:1,SELECT:1,OPTION:1,IMG:1,HR:1},fc:{A:1,INPUT:1,TEXTAREA:1,SELECT:1,BUTTON:1},Gd:{submit:1,button:1,reset:1},aa:function(){}};try{doc.execCommand("BackgroundImageCache",false,true)}catch(aa){}for(var ba=4,Z=doc.createElement("div"),ca=Z.getElementsByTagName("i"),ga;Z.innerHTML="<!--[if gt IE "+ ++ba+"]><i></i><![endif]--\>",ca[0];);f.O=ba;if(ba===6)f.F=f.F.replace(/^-/,"");f.ja=
|
||||
doc.documentMode||f.O;Z.innerHTML='<v:shape adj="1"/>';ga=Z.firstChild;ga.style.behavior="url(#default#VML)";f.zc=typeof ga.adj==="object";(function(){var a,b=0,c={};f.p={Za:function(d){if(!a){a=doc.createDocumentFragment();a.namespaces.add("css3vml","urn:schemas-microsoft-com:vml")}return a.createElement("css3vml:"+d)},Ba:function(d){return d&&d._pieId||(d._pieId="_"+ ++b)},Eb:function(d){var e,g,j,i,h=arguments;e=1;for(g=h.length;e<g;e++){i=h[e];for(j in i)if(i.hasOwnProperty(j))d[j]=i[j]}return d},
|
||||
Rb:function(d,e,g){var j=c[d],i,h;if(j)Object.prototype.toString.call(j)==="[object Array]"?j.push([e,g]):e.call(g,j);else{h=c[d]=[[e,g]];i=new Image;i.onload=function(){j=c[d]={h:i.width,f:i.height};for(var k=0,n=h.length;k<n;k++)h[k][0].call(h[k][1],j);i.onload=null};i.src=d}}}})();f.Na={gc:function(a,b,c,d){function e(){k=j>=90&&j<270?b:0;n=j<180?c:0;m=b-k;p=c-n}function g(){for(;j<0;)j+=360;j%=360}var j=d.sa;d=d.zb;var i,h,k,n,m,p,r,t;if(d){d=d.coords(a,b,c);i=d.x;h=d.y}if(j){j=j.jd();g();e();
|
||||
if(!d){i=k;h=n}d=f.Na.tc(i,h,j,m,p);a=d[0];d=d[1]}else if(d){a=b-i;d=c-h}else{i=h=a=0;d=c}r=a-i;t=d-h;if(j===void 0){j=!r?t<0?90:270:!t?r<0?180:0:-Math.atan2(t,r)/Math.PI*180;g();e()}return{sa:j,xc:i,yc:h,td:a,ud:d,Wd:k,Xd:n,rd:m,sd:p,kd:r,ld:t,rc:f.Na.dc(i,h,a,d)}},tc:function(a,b,c,d,e){if(c===0||c===180)return[d,b];else if(c===90||c===270)return[a,e];else{c=Math.tan(-c*Math.PI/180);a=c*a-b;b=-1/c;d=b*d-e;e=b-c;return[(d-a)/e,(c*d-b*a)/e]}},dc:function(a,b,c,d){a=c-a;b=d-b;return Math.abs(a===0?
|
||||
b:b===0?a:Math.sqrt(a*a+b*b))}};f.ea=function(){this.Gb=[];this.oc={}};f.ea.prototype={ba:function(a){var b=f.p.Ba(a),c=this.oc,d=this.Gb;if(!(b in c)){c[b]=d.length;d.push(a)}},Ha:function(a){a=f.p.Ba(a);var b=this.oc;if(a&&a in b){delete this.Gb[b[a]];delete b[a]}},xa:function(){for(var a=this.Gb,b=a.length;b--;)a[b]&&a[b]()}};f.Oa=new f.ea;f.Oa.Rd=function(){var a=this,b;if(!a.Sd){b=doc.documentElement.currentStyle.getAttribute(f.F+"poll-interval")||250;(function c(){a.xa();setTimeout(c,b)})();
|
||||
a.Sd=1}};(function(){function a(){f.L.xa();window.detachEvent("onunload",a);window.PIE=null}f.L=new f.ea;window.attachEvent("onunload",a);f.L.ta=function(b,c,d){b.attachEvent(c,d);this.ba(function(){b.detachEvent(c,d)})}})();f.Qa=new f.ea;f.L.ta(window,"onresize",function(){f.Qa.xa()});(function(){function a(){f.mb.xa()}f.mb=new f.ea;f.L.ta(window,"onscroll",a);f.Qa.ba(a)})();(function(){function a(){c=f.kb.md()}function b(){if(c){for(var d=0,e=c.length;d<e;d++)f.attach(c[d]);c=0}}var c;if(f.ja<9){f.L.ta(window,
|
||||
"onbeforeprint",a);f.L.ta(window,"onafterprint",b)}})();f.lb=new f.ea;f.L.ta(doc,"onmouseup",function(){f.lb.xa()});f.he=function(){function a(h){this.Y=h}var b=doc.createElement("length-calc"),c=doc.body||doc.documentElement,d=b.style,e={},g=["mm","cm","in","pt","pc"],j=g.length,i={};d.position="absolute";d.top=d.left="-9999px";for(c.appendChild(b);j--;){d.width="100"+g[j];e[g[j]]=b.offsetWidth/100}c.removeChild(b);d.width="1em";a.prototype={Kb:/(px|em|ex|mm|cm|in|pt|pc|%)$/,ic:function(){var h=
|
||||
this.Jd;if(h===void 0)h=this.Jd=parseFloat(this.Y);return h},yb:function(){var h=this.ae;if(!h)h=this.ae=(h=this.Y.match(this.Kb))&&h[0]||"px";return h},a:function(h,k){var n=this.ic(),m=this.yb();switch(m){case "px":return n;case "%":return n*(typeof k==="function"?k():k)/100;case "em":return n*this.xb(h);case "ex":return n*this.xb(h)/2;default:return n*e[m]}},xb:function(h){var k=h.currentStyle.fontSize,n,m;if(k.indexOf("px")>0)return parseFloat(k);else if(h.tagName in f.cc){m=this;n=h.parentNode;
|
||||
return f.n(k).a(n,function(){return m.xb(n)})}else{h.appendChild(b);k=b.offsetWidth;b.parentNode===h&&h.removeChild(b);return k}}};f.n=function(h){return i[h]||(i[h]=new a(h))};return a}();f.Ja=function(){function a(e){this.X=e}var b=f.n("50%"),c={top:1,center:1,bottom:1},d={left:1,center:1,right:1};a.prototype={zd:function(){if(!this.ac){var e=this.X,g=e.length,j=f.v,i=j.qa,h=f.n("0");i=i.na;h=["left",h,"top",h];if(g===1){e.push(new j.ob(i,"center"));g++}if(g===2){i&(e[0].k|e[1].k)&&e[0].d in c&&
|
||||
e[1].d in d&&e.push(e.shift());if(e[0].k&i)if(e[0].d==="center")h[1]=b;else h[0]=e[0].d;else if(e[0].W())h[1]=f.n(e[0].d);if(e[1].k&i)if(e[1].d==="center")h[3]=b;else h[2]=e[1].d;else if(e[1].W())h[3]=f.n(e[1].d)}this.ac=h}return this.ac},coords:function(e,g,j){var i=this.zd(),h=i[1].a(e,g);e=i[3].a(e,j);return{x:i[0]==="right"?g-h:h,y:i[2]==="bottom"?j-e:e}}};return a}();f.Ka=function(){function a(b,c){this.h=b;this.f=c}a.prototype={a:function(b,c,d,e,g){var j=this.h,i=this.f,h=c/d;e=e/g;if(j===
|
||||
"contain"){j=e>h?c:d*e;i=e>h?c/e:d}else if(j==="cover"){j=e<h?c:d*e;i=e<h?c/e:d}else if(j==="auto"){i=i==="auto"?g:i.a(b,d);j=i*e}else{j=j.a(b,c);i=i==="auto"?j/e:i.a(b,d)}return{h:j,f:i}}};a.Kc=new a("auto","auto");return a}();f.Ec=function(){function a(b){this.Y=b}a.prototype={Kb:/[a-z]+$/i,yb:function(){return this.ad||(this.ad=this.Y.match(this.Kb)[0].toLowerCase())},jd:function(){var b=this.Vc,c;if(b===undefined){b=this.yb();c=parseFloat(this.Y,10);b=this.Vc=b==="deg"?c:b==="rad"?c/Math.PI*180:
|
||||
b==="grad"?c/400*360:b==="turn"?c*360:0}return b}};return a}();f.Jc=function(){function a(c){this.Y=c}var b={};a.Qd=/\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;a.Fb={aliceblue:"F0F8FF",antiquewhite:"FAEBD7",aqua:"0FF",aquamarine:"7FFFD4",azure:"F0FFFF",beige:"F5F5DC",bisque:"FFE4C4",black:"000",blanchedalmond:"FFEBCD",blue:"00F",blueviolet:"8A2BE2",brown:"A52A2A",burlywood:"DEB887",cadetblue:"5F9EA0",chartreuse:"7FFF00",chocolate:"D2691E",coral:"FF7F50",cornflowerblue:"6495ED",
|
||||
cornsilk:"FFF8DC",crimson:"DC143C",cyan:"0FF",darkblue:"00008B",darkcyan:"008B8B",darkgoldenrod:"B8860B",darkgray:"A9A9A9",darkgreen:"006400",darkkhaki:"BDB76B",darkmagenta:"8B008B",darkolivegreen:"556B2F",darkorange:"FF8C00",darkorchid:"9932CC",darkred:"8B0000",darksalmon:"E9967A",darkseagreen:"8FBC8F",darkslateblue:"483D8B",darkslategray:"2F4F4F",darkturquoise:"00CED1",darkviolet:"9400D3",deeppink:"FF1493",deepskyblue:"00BFFF",dimgray:"696969",dodgerblue:"1E90FF",firebrick:"B22222",floralwhite:"FFFAF0",
|
||||
forestgreen:"228B22",fuchsia:"F0F",gainsboro:"DCDCDC",ghostwhite:"F8F8FF",gold:"FFD700",goldenrod:"DAA520",gray:"808080",green:"008000",greenyellow:"ADFF2F",honeydew:"F0FFF0",hotpink:"FF69B4",indianred:"CD5C5C",indigo:"4B0082",ivory:"FFFFF0",khaki:"F0E68C",lavender:"E6E6FA",lavenderblush:"FFF0F5",lawngreen:"7CFC00",lemonchiffon:"FFFACD",lightblue:"ADD8E6",lightcoral:"F08080",lightcyan:"E0FFFF",lightgoldenrodyellow:"FAFAD2",lightgreen:"90EE90",lightgrey:"D3D3D3",lightpink:"FFB6C1",lightsalmon:"FFA07A",
|
||||
lightseagreen:"20B2AA",lightskyblue:"87CEFA",lightslategray:"789",lightsteelblue:"B0C4DE",lightyellow:"FFFFE0",lime:"0F0",limegreen:"32CD32",linen:"FAF0E6",magenta:"F0F",maroon:"800000",mediumauqamarine:"66CDAA",mediumblue:"0000CD",mediumorchid:"BA55D3",mediumpurple:"9370D8",mediumseagreen:"3CB371",mediumslateblue:"7B68EE",mediumspringgreen:"00FA9A",mediumturquoise:"48D1CC",mediumvioletred:"C71585",midnightblue:"191970",mintcream:"F5FFFA",mistyrose:"FFE4E1",moccasin:"FFE4B5",navajowhite:"FFDEAD",
|
||||
navy:"000080",oldlace:"FDF5E6",olive:"808000",olivedrab:"688E23",orange:"FFA500",orangered:"FF4500",orchid:"DA70D6",palegoldenrod:"EEE8AA",palegreen:"98FB98",paleturquoise:"AFEEEE",palevioletred:"D87093",papayawhip:"FFEFD5",peachpuff:"FFDAB9",peru:"CD853F",pink:"FFC0CB",plum:"DDA0DD",powderblue:"B0E0E6",purple:"800080",red:"F00",rosybrown:"BC8F8F",royalblue:"4169E1",saddlebrown:"8B4513",salmon:"FA8072",sandybrown:"F4A460",seagreen:"2E8B57",seashell:"FFF5EE",sienna:"A0522D",silver:"C0C0C0",skyblue:"87CEEB",
|
||||
slateblue:"6A5ACD",slategray:"708090",snow:"FFFAFA",springgreen:"00FF7F",steelblue:"4682B4",tan:"D2B48C",teal:"008080",thistle:"D8BFD8",tomato:"FF6347",turquoise:"40E0D0",violet:"EE82EE",wheat:"F5DEB3",white:"FFF",whitesmoke:"F5F5F5",yellow:"FF0",yellowgreen:"9ACD32"};a.prototype={parse:function(){if(!this.Ua){var c=this.Y,d;if(d=c.match(a.Qd)){this.Ua="rgb("+d[1]+","+d[2]+","+d[3]+")";this.Yb=parseFloat(d[4])}else{if((d=c.toLowerCase())in a.Fb)c="#"+a.Fb[d];this.Ua=c;this.Yb=c==="transparent"?0:
|
||||
1}}},U:function(c){this.parse();return this.Ua==="currentColor"?c.currentStyle.color:this.Ua},fa:function(){this.parse();return this.Yb}};f.ha=function(c){return b[c]||(b[c]=new a(c))};return a}();f.v=function(){function a(c){this.$a=c;this.ch=0;this.X=[];this.Ga=0}var b=a.qa={Ia:1,Wb:2,z:4,Lc:8,Xb:16,na:32,K:64,oa:128,pa:256,Ra:512,Tc:1024,URL:2048};a.ob=function(c,d){this.k=c;this.d=d};a.ob.prototype={Ca:function(){return this.k&b.K||this.k&b.oa&&this.d==="0"},W:function(){return this.Ca()||this.k&
|
||||
b.Ra}};a.prototype={de:/\s/,Kd:/^[\+\-]?(\d*\.)?\d+/,url:/^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,nc:/^\-?[_a-z][\w-]*/i,Yd:/^("([^"]*)"|'([^']*)')/,Bd:/^#([\da-f]{6}|[\da-f]{3})/i,be:{px:b.K,em:b.K,ex:b.K,mm:b.K,cm:b.K,"in":b.K,pt:b.K,pc:b.K,deg:b.Ia,rad:b.Ia,grad:b.Ia},fd:{rgb:1,rgba:1,hsl:1,hsla:1},next:function(c){function d(p,r){p=new a.ob(p,r);if(!c){k.X.push(p);k.Ga++}return p}function e(){k.Ga++;return null}var g,j,i,h,k=this;if(this.Ga<this.X.length)return this.X[this.Ga++];for(;this.de.test(this.$a.charAt(this.ch));)this.ch++;
|
||||
if(this.ch>=this.$a.length)return e();j=this.ch;g=this.$a.substring(this.ch);i=g.charAt(0);switch(i){case "#":if(h=g.match(this.Bd)){this.ch+=h[0].length;return d(b.z,h[0])}break;case '"':case "'":if(h=g.match(this.Yd)){this.ch+=h[0].length;return d(b.Tc,h[2]||h[3]||"")}break;case "/":case ",":this.ch++;return d(b.pa,i);case "u":if(h=g.match(this.url)){this.ch+=h[0].length;return d(b.URL,h[2]||h[3]||h[4]||"")}}if(h=g.match(this.Kd)){i=h[0];this.ch+=i.length;if(g.charAt(i.length)==="%"){this.ch++;
|
||||
return d(b.Ra,i+"%")}if(h=g.substring(i.length).match(this.nc)){i+=h[0];this.ch+=h[0].length;return d(this.be[h[0].toLowerCase()]||b.Lc,i)}return d(b.oa,i)}if(h=g.match(this.nc)){i=h[0];this.ch+=i.length;if(i.toLowerCase()in f.Jc.Fb||i==="currentColor"||i==="transparent")return d(b.z,i);if(g.charAt(i.length)==="("){this.ch++;if(i.toLowerCase()in this.fd){g=function(p){return p&&p.k&b.oa};h=function(p){return p&&p.k&(b.oa|b.Ra)};var n=function(p,r){return p&&p.d===r},m=function(){return k.next(1)};
|
||||
if((i.charAt(0)==="r"?h(m()):g(m()))&&n(m(),",")&&h(m())&&n(m(),",")&&h(m())&&(i==="rgb"||i==="hsa"||n(m(),",")&&g(m()))&&n(m(),")"))return d(b.z,this.$a.substring(j,this.ch));return e()}return d(b.Xb,i)}return d(b.na,i)}this.ch++;return d(b.Wb,i)},D:function(){return this.X[this.Ga-- -2]},all:function(){for(;this.next(););return this.X},ma:function(c,d){for(var e=[],g,j;g=this.next();){if(c(g)){j=true;this.D();break}e.push(g)}return d&&!j?null:e}};return a}();var ha=function(a){this.e=a};ha.prototype=
|
||||
{Z:0,Od:function(){var a=this.qb,b;return!a||(b=this.o())&&(a.x!==b.x||a.y!==b.y)},Td:function(){var a=this.qb,b;return!a||(b=this.o())&&(a.h!==b.h||a.f!==b.f)},hc:function(){var a=this.e,b=a.getBoundingClientRect(),c=f.ja===9,d=f.O===7,e=b.right-b.left;return{x:b.left,y:b.top,h:c||d?a.offsetWidth:e,f:c||d?a.offsetHeight:b.bottom-b.top,Hd:d&&e?a.offsetWidth/e:1}},o:function(){return this.Z?this.Va||(this.Va=this.hc()):this.hc()},Ad:function(){return!!this.qb},cb:function(){++this.Z},hb:function(){if(!--this.Z){if(this.Va)this.qb=
|
||||
this.Va;this.Va=null}}};(function(){function a(b){var c=f.p.Ba(b);return function(){if(this.Z){var d=this.$b||(this.$b={});return c in d?d[c]:(d[c]=b.call(this))}else return b.call(this)}}f.B={Z:0,ka:function(b){function c(d){this.e=d;this.Zb=this.ia()}f.p.Eb(c.prototype,f.B,b);c.$c={};return c},j:function(){var b=this.ia(),c=this.constructor.$c;return b?b in c?c[b]:(c[b]=this.la(b)):null},ia:a(function(){var b=this.e,c=this.constructor,d=b.style;b=b.currentStyle;var e=this.wa,g=this.Fa,j=c.Yc||(c.Yc=
|
||||
f.F+e);c=c.Zc||(c.Zc=f.nb+g.charAt(0).toUpperCase()+g.substring(1));return d[c]||b.getAttribute(j)||d[g]||b.getAttribute(e)}),i:a(function(){return!!this.j()}),H:a(function(){var b=this.ia(),c=b!==this.Zb;this.Zb=b;return c}),va:a,cb:function(){++this.Z},hb:function(){--this.Z||delete this.$b}}})();f.Sb=f.B.ka({wa:f.F+"background",Fa:f.nb+"Background",cd:{scroll:1,fixed:1,local:1},fb:{"repeat-x":1,"repeat-y":1,repeat:1,"no-repeat":1},sc:{"padding-box":1,"border-box":1,"content-box":1},Pd:{top:1,right:1,
|
||||
bottom:1,left:1,center:1},Ud:{contain:1,cover:1},eb:{Ma:"backgroundClip",z:"backgroundColor",da:"backgroundImage",Pa:"backgroundOrigin",S:"backgroundPosition",T:"backgroundRepeat",Sa:"backgroundSize"},la:function(a){function b(s){return s&&s.W()||s.k&k&&s.d in t}function c(s){return s&&(s.W()&&f.n(s.d)||s.d==="auto"&&"auto")}var d=this.e.currentStyle,e,g,j,i=f.v.qa,h=i.pa,k=i.na,n=i.z,m,p,r=0,t=this.Pd,v,l,q={M:[]};if(this.wb()){e=new f.v(a);for(j={};g=e.next();){m=g.k;p=g.d;if(!j.P&&m&i.Xb&&p===
|
||||
"linear-gradient"){v={ca:[],P:p};for(l={};g=e.next();){m=g.k;p=g.d;if(m&i.Wb&&p===")"){l.color&&v.ca.push(l);v.ca.length>1&&f.p.Eb(j,v);break}if(m&n){if(v.sa||v.zb){g=e.D();if(g.k!==h)break;e.next()}l={color:f.ha(p)};g=e.next();if(g.W())l.db=f.n(g.d);else e.D()}else if(m&i.Ia&&!v.sa&&!l.color&&!v.ca.length)v.sa=new f.Ec(g.d);else if(b(g)&&!v.zb&&!l.color&&!v.ca.length){e.D();v.zb=new f.Ja(e.ma(function(s){return!b(s)},false))}else if(m&h&&p===","){if(l.color){v.ca.push(l);l={}}}else break}}else if(!j.P&&
|
||||
m&i.URL){j.Ab=p;j.P="image"}else if(b(g)&&!j.$){e.D();j.$=new f.Ja(e.ma(function(s){return!b(s)},false))}else if(m&k)if(p in this.fb&&!j.bb)j.bb=p;else if(p in this.sc&&!j.Wa){j.Wa=p;if((g=e.next())&&g.k&k&&g.d in this.sc)j.ub=g.d;else{j.ub=p;e.D()}}else if(p in this.cd&&!j.bc)j.bc=p;else return null;else if(m&n&&!q.color)q.color=f.ha(p);else if(m&h&&p==="/"&&!j.Xa&&j.$){g=e.next();if(g.k&k&&g.d in this.Ud)j.Xa=new f.Ka(g.d);else if(g=c(g)){m=c(e.next());if(!m){m=g;e.D()}j.Xa=new f.Ka(g,m)}else return null}else if(m&
|
||||
h&&p===","&&j.P){j.Hb=a.substring(r,e.ch-1);r=e.ch;q.M.push(j);j={}}else return null}if(j.P){j.Hb=a.substring(r);q.M.push(j)}}else this.Bc(f.ja<9?function(){var s=this.eb,o=d[s.S+"X"],u=d[s.S+"Y"],x=d[s.da],y=d[s.z];if(y!=="transparent")q.color=f.ha(y);if(x!=="none")q.M=[{P:"image",Ab:(new f.v(x)).next().d,bb:d[s.T],$:new f.Ja((new f.v(o+" "+u)).all())}]}:function(){var s=this.eb,o=/\s*,\s*/,u=d[s.da].split(o),x=d[s.z],y,z,B,E,D,C;if(x!=="transparent")q.color=f.ha(x);if((E=u.length)&&u[0]!=="none"){x=
|
||||
d[s.T].split(o);y=d[s.S].split(o);z=d[s.Pa].split(o);B=d[s.Ma].split(o);s=d[s.Sa].split(o);q.M=[];for(o=0;o<E;o++)if((D=u[o])&&D!=="none"){C=s[o].split(" ");q.M.push({Hb:D+" "+x[o]+" "+y[o]+" / "+s[o]+" "+z[o]+" "+B[o],P:"image",Ab:(new f.v(D)).next().d,bb:x[o],$:new f.Ja((new f.v(y[o])).all()),Wa:z[o],ub:B[o],Xa:new f.Ka(C[0],C[1])})}}});return q.color||q.M[0]?q:null},Bc:function(a){var b=f.ja>8,c=this.eb,d=this.e.runtimeStyle,e=d[c.da],g=d[c.z],j=d[c.T],i,h,k,n;if(e)d[c.da]="";if(g)d[c.z]="";if(j)d[c.T]=
|
||||
"";if(b){i=d[c.Ma];h=d[c.Pa];n=d[c.S];k=d[c.Sa];if(i)d[c.Ma]="";if(h)d[c.Pa]="";if(n)d[c.S]="";if(k)d[c.Sa]=""}a=a.call(this);if(e)d[c.da]=e;if(g)d[c.z]=g;if(j)d[c.T]=j;if(b){if(i)d[c.Ma]=i;if(h)d[c.Pa]=h;if(n)d[c.S]=n;if(k)d[c.Sa]=k}return a},ia:f.B.va(function(){return this.wb()||this.Bc(function(){var a=this.e.currentStyle,b=this.eb;return a[b.z]+" "+a[b.da]+" "+a[b.T]+" "+a[b.S+"X"]+" "+a[b.S+"Y"]})}),wb:f.B.va(function(){var a=this.e;return a.style[this.Fa]||a.currentStyle.getAttribute(this.wa)}),
|
||||
qc:function(){var a=0;if(f.O<7){a=this.e;a=""+(a.style[f.nb+"PngFix"]||a.currentStyle.getAttribute(f.F+"png-fix"))==="true"}return a},i:f.B.va(function(){return(this.wb()||this.qc())&&!!this.j()})});f.Vb=f.B.ka({wc:["Top","Right","Bottom","Left"],Id:{thin:"1px",medium:"3px",thick:"5px"},la:function(){var a={},b={},c={},d=false,e=true,g=true,j=true;this.Cc(function(){for(var i=this.e.currentStyle,h=0,k,n,m,p,r,t,v;h<4;h++){m=this.wc[h];v=m.charAt(0).toLowerCase();k=b[v]=i["border"+m+"Style"];n=i["border"+
|
||||
m+"Color"];m=i["border"+m+"Width"];if(h>0){if(k!==p)g=false;if(n!==r)e=false;if(m!==t)j=false}p=k;r=n;t=m;c[v]=f.ha(n);m=a[v]=f.n(b[v]==="none"?"0":this.Id[m]||m);if(m.a(this.e)>0)d=true}});return d?{J:a,Zd:b,gd:c,ee:j,hd:e,$d:g}:null},ia:f.B.va(function(){var a=this.e,b=a.currentStyle,c;a.tagName in f.Ac&&a.offsetParent.currentStyle.borderCollapse==="collapse"||this.Cc(function(){c=b.borderWidth+"|"+b.borderStyle+"|"+b.borderColor});return c}),Cc:function(a){var b=this.e.runtimeStyle,c=b.borderWidth,
|
||||
d=b.borderColor;if(c)b.borderWidth="";if(d)b.borderColor="";a=a.call(this);if(c)b.borderWidth=c;if(d)b.borderColor=d;return a}});(function(){f.jb=f.B.ka({wa:"border-radius",Fa:"borderRadius",la:function(b){var c=null,d,e,g,j,i=false;if(b){e=new f.v(b);var h=function(){for(var k=[],n;(g=e.next())&&g.W();){j=f.n(g.d);n=j.ic();if(n<0)return null;if(n>0)i=true;k.push(j)}return k.length>0&&k.length<5?{tl:k[0],tr:k[1]||k[0],br:k[2]||k[0],bl:k[3]||k[1]||k[0]}:null};if(b=h()){if(g){if(g.k&f.v.qa.pa&&g.d===
|
||||
"/")d=h()}else d=b;if(i&&b&&d)c={x:b,y:d}}}return c}});var a=f.n("0");a={tl:a,tr:a,br:a,bl:a};f.jb.Dc={x:a,y:a}})();f.Ub=f.B.ka({wa:"border-image",Fa:"borderImage",fb:{stretch:1,round:1,repeat:1,space:1},la:function(a){var b=null,c,d,e,g,j,i,h=0,k=f.v.qa,n=k.na,m=k.oa,p=k.Ra;if(a){c=new f.v(a);b={};for(var r=function(l){return l&&l.k&k.pa&&l.d==="/"},t=function(l){return l&&l.k&n&&l.d==="fill"},v=function(){g=c.ma(function(l){return!(l.k&(m|p))});if(t(c.next())&&!b.fill)b.fill=true;else c.D();if(r(c.next())){h++;
|
||||
j=c.ma(function(l){return!l.W()&&!(l.k&n&&l.d==="auto")});if(r(c.next())){h++;i=c.ma(function(l){return!l.Ca()})}}else c.D()};a=c.next();){d=a.k;e=a.d;if(d&(m|p)&&!g){c.D();v()}else if(t(a)&&!b.fill){b.fill=true;v()}else if(d&n&&this.fb[e]&&!b.repeat){b.repeat={f:e};if(a=c.next())if(a.k&n&&this.fb[a.d])b.repeat.Ob=a.d;else c.D()}else if(d&k.URL&&!b.src)b.src=e;else return null}if(!b.src||!g||g.length<1||g.length>4||j&&j.length>4||h===1&&j.length<1||i&&i.length>4||h===2&&i.length<1)return null;if(!b.repeat)b.repeat=
|
||||
{f:"stretch"};if(!b.repeat.Ob)b.repeat.Ob=b.repeat.f;a=function(l,q){return{t:q(l[0]),r:q(l[1]||l[0]),b:q(l[2]||l[0]),l:q(l[3]||l[1]||l[0])}};b.slice=a(g,function(l){return f.n(l.k&m?l.d+"px":l.d)});if(j&&j[0])b.J=a(j,function(l){return l.W()?f.n(l.d):l.d});if(i&&i[0])b.Da=a(i,function(l){return l.Ca()?f.n(l.d):l.d})}return b}});f.Ic=f.B.ka({wa:"box-shadow",Fa:"boxShadow",la:function(a){var b,c=f.n,d=f.v.qa,e;if(a){e=new f.v(a);b={Da:[],Bb:[]};for(a=function(){for(var g,j,i,h,k,n;g=e.next();){i=g.d;
|
||||
j=g.k;if(j&d.pa&&i===",")break;else if(g.Ca()&&!k){e.D();k=e.ma(function(m){return!m.Ca()})}else if(j&d.z&&!h)h=i;else if(j&d.na&&i==="inset"&&!n)n=true;else return false}g=k&&k.length;if(g>1&&g<5){(n?b.Bb:b.Da).push({fe:c(k[0].d),ge:c(k[1].d),blur:c(k[2]?k[2].d:"0"),Vd:c(k[3]?k[3].d:"0"),color:f.ha(h||"currentColor")});return true}return false};a(););}return b&&(b.Bb.length||b.Da.length)?b:null}});f.Uc=f.B.ka({ia:f.B.va(function(){var a=this.e.currentStyle;return a.visibility+"|"+a.display}),la:function(){var a=
|
||||
this.e,b=a.runtimeStyle;a=a.currentStyle;var c=b.visibility,d;b.visibility="";d=a.visibility;b.visibility=c;return{ce:d!=="hidden",nd:a.display!=="none"}},i:function(){return false}});f.u={R:function(a){function b(c,d,e,g){this.e=c;this.s=d;this.g=e;this.parent=g}f.p.Eb(b.prototype,f.u,a);return b},Cb:false,Q:function(){return false},Ea:f.aa,Lb:function(){this.m();this.i()&&this.V()},ib:function(){this.Cb=true},Mb:function(){this.i()?this.V():this.m()},sb:function(a,b){this.vc(a);for(var c=this.ra||
|
||||
(this.ra=[]),d=a+1,e=c.length,g;d<e;d++)if(g=c[d])break;c[a]=b;this.I().insertBefore(b,g||null)},za:function(a){var b=this.ra;return b&&b[a]||null},vc:function(a){var b=this.za(a),c=this.Ta;if(b&&c){c.removeChild(b);this.ra[a]=null}},Aa:function(a,b,c,d){var e=this.rb||(this.rb={}),g=e[a];if(!g){g=e[a]=f.p.Za("shape");if(b)g.appendChild(g[b]=f.p.Za(b));if(d){c=this.za(d);if(!c){this.sb(d,doc.createElement("group"+d));c=this.za(d)}}c.appendChild(g);a=g.style;a.position="absolute";a.left=a.top=0;a.behavior=
|
||||
"url(#default#VML)"}return g},vb:function(a){var b=this.rb,c=b&&b[a];if(c){c.parentNode.removeChild(c);delete b[a]}return!!c},kc:function(a){var b=this.e,c=this.s.o(),d=c.h,e=c.f,g,j,i,h,k,n;c=a.x.tl.a(b,d);g=a.y.tl.a(b,e);j=a.x.tr.a(b,d);i=a.y.tr.a(b,e);h=a.x.br.a(b,d);k=a.y.br.a(b,e);n=a.x.bl.a(b,d);a=a.y.bl.a(b,e);d=Math.min(d/(c+j),e/(i+k),d/(n+h),e/(g+a));if(d<1){c*=d;g*=d;j*=d;i*=d;h*=d;k*=d;n*=d;a*=d}return{x:{tl:c,tr:j,br:h,bl:n},y:{tl:g,tr:i,br:k,bl:a}}},ya:function(a,b,c){b=b||1;var d,e,
|
||||
g=this.s.o();e=g.h*b;g=g.f*b;var j=this.g.G,i=Math.floor,h=Math.ceil,k=a?a.Jb*b:0,n=a?a.Ib*b:0,m=a?a.tb*b:0;a=a?a.Db*b:0;var p,r,t,v,l;if(c||j.i()){d=this.kc(c||j.j());c=d.x.tl*b;j=d.y.tl*b;p=d.x.tr*b;r=d.y.tr*b;t=d.x.br*b;v=d.y.br*b;l=d.x.bl*b;b=d.y.bl*b;e="m"+i(a)+","+i(j)+"qy"+i(c)+","+i(k)+"l"+h(e-p)+","+i(k)+"qx"+h(e-n)+","+i(r)+"l"+h(e-n)+","+h(g-v)+"qy"+h(e-t)+","+h(g-m)+"l"+i(l)+","+h(g-m)+"qx"+i(a)+","+h(g-b)+" x e"}else e="m"+i(a)+","+i(k)+"l"+h(e-n)+","+i(k)+"l"+h(e-n)+","+h(g-m)+"l"+i(a)+
|
||||
","+h(g-m)+"xe";return e},I:function(){var a=this.parent.za(this.N),b;if(!a){a=doc.createElement(this.Ya);b=a.style;b.position="absolute";b.top=b.left=0;this.parent.sb(this.N,a)}return a},mc:function(){var a=this.e,b=a.currentStyle,c=a.runtimeStyle,d=a.tagName,e=f.O===6,g;if(e&&(d in f.cc||d==="FIELDSET")||d==="BUTTON"||d==="INPUT"&&a.type in f.Gd){c.borderWidth="";d=this.g.w.wc;for(g=d.length;g--;){e=d[g];c["padding"+e]="";c["padding"+e]=f.n(b["padding"+e]).a(a)+f.n(b["border"+e+"Width"]).a(a)+(f.O!==
|
||||
8&&g%2?1:0)}c.borderWidth=0}else if(e){if(a.childNodes.length!==1||a.firstChild.tagName!=="ie6-mask"){b=doc.createElement("ie6-mask");d=b.style;d.visibility="visible";for(d.zoom=1;d=a.firstChild;)b.appendChild(d);a.appendChild(b);c.visibility="hidden"}}else c.borderColor="transparent"},ie:function(){},m:function(){this.parent.vc(this.N);delete this.rb;delete this.ra}};f.Rc=f.u.R({i:function(){var a=this.ed;for(var b in a)if(a.hasOwnProperty(b)&&a[b].i())return true;return false},Q:function(){return this.g.Pb.H()},
|
||||
ib:function(){if(this.i()){var a=this.jc(),b=a,c;a=a.currentStyle;var d=a.position,e=this.I().style,g=0,j=0;j=this.s.o();var i=j.Hd;if(d==="fixed"&&f.O>6){g=j.x*i;j=j.y*i;b=d}else{do b=b.offsetParent;while(b&&b.currentStyle.position==="static");if(b){c=b.getBoundingClientRect();b=b.currentStyle;g=(j.x-c.left)*i-(parseFloat(b.borderLeftWidth)||0);j=(j.y-c.top)*i-(parseFloat(b.borderTopWidth)||0)}else{b=doc.documentElement;g=(j.x+b.scrollLeft-b.clientLeft)*i;j=(j.y+b.scrollTop-b.clientTop)*i}b="absolute"}e.position=
|
||||
b;e.left=g;e.top=j;e.zIndex=d==="static"?-1:a.zIndex;this.Cb=true}},Mb:f.aa,Nb:function(){var a=this.g.Pb.j();this.I().style.display=a.ce&&a.nd?"":"none"},Lb:function(){this.i()?this.Nb():this.m()},jc:function(){var a=this.e;return a.tagName in f.Ac?a.offsetParent:a},I:function(){var a=this.Ta,b;if(!a){b=this.jc();a=this.Ta=doc.createElement("css3-container");a.style.direction="ltr";this.Nb();b.parentNode.insertBefore(a,b)}return a},ab:f.aa,m:function(){var a=this.Ta,b;if(a&&(b=a.parentNode))b.removeChild(a);
|
||||
delete this.Ta;delete this.ra}});f.Fc=f.u.R({N:2,Ya:"background",Q:function(){var a=this.g;return a.C.H()||a.G.H()},i:function(){var a=this.g;return a.q.i()||a.G.i()||a.C.i()||a.ga.i()&&a.ga.j().Bb},V:function(){var a=this.s.o();if(a.h&&a.f){this.od();this.pd()}},od:function(){var a=this.g.C.j(),b=this.s.o(),c=this.e,d=a&&a.color,e,g;if(d&&d.fa()>0){this.lc();a=this.Aa("bgColor","fill",this.I(),1);e=b.h;b=b.f;a.stroked=false;a.coordsize=e*2+","+b*2;a.coordorigin="1,1";a.path=this.ya(null,2);g=a.style;
|
||||
g.width=e;g.height=b;a.fill.color=d.U(c);c=d.fa();if(c<1)a.fill.opacity=c}else this.vb("bgColor")},pd:function(){var a=this.g.C.j(),b=this.s.o();a=a&&a.M;var c,d,e,g,j;if(a){this.lc();d=b.h;e=b.f;for(j=a.length;j--;){b=a[j];c=this.Aa("bgImage"+j,"fill",this.I(),2);c.stroked=false;c.fill.type="tile";c.fillcolor="none";c.coordsize=d*2+","+e*2;c.coordorigin="1,1";c.path=this.ya(0,2);g=c.style;g.width=d;g.height=e;if(b.P==="linear-gradient")this.bd(c,b);else{c.fill.src=b.Ab;this.Nd(c,j)}}}for(j=a?a.length:
|
||||
0;this.vb("bgImage"+j++););},Nd:function(a,b){var c=this;f.p.Rb(a.fill.src,function(d){var e=c.e,g=c.s.o(),j=g.h;g=g.f;if(j&&g){var i=a.fill,h=c.g,k=h.w.j(),n=k&&k.J;k=n?n.t.a(e):0;var m=n?n.r.a(e):0,p=n?n.b.a(e):0;n=n?n.l.a(e):0;h=h.C.j().M[b];e=h.$?h.$.coords(e,j-d.h-n-m,g-d.f-k-p):{x:0,y:0};h=h.bb;p=m=0;var r=j+1,t=g+1,v=f.O===8?0:1;n=Math.round(e.x)+n+0.5;k=Math.round(e.y)+k+0.5;i.position=n/j+","+k/g;i.size.x=1;i.size=d.h+"px,"+d.f+"px";if(h&&h!=="repeat"){if(h==="repeat-x"||h==="no-repeat"){m=
|
||||
k+1;t=k+d.f+v}if(h==="repeat-y"||h==="no-repeat"){p=n+1;r=n+d.h+v}a.style.clip="rect("+m+"px,"+r+"px,"+t+"px,"+p+"px)"}}})},bd:function(a,b){var c=this.e,d=this.s.o(),e=d.h,g=d.f;a=a.fill;d=b.ca;var j=d.length,i=Math.PI,h=f.Na,k=h.tc,n=h.dc;b=h.gc(c,e,g,b);h=b.sa;var m=b.xc,p=b.yc,r=b.Wd,t=b.Xd,v=b.rd,l=b.sd,q=b.kd,s=b.ld;b=b.rc;e=h%90?Math.atan2(q*e/g,s)/i*180:h+90;e+=180;e%=360;v=k(r,t,h,v,l);g=n(r,t,v[0],v[1]);i=[];v=k(m,p,h,r,t);n=n(m,p,v[0],v[1])/g*100;k=[];for(h=0;h<j;h++)k.push(d[h].db?d[h].db.a(c,
|
||||
b):h===0?0:h===j-1?b:null);for(h=1;h<j;h++){if(k[h]===null){m=k[h-1];b=h;do p=k[++b];while(p===null);k[h]=m+(p-m)/(b-h+1)}k[h]=Math.max(k[h],k[h-1])}for(h=0;h<j;h++)i.push(n+k[h]/g*100+"% "+d[h].color.U(c));a.angle=e;a.type="gradient";a.method="sigma";a.color=d[0].color.U(c);a.color2=d[j-1].color.U(c);if(a.colors)a.colors.value=i.join(",");else a.colors=i.join(",")},lc:function(){var a=this.e.runtimeStyle;a.backgroundImage="url(about:blank)";a.backgroundColor="transparent"},m:function(){f.u.m.call(this);
|
||||
var a=this.e.runtimeStyle;a.backgroundImage=a.backgroundColor=""}});f.Gc=f.u.R({N:4,Ya:"border",Q:function(){var a=this.g;return a.w.H()||a.G.H()},i:function(){var a=this.g;return a.G.i()&&!a.q.i()&&a.w.i()},V:function(){var a=this.e,b=this.g.w.j(),c=this.s.o(),d=c.h;c=c.f;var e,g,j,i,h;if(b){this.mc();b=this.wd(2);i=0;for(h=b.length;i<h;i++){j=b[i];e=this.Aa("borderPiece"+i,j.stroke?"stroke":"fill",this.I());e.coordsize=d*2+","+c*2;e.coordorigin="1,1";e.path=j.path;g=e.style;g.width=d;g.height=c;
|
||||
e.filled=!!j.fill;e.stroked=!!j.stroke;if(j.stroke){e=e.stroke;e.weight=j.Qb+"px";e.color=j.color.U(a);e.dashstyle=j.stroke==="dashed"?"2 2":j.stroke==="dotted"?"1 1":"solid";e.linestyle=j.stroke==="double"&&j.Qb>2?"ThinThin":"Single"}else e.fill.color=j.fill.U(a)}for(;this.vb("borderPiece"+i++););}},wd:function(a){var b=this.e,c,d,e,g=this.g.w,j=[],i,h,k,n,m=Math.round,p,r,t;if(g.i()){c=g.j();g=c.J;r=c.Zd;t=c.gd;if(c.ee&&c.$d&&c.hd){if(t.t.fa()>0){c=g.t.a(b);k=c/2;j.push({path:this.ya({Jb:k,Ib:k,
|
||||
tb:k,Db:k},a),stroke:r.t,color:t.t,Qb:c})}}else{a=a||1;c=this.s.o();d=c.h;e=c.f;c=m(g.t.a(b));k=m(g.r.a(b));n=m(g.b.a(b));b=m(g.l.a(b));var v={t:c,r:k,b:n,l:b};b=this.g.G;if(b.i())p=this.kc(b.j());i=Math.floor;h=Math.ceil;var l=function(o,u){return p?p[o][u]:0},q=function(o,u,x,y,z,B){var E=l("x",o),D=l("y",o),C=o.charAt(1)==="r";o=o.charAt(0)==="b";return E>0&&D>0?(B?"al":"ae")+(C?h(d-E):i(E))*a+","+(o?h(e-D):i(D))*a+","+(i(E)-u)*a+","+(i(D)-x)*a+","+y*65535+","+2949075*(z?1:-1):(B?"m":"l")+(C?d-
|
||||
u:u)*a+","+(o?e-x:x)*a},s=function(o,u,x,y){var z=o==="t"?i(l("x","tl"))*a+","+h(u)*a:o==="r"?h(d-u)*a+","+i(l("y","tr"))*a:o==="b"?h(d-l("x","br"))*a+","+i(e-u)*a:i(u)*a+","+h(e-l("y","bl"))*a;o=o==="t"?h(d-l("x","tr"))*a+","+h(u)*a:o==="r"?h(d-u)*a+","+h(e-l("y","br"))*a:o==="b"?i(l("x","bl"))*a+","+i(e-u)*a:i(u)*a+","+i(l("y","tl"))*a;return x?(y?"m"+o:"")+"l"+z:(y?"m"+z:"")+"l"+o};b=function(o,u,x,y,z,B){var E=o==="l"||o==="r",D=v[o],C,F;if(D>0&&r[o]!=="none"&&t[o].fa()>0){C=v[E?o:u];u=v[E?u:
|
||||
o];F=v[E?o:x];x=v[E?x:o];if(r[o]==="dashed"||r[o]==="dotted"){j.push({path:q(y,C,u,B+45,0,1)+q(y,0,0,B,1,0),fill:t[o]});j.push({path:s(o,D/2,0,1),stroke:r[o],Qb:D,color:t[o]});j.push({path:q(z,F,x,B,0,1)+q(z,0,0,B-45,1,0),fill:t[o]})}else j.push({path:q(y,C,u,B+45,0,1)+s(o,D,0,0)+q(z,F,x,B,0,0)+(r[o]==="double"&&D>2?q(z,F-i(F/3),x-i(x/3),B-45,1,0)+s(o,h(D/3*2),1,0)+q(y,C-i(C/3),u-i(u/3),B,1,0)+"x "+q(y,i(C/3),i(u/3),B+45,0,1)+s(o,i(D/3),1,0)+q(z,i(F/3),i(x/3),B,0,0):"")+q(z,0,0,B-45,1,0)+s(o,0,1,
|
||||
0)+q(y,0,0,B,1,0),fill:t[o]})}};b("t","l","r","tl","tr",90);b("r","t","b","tr","br",0);b("b","r","l","br","bl",-90);b("l","b","t","bl","tl",-180)}}return j},m:function(){if(this.ec||!this.g.q.i())this.e.runtimeStyle.borderColor="";f.u.m.call(this)}});f.Tb=f.u.R({N:5,Md:["t","tr","r","br","b","bl","l","tl","c"],Q:function(){return this.g.q.H()},i:function(){return this.g.q.i()},V:function(){this.I();var a=this.g.q.j(),b=this.g.w.j(),c=this.s.o(),d=this.e,e=this.uc;f.p.Rb(a.src,function(g){function j(s,
|
||||
o,u,x,y){s=e[s].style;var z=Math.max;s.width=z(o,0);s.height=z(u,0);s.left=x;s.top=y}function i(s,o,u){for(var x=0,y=s.length;x<y;x++)e[s[x]].imagedata[o]=u}var h=c.h,k=c.f,n=f.n("0"),m=a.J||(b?b.J:{t:n,r:n,b:n,l:n});n=m.t.a(d);var p=m.r.a(d),r=m.b.a(d);m=m.l.a(d);var t=a.slice,v=t.t.a(d),l=t.r.a(d),q=t.b.a(d);t=t.l.a(d);j("tl",m,n,0,0);j("t",h-m-p,n,m,0);j("tr",p,n,h-p,0);j("r",p,k-n-r,h-p,n);j("br",p,r,h-p,k-r);j("b",h-m-p,r,m,k-r);j("bl",m,r,0,k-r);j("l",m,k-n-r,0,n);j("c",h-m-p,k-n-r,m,n);i(["tl",
|
||||
"t","tr"],"cropBottom",(g.f-v)/g.f);i(["tl","l","bl"],"cropRight",(g.h-t)/g.h);i(["bl","b","br"],"cropTop",(g.f-q)/g.f);i(["tr","r","br"],"cropLeft",(g.h-l)/g.h);i(["l","r","c"],"cropTop",v/g.f);i(["l","r","c"],"cropBottom",q/g.f);i(["t","b","c"],"cropLeft",t/g.h);i(["t","b","c"],"cropRight",l/g.h);e.c.style.display=a.fill?"":"none"},this)},I:function(){var a=this.parent.za(this.N),b,c,d,e=this.Md,g=e.length;if(!a){a=doc.createElement("border-image");b=a.style;b.position="absolute";this.uc={};for(d=
|
||||
0;d<g;d++){c=this.uc[e[d]]=f.p.Za("rect");c.appendChild(f.p.Za("imagedata"));b=c.style;b.behavior="url(#default#VML)";b.position="absolute";b.top=b.left=0;c.imagedata.src=this.g.q.j().src;c.stroked=false;c.filled=false;a.appendChild(c)}this.parent.sb(this.N,a)}return a},Ea:function(){if(this.i()){var a=this.e,b=a.runtimeStyle,c=this.g.q.j().J;b.borderStyle="solid";if(c){b.borderTopWidth=c.t.a(a)+"px";b.borderRightWidth=c.r.a(a)+"px";b.borderBottomWidth=c.b.a(a)+"px";b.borderLeftWidth=c.l.a(a)+"px"}this.mc()}},
|
||||
m:function(){var a=this.e.runtimeStyle;a.borderStyle="";if(this.ec||!this.g.w.i())a.borderColor=a.borderWidth="";f.u.m.call(this)}});f.Hc=f.u.R({N:1,Ya:"outset-box-shadow",Q:function(){var a=this.g;return a.ga.H()||a.G.H()},i:function(){var a=this.g.ga;return a.i()&&a.j().Da[0]},V:function(){function a(C,F,O,H,M,P,I){C=b.Aa("shadow"+C+F,"fill",d,j-C);F=C.fill;C.coordsize=n*2+","+m*2;C.coordorigin="1,1";C.stroked=false;C.filled=true;F.color=M.U(c);if(P){F.type="gradienttitle";F.color2=F.color;F.opacity=
|
||||
0}C.path=I;l=C.style;l.left=O;l.top=H;l.width=n;l.height=m;return C}var b=this,c=this.e,d=this.I(),e=this.g,g=e.ga.j().Da;e=e.G.j();var j=g.length,i=j,h,k=this.s.o(),n=k.h,m=k.f;k=f.O===8?1:0;for(var p=["tl","tr","br","bl"],r,t,v,l,q,s,o,u,x,y,z,B,E,D;i--;){t=g[i];q=t.fe.a(c);s=t.ge.a(c);h=t.Vd.a(c);o=t.blur.a(c);t=t.color;u=-h-o;if(!e&&o)e=f.jb.Dc;u=this.ya({Jb:u,Ib:u,tb:u,Db:u},2,e);if(o){x=(h+o)*2+n;y=(h+o)*2+m;z=x?o*2/x:0;B=y?o*2/y:0;if(o-h>n/2||o-h>m/2)for(h=4;h--;){r=p[h];E=r.charAt(0)==="b";
|
||||
D=r.charAt(1)==="r";r=a(i,r,q,s,t,o,u);v=r.fill;v.focusposition=(D?1-z:z)+","+(E?1-B:B);v.focussize="0,0";r.style.clip="rect("+((E?y/2:0)+k)+"px,"+(D?x:x/2)+"px,"+(E?y:y/2)+"px,"+((D?x/2:0)+k)+"px)"}else{r=a(i,"",q,s,t,o,u);v=r.fill;v.focusposition=z+","+B;v.focussize=1-z*2+","+(1-B*2)}}else{r=a(i,"",q,s,t,o,u);q=t.fa();if(q<1)r.fill.opacity=q}}}});f.Pc=f.u.R({N:6,Ya:"imgEl",Q:function(){var a=this.g;return this.e.src!==this.Xc||a.G.H()},i:function(){var a=this.g;return a.G.i()||a.C.qc()},V:function(){this.Xc=
|
||||
j;this.Cd();var a=this.Aa("img","fill",this.I()),b=a.fill,c=this.s.o(),d=c.h;c=c.f;var e=this.g.w.j(),g=e&&e.J;e=this.e;var j=e.src,i=Math.round,h=e.currentStyle,k=f.n;if(!g||f.O<7){g=f.n("0");g={t:g,r:g,b:g,l:g}}a.stroked=false;b.type="frame";b.src=j;b.position=(d?0.5/d:0)+","+(c?0.5/c:0);a.coordsize=d*2+","+c*2;a.coordorigin="1,1";a.path=this.ya({Jb:i(g.t.a(e)+k(h.paddingTop).a(e)),Ib:i(g.r.a(e)+k(h.paddingRight).a(e)),tb:i(g.b.a(e)+k(h.paddingBottom).a(e)),Db:i(g.l.a(e)+k(h.paddingLeft).a(e))},
|
||||
2);a=a.style;a.width=d;a.height=c},Cd:function(){this.e.runtimeStyle.filter="alpha(opacity=0)"},m:function(){f.u.m.call(this);this.e.runtimeStyle.filter=""}});f.Oc=f.u.R({ib:f.aa,Mb:f.aa,Nb:f.aa,Lb:f.aa,Ld:/^,+|,+$/g,Fd:/,+/g,gb:function(a,b){(this.pb||(this.pb=[]))[a]=b||void 0},ab:function(){var a=this.pb,b;if(a&&(b=a.join(",").replace(this.Ld,"").replace(this.Fd,","))!==this.Wc)this.Wc=this.e.runtimeStyle.background=b},m:function(){this.e.runtimeStyle.background="";delete this.pb}});f.Mc=f.u.R({ua:1,
|
||||
Q:function(){return this.g.C.H()},i:function(){var a=this.g;return a.C.i()||a.q.i()},V:function(){var a=this.g.C.j(),b,c,d=0,e,g;if(a){b=[];if(c=a.M)for(;e=c[d++];)if(e.P==="linear-gradient"){g=this.vd(e.Wa);g=(e.Xa||f.Ka.Kc).a(this.e,g.h,g.f,g.h,g.f);b.push("url(data:image/svg+xml,"+escape(this.xd(e,g.h,g.f))+") "+this.dd(e.$)+" / "+g.h+"px "+g.f+"px "+(e.bc||"")+" "+(e.Wa||"")+" "+(e.ub||""))}else b.push(e.Hb);a.color&&b.push(a.color.Y);this.parent.gb(this.ua,b.join(","))}},dd:function(a){return a?
|
||||
a.X.map(function(b){return b.d}).join(" "):"0 0"},vd:function(a){var b=this.e,c=this.s.o(),d=c.h;c=c.f;var e;if(a!=="border-box")if((e=this.g.w.j())&&(e=e.J)){d-=e.l.a(b)+e.l.a(b);c-=e.t.a(b)+e.b.a(b)}if(a==="content-box"){a=f.n;e=b.currentStyle;d-=a(e.paddingLeft).a(b)+a(e.paddingRight).a(b);c-=a(e.paddingTop).a(b)+a(e.paddingBottom).a(b)}return{h:d,f:c}},xd:function(a,b,c){var d=this.e,e=a.ca,g=e.length,j=f.Na.gc(d,b,c,a);a=j.xc;var i=j.yc,h=j.td,k=j.ud;j=j.rc;var n,m,p,r,t;n=[];for(m=0;m<g;m++)n.push(e[m].db?
|
||||
e[m].db.a(d,j):m===0?0:m===g-1?j:null);for(m=1;m<g;m++)if(n[m]===null){r=n[m-1];p=m;do t=n[++p];while(t===null);n[m]=r+(t-r)/(p-m+1)}b=['<svg width="'+b+'" height="'+c+'" xmlns="http://www.w3.org/2000/svg"><defs><linearGradient id="g" gradientUnits="userSpaceOnUse" x1="'+a/b*100+'%" y1="'+i/c*100+'%" x2="'+h/b*100+'%" y2="'+k/c*100+'%">'];for(m=0;m<g;m++)b.push('<stop offset="'+n[m]/j+'" stop-color="'+e[m].color.U(d)+'" stop-opacity="'+e[m].color.fa()+'"/>');b.push('</linearGradient></defs><rect width="100%" height="100%" fill="url(#g)"/></svg>');
|
||||
return b.join("")},m:function(){this.parent.gb(this.ua)}});f.Nc=f.u.R({T:"repeat",Sc:"stretch",Qc:"round",ua:0,Q:function(){return this.g.q.H()},i:function(){return this.g.q.i()},V:function(){var a=this,b=a.g.q.j(),c=a.g.w.j(),d=a.s.o(),e=b.repeat,g=e.f,j=e.Ob,i=a.e,h=0;f.p.Rb(b.src,function(k){function n(Q,R,U,V,W,Y,X,S,w,A){K.push('<pattern patternUnits="userSpaceOnUse" id="pattern'+G+'" x="'+(g===l?Q+U/2-w/2:Q)+'" y="'+(j===l?R+V/2-A/2:R)+'" width="'+w+'" height="'+A+'"><svg width="'+w+'" height="'+
|
||||
A+'" viewBox="'+W+" "+Y+" "+X+" "+S+'" preserveAspectRatio="none"><image xlink:href="'+v+'" x="0" y="0" width="'+r+'" height="'+t+'" /></svg></pattern>');J.push('<rect x="'+Q+'" y="'+R+'" width="'+U+'" height="'+V+'" fill="url(#pattern'+G+')" />');G++}var m=d.h,p=d.f,r=k.h,t=k.f,v=a.Dd(b.src,r,t),l=a.T,q=a.Sc;k=a.Qc;var s=Math.ceil,o=f.n("0"),u=b.J||(c?c.J:{t:o,r:o,b:o,l:o});o=u.t.a(i);var x=u.r.a(i),y=u.b.a(i);u=u.l.a(i);var z=b.slice,B=z.t.a(i),E=z.r.a(i),D=z.b.a(i);z=z.l.a(i);var C=m-u-x,F=p-o-
|
||||
y,O=r-z-E,H=t-B-D,M=g===q?C:O*o/B,P=j===q?F:H*x/E,I=g===q?C:O*y/D;q=j===q?F:H*u/z;var K=[],J=[],G=0;if(g===k){M-=(M-(C%M||M))/s(C/M);I-=(I-(C%I||I))/s(C/I)}if(j===k){P-=(P-(F%P||P))/s(F/P);q-=(q-(F%q||q))/s(F/q)}k=['<svg width="'+m+'" height="'+p+'" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink">'];n(0,0,u,o,0,0,z,B,u,o);n(u,0,C,o,z,0,O,B,M,o);n(m-x,0,x,o,r-E,0,E,B,x,o);n(0,o,u,F,0,B,z,H,u,q);if(b.fill)n(u,o,C,F,z,B,O,H,M||I||O,q||P||H);n(m-x,o,x,F,r-E,B,E,H,x,P);n(0,
|
||||
p-y,u,y,0,t-D,z,D,u,y);n(u,p-y,C,y,z,t-D,O,D,I,y);n(m-x,p-y,x,y,r-E,t-D,E,D,x,y);k.push("<defs>"+K.join("\n")+"</defs>"+J.join("\n")+"</svg>");a.parent.gb(a.ua,"url(data:image/svg+xml,"+escape(k.join(""))+") no-repeat border-box border-box");h&&a.parent.ab()},a);h=1},Dd:function(){var a={};return function(b,c,d){var e=a[b],g;if(!e){e=new Image;g=doc.createElement("canvas");e.src=b;g.width=c;g.height=d;g.getContext("2d").drawImage(e,0,0);e=a[b]=g.toDataURL()}return e}}(),Ea:f.Tb.prototype.Ea,m:function(){var a=
|
||||
this.e.runtimeStyle;this.parent.gb(this.ua);a.borderColor=a.borderStyle=a.borderWidth=""}});f.kb=function(){function a(l,q){l.className+=" "+q}function b(l){var q=v.slice.call(arguments,1),s=q.length;setTimeout(function(){if(l)for(;s--;)a(l,q[s])},0)}function c(l){var q=v.slice.call(arguments,1),s=q.length;setTimeout(function(){if(l)for(;s--;){var o=q[s];o=t[o]||(t[o]=new RegExp("\\b"+o+"\\b","g"));l.className=l.className.replace(o,"")}},0)}function d(l){function q(){if(!U){var w,A,L=f.ja,T=l.currentStyle,
|
||||
N=T.getAttribute(g)==="true",da=T.getAttribute(i)!=="false",ea=T.getAttribute(h)!=="false";S=T.getAttribute(j);S=L>7?S!=="false":S==="true";if(!R){R=1;l.runtimeStyle.zoom=1;T=l;for(var fa=1;T=T.previousSibling;)if(T.nodeType===1){fa=0;break}fa&&a(l,p)}J.cb();if(N&&(A=J.o())&&(w=doc.documentElement||doc.body)&&(A.y>w.clientHeight||A.x>w.clientWidth||A.y+A.f<0||A.x+A.h<0)){if(!Y){Y=1;f.mb.ba(q)}}else{U=1;Y=R=0;f.mb.Ha(q);if(L===9){G={C:new f.Sb(l),q:new f.Ub(l),w:new f.Vb(l)};Q=[G.C,G.q];K=new f.Oc(l,
|
||||
J,G);w=[new f.Mc(l,J,G,K),new f.Nc(l,J,G,K)]}else{G={C:new f.Sb(l),w:new f.Vb(l),q:new f.Ub(l),G:new f.jb(l),ga:new f.Ic(l),Pb:new f.Uc(l)};Q=[G.C,G.w,G.q,G.G,G.ga,G.Pb];K=new f.Rc(l,J,G);w=[new f.Hc(l,J,G,K),new f.Fc(l,J,G,K),new f.Gc(l,J,G,K),new f.Tb(l,J,G,K)];l.tagName==="IMG"&&w.push(new f.Pc(l,J,G,K));K.ed=w}I=[K].concat(w);if(w=l.currentStyle.getAttribute(f.F+"watch-ancestors")){w=parseInt(w,10);A=0;for(N=l.parentNode;N&&(w==="NaN"||A++<w);){H(N,"onpropertychange",C);H(N,"onmouseenter",x);
|
||||
H(N,"onmouseleave",y);H(N,"onmousedown",z);if(N.tagName in f.fc){H(N,"onfocus",E);H(N,"onblur",D)}N=N.parentNode}}if(S){f.Oa.ba(o);f.Oa.Rd()}o(1)}if(!V){V=1;L<9&&H(l,"onmove",s);H(l,"onresize",s);H(l,"onpropertychange",u);ea&&H(l,"onmouseenter",x);if(ea||da)H(l,"onmouseleave",y);da&&H(l,"onmousedown",z);if(l.tagName in f.fc){H(l,"onfocus",E);H(l,"onblur",D)}f.Qa.ba(s);f.L.ba(M)}J.hb()}}function s(){J&&J.Ad()&&o()}function o(w){if(!X)if(U){var A,L=I.length;F();for(A=0;A<L;A++)I[A].Ea();if(w||J.Od())for(A=
|
||||
0;A<L;A++)I[A].ib();if(w||J.Td())for(A=0;A<L;A++)I[A].Mb();K.ab();O()}else R||q()}function u(){var w,A=I.length,L;w=event;if(!X&&!(w&&w.propertyName in r))if(U){F();for(w=0;w<A;w++)I[w].Ea();for(w=0;w<A;w++){L=I[w];L.Cb||L.ib();L.Q()&&L.Lb()}K.ab();O()}else R||q()}function x(){b(l,k)}function y(){c(l,k,n)}function z(){b(l,n);f.lb.ba(B)}function B(){c(l,n);f.lb.Ha(B)}function E(){b(l,m)}function D(){c(l,m)}function C(){var w=event.propertyName;if(w==="className"||w==="id")u()}function F(){J.cb();for(var w=
|
||||
Q.length;w--;)Q[w].cb()}function O(){for(var w=Q.length;w--;)Q[w].hb();J.hb()}function H(w,A,L){w.attachEvent(A,L);W.push([w,A,L])}function M(){if(V){for(var w=W.length,A;w--;){A=W[w];A[0].detachEvent(A[1],A[2])}f.L.Ha(M);V=0;W=[]}}function P(){if(!X){var w,A;M();X=1;if(I){w=0;for(A=I.length;w<A;w++){I[w].ec=1;I[w].m()}}S&&f.Oa.Ha(o);f.Qa.Ha(o);I=J=G=Q=l=null}}var I,K,J=new ha(l),G,Q,R,U,V,W=[],Y,X,S;this.Ed=q;this.update=o;this.m=P;this.qd=l}var e={},g=f.F+"lazy-init",j=f.F+"poll",i=f.F+"track-active",
|
||||
h=f.F+"track-hover",k=f.La+"hover",n=f.La+"active",m=f.La+"focus",p=f.La+"first-child",r={background:1,bgColor:1,display:1},t={},v=[];d.yd=function(l){var q=f.p.Ba(l);return e[q]||(e[q]=new d(l))};d.m=function(l){l=f.p.Ba(l);var q=e[l];if(q){q.m();delete e[l]}};d.md=function(){var l=[],q;if(e){for(var s in e)if(e.hasOwnProperty(s)){q=e[s];l.push(q.qd);q.m()}e={}}return l};return d}();f.supportsVML=f.zc;f.attach=function(a){f.ja<10&&f.zc&&f.kb.yd(a).Ed()};f.detach=function(a){f.kb.m(a)}};
|
||||
var $=element;function init(){if(doc.media!=="print"){var a=window.PIE;a&&a.attach($)}}function cleanup(){if(doc.media!=="print"){var a=window.PIE;if(a){a.detach($);$=0}}}$.readyState==="complete"&&init();
|
||||
</script>
|
||||
</PUBLIC:COMPONENT>
|
||||
BIN
app/assets/img/100x100.gif
Normal file
BIN
app/assets/img/100x100.gif
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 336 B |
BIN
app/assets/img/130x100.gif
Normal file
BIN
app/assets/img/130x100.gif
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 414 B |
BIN
app/assets/img/180x120.gif
Normal file
BIN
app/assets/img/180x120.gif
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 587 B |
BIN
app/assets/img/200x120.gif
Normal file
BIN
app/assets/img/200x120.gif
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 633 B |
BIN
app/assets/img/300x200.gif
Normal file
BIN
app/assets/img/300x200.gif
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.1 KiB |
BIN
app/assets/img/32x32.gif
Normal file
BIN
app/assets/img/32x32.gif
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 117 B |
BIN
app/assets/img/350x250.gif
Normal file
BIN
app/assets/img/350x250.gif
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.3 KiB |
BIN
app/assets/img/400x300.gif
Normal file
BIN
app/assets/img/400x300.gif
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.5 KiB |
BIN
app/assets/img/64x64.gif
Normal file
BIN
app/assets/img/64x64.gif
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 239 B |
Binary file not shown.
|
Before Width: | Height: | Size: 36 KiB |
BIN
app/assets/img/alpha-10.png
Normal file
BIN
app/assets/img/alpha-10.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/alpha-20.png
Normal file
BIN
app/assets/img/alpha-20.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/alpha-30.png
Normal file
BIN
app/assets/img/alpha-30.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/alpha-40.png
Normal file
BIN
app/assets/img/alpha-40.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/alpha-50.png
Normal file
BIN
app/assets/img/alpha-50.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/alpha-60.png
Normal file
BIN
app/assets/img/alpha-60.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/alpha-70.png
Normal file
BIN
app/assets/img/alpha-70.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/alpha-80.png
Normal file
BIN
app/assets/img/alpha-80.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/alpha-90.png
Normal file
BIN
app/assets/img/alpha-90.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/alpha-w-10.png
Normal file
BIN
app/assets/img/alpha-w-10.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 922 B |
BIN
app/assets/img/alpha-w-20.png
Normal file
BIN
app/assets/img/alpha-w-20.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 922 B |
BIN
app/assets/img/alpha-w-30.png
Normal file
BIN
app/assets/img/alpha-w-30.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 922 B |
BIN
app/assets/img/alpha-w-40.png
Normal file
BIN
app/assets/img/alpha-w-40.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 922 B |
BIN
app/assets/img/alpha-w-50.png
Normal file
BIN
app/assets/img/alpha-w-50.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 922 B |
BIN
app/assets/img/alpha-w-60.png
Normal file
BIN
app/assets/img/alpha-w-60.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 922 B |
BIN
app/assets/img/alpha-w-70.png
Normal file
BIN
app/assets/img/alpha-w-70.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 922 B |
BIN
app/assets/img/alpha-w-80.png
Normal file
BIN
app/assets/img/alpha-w-80.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 922 B |
BIN
app/assets/img/alpha-w-90.png
Normal file
BIN
app/assets/img/alpha-w-90.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 922 B |
BIN
app/assets/img/alpha.png
Normal file
BIN
app/assets/img/alpha.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/avatar-large.jpg
Normal file
BIN
app/assets/img/avatar-large.jpg
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 13 KiB |
BIN
app/assets/img/avatar-small.jpg
Normal file
BIN
app/assets/img/avatar-small.jpg
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 3.2 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 739 B |
BIN
app/assets/img/border.png
Normal file
BIN
app/assets/img/border.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 921 B |
BIN
app/assets/img/cascade icons/logo-.png
Normal file
BIN
app/assets/img/cascade icons/logo-.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.1 KiB |
BIN
app/assets/img/cascade icons/logo-grey-.png
Normal file
BIN
app/assets/img/cascade icons/logo-grey-.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.3 KiB |
BIN
app/assets/img/cascade icons/logo-grey.png
Normal file
BIN
app/assets/img/cascade icons/logo-grey.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 6.4 KiB |
BIN
app/assets/img/cascade icons/logo-large-grey.png
Normal file
BIN
app/assets/img/cascade icons/logo-large-grey.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.8 KiB |
BIN
app/assets/img/cascade icons/logo-large-reverse.png
Normal file
BIN
app/assets/img/cascade icons/logo-large-reverse.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.3 KiB |
BIN
app/assets/img/cascade icons/logo-large.png
Normal file
BIN
app/assets/img/cascade icons/logo-large.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.4 KiB |
BIN
app/assets/img/cascade icons/logo-masthead.png
Normal file
BIN
app/assets/img/cascade icons/logo-masthead.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.3 KiB |
BIN
app/assets/img/cascade icons/logo-reverse.png
Normal file
BIN
app/assets/img/cascade icons/logo-reverse.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.1 KiB |
BIN
app/assets/img/cascade icons/logo-small-.png
Normal file
BIN
app/assets/img/cascade icons/logo-small-.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1022 B |
BIN
app/assets/img/cascade icons/logo-small-bg-selected.png
Normal file
BIN
app/assets/img/cascade icons/logo-small-bg-selected.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.2 KiB |
BIN
app/assets/img/cascade icons/logo-small-bg.png
Normal file
BIN
app/assets/img/cascade icons/logo-small-bg.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.2 KiB |
BIN
app/assets/img/cascade icons/logo-small-grey-.png
Normal file
BIN
app/assets/img/cascade icons/logo-small-grey-.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1012 B |
BIN
app/assets/img/cascade icons/logo-small-grey.png
Normal file
BIN
app/assets/img/cascade icons/logo-small-grey.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 2.1 KiB |
BIN
app/assets/img/cascade icons/logo-small-reverse.png
Normal file
BIN
app/assets/img/cascade icons/logo-small-reverse.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.1 KiB |
BIN
app/assets/img/cascade icons/logo-small.png
Normal file
BIN
app/assets/img/cascade icons/logo-small.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 2.1 KiB |
BIN
app/assets/img/cascade icons/logo-smaller-.png
Normal file
BIN
app/assets/img/cascade icons/logo-smaller-.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.4 KiB |
BIN
app/assets/img/cascade icons/logo-smaller-grey-.png
Normal file
BIN
app/assets/img/cascade icons/logo-smaller-grey-.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 1.3 KiB |
BIN
app/assets/img/cascade icons/logo-smaller-grey.png
Normal file
BIN
app/assets/img/cascade icons/logo-smaller-grey.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 3.9 KiB |
BIN
app/assets/img/cascade icons/logo-smaller.png
Normal file
BIN
app/assets/img/cascade icons/logo-smaller.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 4.3 KiB |
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue
Block a user